Searched refs:FR8 (Results 26 – 33 of 33) sorted by relevance
12
| /dports/biology/emboss/EMBOSS-6.6.0/emboss/data/ |
| H A D | Epdbtosp.dat | 41681 EN 1FR8
|
| /dports/biology/emboss/EMBOSS-6.6.0/test/data/structure/ |
| H A D | Epdbtosp.dat | 41681 EN 1FR8
|
| /dports/audio/rhvoice/RHVoice-1.2.4/src/third-party/cldr/tools/java/org/unicode/cldr/util/data/external/ |
| H A D | 2013-1_UNLOCODE_CodeListPart3.csv | 15182 ,"US","FR8","Fort Drum","Fort Drum","FL","--3-----","RL","0901",,"2731N 08048W",
|
| /dports/science/py-oddt/oddt-0.7/oddt/toolkits/extras/ |
| H A D | pdb_residue_templates.smi | 14439 NC(=O)c1cn(cn1)C(CO)CCn1ccc2ccc(cc21)NC(=O)CCCCc1ccccc1 FR8
|
| /dports/games/libretro-mame2003_plus/mame2003-plus-libretro-17e9889/metadata/ |
| H A D | history.dat | 81037 FR8-871-TLK : Level 63, Armor-Fight-Magic-Speed-Shot powerups, 1500 HP, 10 Keys, 10 Bombs, 1657 Poi…
|
| /dports/security/hashcat-legacy/hashcat-legacy-2.00/salts/ |
| H A D | brute-vbulletin.salt | 347725 FR8
|
| /dports/math/py-heyoka/heyoka.py-0.16.0/doc/notebooks/ |
| H A D | The Maxwell-Boltzmann distribution.ipynb | 309303 "FR8+fECBAgX+dbFMn63ftBVvF6bByQaoOM0MFy9eRM2aNUVnfZeVlRUa1K2JytNPIbOdDMnKDTEx\\\n",
692155 "FR8/ftRAaebMnzsLBd3ywquwG4YO6pfu6x8/fowihfKjR5ua8CrshqCgoEz1xMXF8c9YIgFUKSn4\\\n",
|
| H A D | tides_spokes.ipynb | 716446 "0Sm5l98CA26ECx50vbMUt95XR0s6yl+FR8+BvcvjnkjKOwa0pCOr2ACPngebp8AZt8MZt0FBUdxT\\\n",
|
12