Searched refs:IPL (Results 851 – 870 of 870) sorted by relevance
1...<<3132333435
| /dports/devel/avr-gcc/gcc-10.2.0/gcc/doc/ |
| H A D | gcc.info | 33698 Priority Level (IPL) is copied to the current IPL which has the
|
| /dports/lang/gcc11/gcc-11.2.0/gcc/doc/ |
| H A D | gcc.info | 35806 Priority Level (IPL) is copied to the current IPL which has the
|
| /dports/misc/cxx_atomics_pic/gcc-11.2.0/gcc/doc/ |
| H A D | gcc.info | 35806 Priority Level (IPL) is copied to the current IPL which has the
|
| /dports/lang/gcc9-aux/gcc-9.1.0/gcc/doc/ |
| H A D | gcc.info | 32264 Priority Level (IPL) is copied to the current IPL which has the
|
| /dports/lang/gcc10/gcc-10.3.0/gcc/doc/ |
| H A D | gcc.info | 33772 Priority Level (IPL) is copied to the current IPL which has the
|
| /dports/math/spot/spot-2.10.2/ |
| H A D | ChangeLog | 26991 closer to his original paper in IPL.
|
| /dports/math/py-spot/spot-2.10.2/ |
| H A D | ChangeLog | 26991 closer to his original paper in IPL.
|
| /dports/science/py-oddt/oddt-0.7/oddt/toolkits/extras/ |
| H A D | pdb_residue_templates.smi | 16295 O=P(O)(O)OCCCc1c[nH]c2ccccc12 IPL
|
| /dports/textproc/ro-hunspell/ro-hunspell-3.3.10/ |
| H A D | ro_RO.dic | 7096 IPL
|
| H A D | ro_RO-ante1993.dic | 7096 IPL
|
| /dports/editors/texstudio/texstudio-4.1.2/utilities/dictionaries/ |
| H A D | ro_RO-Romanian.dic | 7096 IPL
|
| /dports/www/dooble/dooble-2021.12.05/Dictionaries/ro/ |
| H A D | ro_RO.dic | 7082 IPL
|
| /dports/audio/rhvoice/RHVoice-1.2.4/src/third-party/cldr/tools/java/org/unicode/cldr/util/data/external/ |
| H A D | 2013-1_UNLOCODE_CodeListPart1.csv | 6960 ,"BR","IPL","Itaiopolis","Itaiopolis","SC","--3-----","RQ","0607",,,
|
| /dports/astro/weather/weather-2.4.2/ |
| H A D | airports.csv | 33956 …01812699995,-115.57900238,-54,"NA","US","US-CA","Imperial","no","KIPL","IPL","IPL",,"https://en.wi…
|
| /dports/devel/godot-tools/godot-demo-projects-8d9d58f112d8/3d/material_testers/backgrounds/ |
| H A D | lobby.hdr | 13119 …GIMbofjnohd+)(''&'',1233212433LTVSNKD@<;=;9987659huy}�@A@B�C�DDCCCDEEED~IPL�������}ros~n_G�|rs�…
|
| /dports/security/hashcat-legacy/hashcat-legacy-2.00/salts/ |
| H A D | brute-vbulletin.salt | 374630 IPL
|
| /dports/biology/emboss/EMBOSS-6.6.0/emboss/data/OBO/ |
| H A D | go.obo | 126806 …hotoreceptors and bipolar and horizontal cells. The inner plexiform layer (IPL) is positioned betw…
279642 synonym: "IPL" EXACT []
|
| H A D | chebi.obo | 246242 xref: PDBeChem:IPL "PDBeChem"
|
| /dports/databases/py-mysql-connector-python/mysql-connector-python-8.0.27/tests/data/ |
| H A D | random_big_bin.csv | 55169 AH�G<`l ���,!0f�sP����d�M&��XQl�a]��|�ڎ�2��uIPL|x�.�j��[/3_z�|��W1��+$��iFҕ���~4C� OH����P…
|
| /dports/devel/cld2/cld-20150505/internal/ |
| H A D | test_shuffle_1000_48_666.utf8 | 38250 …ga bisa. Tapi ntar pas dimaenin ~ mmpersiapkan untuk menayangkan kompetisi IPL ~ mau tanya salah s…
82069 …rične energije? Brezplačni ~ našli pa smo tudi neustrezne. Na testu tokrat IPL ~ saj naj bi se pre…
82459 …ice 142h:59m:41s 142h:59m:41s 142h:59m:41s ~ pazduho. 2. ponudba vsebuje : IPL trajno ~ KI vaje al…
|
1...<<3132333435