1 /*- 2 * SPDX-License-Identifier: BSD-2-Clause 3 * 4 * Copyright (c) 1997, Stefan Esser <se@freebsd.org> 5 * Copyright (c) 2000, Michael Smith <msmith@freebsd.org> 6 * Copyright (c) 2000, BSDi 7 * All rights reserved. 8 * 9 * Redistribution and use in source and binary forms, with or without 10 * modification, are permitted provided that the following conditions 11 * are met: 12 * 1. Redistributions of source code must retain the above copyright 13 * notice unmodified, this list of conditions, and the following 14 * disclaimer. 15 * 2. Redistributions in binary form must reproduce the above copyright 16 * notice, this list of conditions and the following disclaimer in the 17 * documentation and/or other materials provided with the distribution. 18 * 19 * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR 20 * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES 21 * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. 22 * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, 23 * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT 24 * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, 25 * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY 26 * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT 27 * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF 28 * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. 29 */ 30 31 #include <sys/cdefs.h> 32 __FBSDID("$FreeBSD$"); 33 34 #include "opt_acpi.h" 35 #include "opt_iommu.h" 36 #include "opt_bus.h" 37 38 #include <sys/param.h> 39 #include <sys/conf.h> 40 #include <sys/endian.h> 41 #include <sys/eventhandler.h> 42 #include <sys/fcntl.h> 43 #include <sys/kernel.h> 44 #include <sys/limits.h> 45 #include <sys/linker.h> 46 #include <sys/malloc.h> 47 #include <sys/module.h> 48 #include <sys/queue.h> 49 #include <sys/sbuf.h> 50 #include <sys/sysctl.h> 51 #include <sys/systm.h> 52 #include <sys/taskqueue.h> 53 #include <sys/tree.h> 54 55 #include <vm/vm.h> 56 #include <vm/pmap.h> 57 #include <vm/vm_extern.h> 58 59 #include <sys/bus.h> 60 #include <machine/bus.h> 61 #include <sys/rman.h> 62 #include <machine/resource.h> 63 #include <machine/stdarg.h> 64 65 #if defined(__i386__) || defined(__amd64__) || defined(__powerpc__) 66 #include <machine/intr_machdep.h> 67 #endif 68 69 #include <sys/pciio.h> 70 #include <dev/pci/pcireg.h> 71 #include <dev/pci/pcivar.h> 72 #include <dev/pci/pci_private.h> 73 74 #ifdef PCI_IOV 75 #include <sys/nv.h> 76 #include <dev/pci/pci_iov_private.h> 77 #endif 78 79 #include <dev/usb/controller/xhcireg.h> 80 #include <dev/usb/controller/ehcireg.h> 81 #include <dev/usb/controller/ohcireg.h> 82 #include <dev/usb/controller/uhcireg.h> 83 84 #include <dev/iommu/iommu.h> 85 86 #include "pcib_if.h" 87 #include "pci_if.h" 88 89 #define PCIR_IS_BIOS(cfg, reg) \ 90 (((cfg)->hdrtype == PCIM_HDRTYPE_NORMAL && reg == PCIR_BIOS) || \ 91 ((cfg)->hdrtype == PCIM_HDRTYPE_BRIDGE && reg == PCIR_BIOS_1)) 92 93 static int pci_has_quirk(uint32_t devid, int quirk); 94 static pci_addr_t pci_mapbase(uint64_t mapreg); 95 static const char *pci_maptype(uint64_t mapreg); 96 static int pci_maprange(uint64_t mapreg); 97 static pci_addr_t pci_rombase(uint64_t mapreg); 98 static int pci_romsize(uint64_t testval); 99 static void pci_fixancient(pcicfgregs *cfg); 100 static int pci_printf(pcicfgregs *cfg, const char *fmt, ...); 101 102 static int pci_porten(device_t dev); 103 static int pci_memen(device_t dev); 104 static void pci_assign_interrupt(device_t bus, device_t dev, 105 int force_route); 106 static int pci_add_map(device_t bus, device_t dev, int reg, 107 struct resource_list *rl, int force, int prefetch); 108 static int pci_probe(device_t dev); 109 static void pci_load_vendor_data(void); 110 static int pci_describe_parse_line(char **ptr, int *vendor, 111 int *device, char **desc); 112 static char *pci_describe_device(device_t dev); 113 static int pci_modevent(module_t mod, int what, void *arg); 114 static void pci_hdrtypedata(device_t pcib, int b, int s, int f, 115 pcicfgregs *cfg); 116 static void pci_read_cap(device_t pcib, pcicfgregs *cfg); 117 static int pci_read_vpd_reg(device_t pcib, pcicfgregs *cfg, 118 int reg, uint32_t *data); 119 #if 0 120 static int pci_write_vpd_reg(device_t pcib, pcicfgregs *cfg, 121 int reg, uint32_t data); 122 #endif 123 static void pci_read_vpd(device_t pcib, pcicfgregs *cfg); 124 static void pci_mask_msix(device_t dev, u_int index); 125 static void pci_unmask_msix(device_t dev, u_int index); 126 static int pci_msi_blacklisted(void); 127 static int pci_msix_blacklisted(void); 128 static void pci_resume_msi(device_t dev); 129 static void pci_resume_msix(device_t dev); 130 static int pci_remap_intr_method(device_t bus, device_t dev, 131 u_int irq); 132 static void pci_hint_device_unit(device_t acdev, device_t child, 133 const char *name, int *unitp); 134 static int pci_reset_post(device_t dev, device_t child); 135 static int pci_reset_prepare(device_t dev, device_t child); 136 static int pci_reset_child(device_t dev, device_t child, 137 int flags); 138 139 static int pci_get_id_method(device_t dev, device_t child, 140 enum pci_id_type type, uintptr_t *rid); 141 static struct pci_devinfo * pci_fill_devinfo(device_t pcib, device_t bus, int d, 142 int b, int s, int f, uint16_t vid, uint16_t did); 143 144 static device_method_t pci_methods[] = { 145 /* Device interface */ 146 DEVMETHOD(device_probe, pci_probe), 147 DEVMETHOD(device_attach, pci_attach), 148 DEVMETHOD(device_detach, pci_detach), 149 DEVMETHOD(device_shutdown, bus_generic_shutdown), 150 DEVMETHOD(device_suspend, bus_generic_suspend), 151 DEVMETHOD(device_resume, pci_resume), 152 153 /* Bus interface */ 154 DEVMETHOD(bus_print_child, pci_print_child), 155 DEVMETHOD(bus_probe_nomatch, pci_probe_nomatch), 156 DEVMETHOD(bus_read_ivar, pci_read_ivar), 157 DEVMETHOD(bus_write_ivar, pci_write_ivar), 158 DEVMETHOD(bus_driver_added, pci_driver_added), 159 DEVMETHOD(bus_setup_intr, pci_setup_intr), 160 DEVMETHOD(bus_teardown_intr, pci_teardown_intr), 161 DEVMETHOD(bus_reset_prepare, pci_reset_prepare), 162 DEVMETHOD(bus_reset_post, pci_reset_post), 163 DEVMETHOD(bus_reset_child, pci_reset_child), 164 165 DEVMETHOD(bus_get_dma_tag, pci_get_dma_tag), 166 DEVMETHOD(bus_get_resource_list,pci_get_resource_list), 167 DEVMETHOD(bus_set_resource, bus_generic_rl_set_resource), 168 DEVMETHOD(bus_get_resource, bus_generic_rl_get_resource), 169 DEVMETHOD(bus_delete_resource, pci_delete_resource), 170 DEVMETHOD(bus_alloc_resource, pci_alloc_resource), 171 DEVMETHOD(bus_adjust_resource, bus_generic_adjust_resource), 172 DEVMETHOD(bus_release_resource, pci_release_resource), 173 DEVMETHOD(bus_activate_resource, pci_activate_resource), 174 DEVMETHOD(bus_deactivate_resource, pci_deactivate_resource), 175 DEVMETHOD(bus_child_deleted, pci_child_deleted), 176 DEVMETHOD(bus_child_detached, pci_child_detached), 177 DEVMETHOD(bus_child_pnpinfo, pci_child_pnpinfo_method), 178 DEVMETHOD(bus_child_location, pci_child_location_method), 179 DEVMETHOD(bus_get_device_path, pci_get_device_path_method), 180 DEVMETHOD(bus_hint_device_unit, pci_hint_device_unit), 181 DEVMETHOD(bus_remap_intr, pci_remap_intr_method), 182 DEVMETHOD(bus_suspend_child, pci_suspend_child), 183 DEVMETHOD(bus_resume_child, pci_resume_child), 184 DEVMETHOD(bus_rescan, pci_rescan_method), 185 186 /* PCI interface */ 187 DEVMETHOD(pci_read_config, pci_read_config_method), 188 DEVMETHOD(pci_write_config, pci_write_config_method), 189 DEVMETHOD(pci_enable_busmaster, pci_enable_busmaster_method), 190 DEVMETHOD(pci_disable_busmaster, pci_disable_busmaster_method), 191 DEVMETHOD(pci_enable_io, pci_enable_io_method), 192 DEVMETHOD(pci_disable_io, pci_disable_io_method), 193 DEVMETHOD(pci_get_vpd_ident, pci_get_vpd_ident_method), 194 DEVMETHOD(pci_get_vpd_readonly, pci_get_vpd_readonly_method), 195 DEVMETHOD(pci_get_powerstate, pci_get_powerstate_method), 196 DEVMETHOD(pci_set_powerstate, pci_set_powerstate_method), 197 DEVMETHOD(pci_assign_interrupt, pci_assign_interrupt_method), 198 DEVMETHOD(pci_find_cap, pci_find_cap_method), 199 DEVMETHOD(pci_find_next_cap, pci_find_next_cap_method), 200 DEVMETHOD(pci_find_extcap, pci_find_extcap_method), 201 DEVMETHOD(pci_find_next_extcap, pci_find_next_extcap_method), 202 DEVMETHOD(pci_find_htcap, pci_find_htcap_method), 203 DEVMETHOD(pci_find_next_htcap, pci_find_next_htcap_method), 204 DEVMETHOD(pci_alloc_msi, pci_alloc_msi_method), 205 DEVMETHOD(pci_alloc_msix, pci_alloc_msix_method), 206 DEVMETHOD(pci_enable_msi, pci_enable_msi_method), 207 DEVMETHOD(pci_enable_msix, pci_enable_msix_method), 208 DEVMETHOD(pci_disable_msi, pci_disable_msi_method), 209 DEVMETHOD(pci_remap_msix, pci_remap_msix_method), 210 DEVMETHOD(pci_release_msi, pci_release_msi_method), 211 DEVMETHOD(pci_msi_count, pci_msi_count_method), 212 DEVMETHOD(pci_msix_count, pci_msix_count_method), 213 DEVMETHOD(pci_msix_pba_bar, pci_msix_pba_bar_method), 214 DEVMETHOD(pci_msix_table_bar, pci_msix_table_bar_method), 215 DEVMETHOD(pci_get_id, pci_get_id_method), 216 DEVMETHOD(pci_alloc_devinfo, pci_alloc_devinfo_method), 217 DEVMETHOD(pci_child_added, pci_child_added_method), 218 #ifdef PCI_IOV 219 DEVMETHOD(pci_iov_attach, pci_iov_attach_method), 220 DEVMETHOD(pci_iov_detach, pci_iov_detach_method), 221 DEVMETHOD(pci_create_iov_child, pci_create_iov_child_method), 222 #endif 223 224 DEVMETHOD_END 225 }; 226 227 DEFINE_CLASS_0(pci, pci_driver, pci_methods, sizeof(struct pci_softc)); 228 229 EARLY_DRIVER_MODULE(pci, pcib, pci_driver, pci_modevent, NULL, BUS_PASS_BUS); 230 MODULE_VERSION(pci, 1); 231 232 static char *pci_vendordata; 233 static size_t pci_vendordata_size; 234 235 struct pci_quirk { 236 uint32_t devid; /* Vendor/device of the card */ 237 int type; 238 #define PCI_QUIRK_MAP_REG 1 /* PCI map register in weird place */ 239 #define PCI_QUIRK_DISABLE_MSI 2 /* Neither MSI nor MSI-X work */ 240 #define PCI_QUIRK_ENABLE_MSI_VM 3 /* Older chipset in VM where MSI works */ 241 #define PCI_QUIRK_UNMAP_REG 4 /* Ignore PCI map register */ 242 #define PCI_QUIRK_DISABLE_MSIX 5 /* MSI-X doesn't work */ 243 #define PCI_QUIRK_MSI_INTX_BUG 6 /* PCIM_CMD_INTxDIS disables MSI */ 244 #define PCI_QUIRK_REALLOC_BAR 7 /* Can't allocate memory at the default address */ 245 int arg1; 246 int arg2; 247 }; 248 249 static const struct pci_quirk pci_quirks[] = { 250 /* The Intel 82371AB and 82443MX have a map register at offset 0x90. */ 251 { 0x71138086, PCI_QUIRK_MAP_REG, 0x90, 0 }, 252 { 0x719b8086, PCI_QUIRK_MAP_REG, 0x90, 0 }, 253 /* As does the Serverworks OSB4 (the SMBus mapping register) */ 254 { 0x02001166, PCI_QUIRK_MAP_REG, 0x90, 0 }, 255 256 /* 257 * MSI doesn't work with the ServerWorks CNB20-HE Host Bridge 258 * or the CMIC-SL (AKA ServerWorks GC_LE). 259 */ 260 { 0x00141166, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 261 { 0x00171166, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 262 263 /* 264 * MSI doesn't work on earlier Intel chipsets including 265 * E7500, E7501, E7505, 845, 865, 875/E7210, and 855. 266 */ 267 { 0x25408086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 268 { 0x254c8086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 269 { 0x25508086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 270 { 0x25608086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 271 { 0x25708086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 272 { 0x25788086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 273 { 0x35808086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 274 275 /* 276 * MSI doesn't work with devices behind the AMD 8131 HT-PCIX 277 * bridge. 278 */ 279 { 0x74501022, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 280 281 /* 282 * Some virtualization environments emulate an older chipset 283 * but support MSI just fine. QEMU uses the Intel 82440. 284 */ 285 { 0x12378086, PCI_QUIRK_ENABLE_MSI_VM, 0, 0 }, 286 287 /* 288 * HPET MMIO base address may appear in Bar1 for AMD SB600 SMBus 289 * controller depending on SoftPciRst register (PM_IO 0x55 [7]). 290 * It prevents us from attaching hpet(4) when the bit is unset. 291 * Note this quirk only affects SB600 revision A13 and earlier. 292 * For SB600 A21 and later, firmware must set the bit to hide it. 293 * For SB700 and later, it is unused and hardcoded to zero. 294 */ 295 { 0x43851002, PCI_QUIRK_UNMAP_REG, 0x14, 0 }, 296 297 /* 298 * Atheros AR8161/AR8162/E2200/E2400/E2500 Ethernet controllers have 299 * a bug that MSI interrupt does not assert if PCIM_CMD_INTxDIS bit 300 * of the command register is set. 301 */ 302 { 0x10911969, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, 303 { 0xE0911969, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, 304 { 0xE0A11969, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, 305 { 0xE0B11969, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, 306 { 0x10901969, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, 307 308 /* 309 * Broadcom BCM5714(S)/BCM5715(S)/BCM5780(S) Ethernet MACs don't 310 * issue MSI interrupts with PCIM_CMD_INTxDIS set either. 311 */ 312 { 0x166814e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5714 */ 313 { 0x166914e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5714S */ 314 { 0x166a14e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5780 */ 315 { 0x166b14e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5780S */ 316 { 0x167814e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5715 */ 317 { 0x167914e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5715S */ 318 319 /* 320 * HPE Gen 10 VGA has a memory range that can't be allocated in the 321 * expected place. 322 */ 323 { 0x98741002, PCI_QUIRK_REALLOC_BAR, 0, 0 }, 324 { 0 } 325 }; 326 327 /* map register information */ 328 #define PCI_MAPMEM 0x01 /* memory map */ 329 #define PCI_MAPMEMP 0x02 /* prefetchable memory map */ 330 #define PCI_MAPPORT 0x04 /* port map */ 331 332 struct devlist pci_devq; 333 uint32_t pci_generation; 334 uint32_t pci_numdevs = 0; 335 static int pcie_chipset, pcix_chipset; 336 337 /* sysctl vars */ 338 SYSCTL_NODE(_hw, OID_AUTO, pci, CTLFLAG_RD | CTLFLAG_MPSAFE, 0, 339 "PCI bus tuning parameters"); 340 341 static int pci_enable_io_modes = 1; 342 SYSCTL_INT(_hw_pci, OID_AUTO, enable_io_modes, CTLFLAG_RWTUN, 343 &pci_enable_io_modes, 1, 344 "Enable I/O and memory bits in the config register. Some BIOSes do not" 345 " enable these bits correctly. We'd like to do this all the time, but" 346 " there are some peripherals that this causes problems with."); 347 348 static int pci_do_realloc_bars = 1; 349 SYSCTL_INT(_hw_pci, OID_AUTO, realloc_bars, CTLFLAG_RWTUN, 350 &pci_do_realloc_bars, 0, 351 "Attempt to allocate a new range for any BARs whose original " 352 "firmware-assigned ranges fail to allocate during the initial device scan."); 353 354 static int pci_do_power_nodriver = 0; 355 SYSCTL_INT(_hw_pci, OID_AUTO, do_power_nodriver, CTLFLAG_RWTUN, 356 &pci_do_power_nodriver, 0, 357 "Place a function into D3 state when no driver attaches to it. 0 means" 358 " disable. 1 means conservatively place devices into D3 state. 2 means" 359 " aggressively place devices into D3 state. 3 means put absolutely" 360 " everything in D3 state."); 361 362 int pci_do_power_resume = 1; 363 SYSCTL_INT(_hw_pci, OID_AUTO, do_power_resume, CTLFLAG_RWTUN, 364 &pci_do_power_resume, 1, 365 "Transition from D3 -> D0 on resume."); 366 367 int pci_do_power_suspend = 1; 368 SYSCTL_INT(_hw_pci, OID_AUTO, do_power_suspend, CTLFLAG_RWTUN, 369 &pci_do_power_suspend, 1, 370 "Transition from D0 -> D3 on suspend."); 371 372 static int pci_do_msi = 1; 373 SYSCTL_INT(_hw_pci, OID_AUTO, enable_msi, CTLFLAG_RWTUN, &pci_do_msi, 1, 374 "Enable support for MSI interrupts"); 375 376 static int pci_do_msix = 1; 377 SYSCTL_INT(_hw_pci, OID_AUTO, enable_msix, CTLFLAG_RWTUN, &pci_do_msix, 1, 378 "Enable support for MSI-X interrupts"); 379 380 static int pci_msix_rewrite_table = 0; 381 SYSCTL_INT(_hw_pci, OID_AUTO, msix_rewrite_table, CTLFLAG_RWTUN, 382 &pci_msix_rewrite_table, 0, 383 "Rewrite entire MSI-X table when updating MSI-X entries"); 384 385 static int pci_honor_msi_blacklist = 1; 386 SYSCTL_INT(_hw_pci, OID_AUTO, honor_msi_blacklist, CTLFLAG_RDTUN, 387 &pci_honor_msi_blacklist, 1, "Honor chipset blacklist for MSI/MSI-X"); 388 389 #if defined(__i386__) || defined(__amd64__) 390 static int pci_usb_takeover = 1; 391 #else 392 static int pci_usb_takeover = 0; 393 #endif 394 SYSCTL_INT(_hw_pci, OID_AUTO, usb_early_takeover, CTLFLAG_RDTUN, 395 &pci_usb_takeover, 1, 396 "Enable early takeover of USB controllers. Disable this if you depend on" 397 " BIOS emulation of USB devices, that is you use USB devices (like" 398 " keyboard or mouse) but do not load USB drivers"); 399 400 static int pci_clear_bars; 401 SYSCTL_INT(_hw_pci, OID_AUTO, clear_bars, CTLFLAG_RDTUN, &pci_clear_bars, 0, 402 "Ignore firmware-assigned resources for BARs."); 403 404 #if defined(NEW_PCIB) && defined(PCI_RES_BUS) 405 static int pci_clear_buses; 406 SYSCTL_INT(_hw_pci, OID_AUTO, clear_buses, CTLFLAG_RDTUN, &pci_clear_buses, 0, 407 "Ignore firmware-assigned bus numbers."); 408 #endif 409 410 static int pci_enable_ari = 1; 411 SYSCTL_INT(_hw_pci, OID_AUTO, enable_ari, CTLFLAG_RDTUN, &pci_enable_ari, 412 0, "Enable support for PCIe Alternative RID Interpretation"); 413 414 int pci_enable_aspm = 1; 415 SYSCTL_INT(_hw_pci, OID_AUTO, enable_aspm, CTLFLAG_RDTUN, &pci_enable_aspm, 416 0, "Enable support for PCIe Active State Power Management"); 417 418 static int pci_clear_aer_on_attach = 0; 419 SYSCTL_INT(_hw_pci, OID_AUTO, clear_aer_on_attach, CTLFLAG_RWTUN, 420 &pci_clear_aer_on_attach, 0, 421 "Clear port and device AER state on driver attach"); 422 423 static bool pci_enable_mps_tune = true; 424 SYSCTL_BOOL(_hw_pci, OID_AUTO, enable_mps_tune, CTLFLAG_RWTUN, 425 &pci_enable_mps_tune, 1, 426 "Enable tuning of MPS(maximum payload size)." ); 427 428 static int 429 pci_has_quirk(uint32_t devid, int quirk) 430 { 431 const struct pci_quirk *q; 432 433 for (q = &pci_quirks[0]; q->devid; q++) { 434 if (q->devid == devid && q->type == quirk) 435 return (1); 436 } 437 return (0); 438 } 439 440 /* Find a device_t by bus/slot/function in domain 0 */ 441 442 device_t 443 pci_find_bsf(uint8_t bus, uint8_t slot, uint8_t func) 444 { 445 446 return (pci_find_dbsf(0, bus, slot, func)); 447 } 448 449 /* Find a device_t by domain/bus/slot/function */ 450 451 device_t 452 pci_find_dbsf(uint32_t domain, uint8_t bus, uint8_t slot, uint8_t func) 453 { 454 struct pci_devinfo *dinfo = NULL; 455 456 STAILQ_FOREACH(dinfo, &pci_devq, pci_links) { 457 if ((dinfo->cfg.domain == domain) && 458 (dinfo->cfg.bus == bus) && 459 (dinfo->cfg.slot == slot) && 460 (dinfo->cfg.func == func)) { 461 break; 462 } 463 } 464 465 return (dinfo != NULL ? dinfo->cfg.dev : NULL); 466 } 467 468 /* Find a device_t by vendor/device ID */ 469 470 device_t 471 pci_find_device(uint16_t vendor, uint16_t device) 472 { 473 struct pci_devinfo *dinfo; 474 475 STAILQ_FOREACH(dinfo, &pci_devq, pci_links) { 476 if ((dinfo->cfg.vendor == vendor) && 477 (dinfo->cfg.device == device)) { 478 return (dinfo->cfg.dev); 479 } 480 } 481 482 return (NULL); 483 } 484 485 device_t 486 pci_find_class(uint8_t class, uint8_t subclass) 487 { 488 struct pci_devinfo *dinfo; 489 490 STAILQ_FOREACH(dinfo, &pci_devq, pci_links) { 491 if (dinfo->cfg.baseclass == class && 492 dinfo->cfg.subclass == subclass) { 493 return (dinfo->cfg.dev); 494 } 495 } 496 497 return (NULL); 498 } 499 500 device_t 501 pci_find_class_from(uint8_t class, uint8_t subclass, device_t from) 502 { 503 struct pci_devinfo *dinfo; 504 bool found = false; 505 506 STAILQ_FOREACH(dinfo, &pci_devq, pci_links) { 507 if (from != NULL && found == false) { 508 if (from != dinfo->cfg.dev) 509 continue; 510 found = true; 511 continue; 512 } 513 if (dinfo->cfg.baseclass == class && 514 dinfo->cfg.subclass == subclass) { 515 return (dinfo->cfg.dev); 516 } 517 } 518 519 return (NULL); 520 } 521 522 static int 523 pci_printf(pcicfgregs *cfg, const char *fmt, ...) 524 { 525 va_list ap; 526 int retval; 527 528 retval = printf("pci%d:%d:%d:%d: ", cfg->domain, cfg->bus, cfg->slot, 529 cfg->func); 530 va_start(ap, fmt); 531 retval += vprintf(fmt, ap); 532 va_end(ap); 533 return (retval); 534 } 535 536 /* return base address of memory or port map */ 537 538 static pci_addr_t 539 pci_mapbase(uint64_t mapreg) 540 { 541 542 if (PCI_BAR_MEM(mapreg)) 543 return (mapreg & PCIM_BAR_MEM_BASE); 544 else 545 return (mapreg & PCIM_BAR_IO_BASE); 546 } 547 548 /* return map type of memory or port map */ 549 550 static const char * 551 pci_maptype(uint64_t mapreg) 552 { 553 554 if (PCI_BAR_IO(mapreg)) 555 return ("I/O Port"); 556 if (mapreg & PCIM_BAR_MEM_PREFETCH) 557 return ("Prefetchable Memory"); 558 return ("Memory"); 559 } 560 561 /* return log2 of map size decoded for memory or port map */ 562 563 int 564 pci_mapsize(uint64_t testval) 565 { 566 int ln2size; 567 568 testval = pci_mapbase(testval); 569 ln2size = 0; 570 if (testval != 0) { 571 while ((testval & 1) == 0) 572 { 573 ln2size++; 574 testval >>= 1; 575 } 576 } 577 return (ln2size); 578 } 579 580 /* return base address of device ROM */ 581 582 static pci_addr_t 583 pci_rombase(uint64_t mapreg) 584 { 585 586 return (mapreg & PCIM_BIOS_ADDR_MASK); 587 } 588 589 /* return log2 of map size decided for device ROM */ 590 591 static int 592 pci_romsize(uint64_t testval) 593 { 594 int ln2size; 595 596 testval = pci_rombase(testval); 597 ln2size = 0; 598 if (testval != 0) { 599 while ((testval & 1) == 0) 600 { 601 ln2size++; 602 testval >>= 1; 603 } 604 } 605 return (ln2size); 606 } 607 608 /* return log2 of address range supported by map register */ 609 610 static int 611 pci_maprange(uint64_t mapreg) 612 { 613 int ln2range = 0; 614 615 if (PCI_BAR_IO(mapreg)) 616 ln2range = 32; 617 else 618 switch (mapreg & PCIM_BAR_MEM_TYPE) { 619 case PCIM_BAR_MEM_32: 620 ln2range = 32; 621 break; 622 case PCIM_BAR_MEM_1MB: 623 ln2range = 20; 624 break; 625 case PCIM_BAR_MEM_64: 626 ln2range = 64; 627 break; 628 } 629 return (ln2range); 630 } 631 632 /* adjust some values from PCI 1.0 devices to match 2.0 standards ... */ 633 634 static void 635 pci_fixancient(pcicfgregs *cfg) 636 { 637 if ((cfg->hdrtype & PCIM_HDRTYPE) != PCIM_HDRTYPE_NORMAL) 638 return; 639 640 /* PCI to PCI bridges use header type 1 */ 641 if (cfg->baseclass == PCIC_BRIDGE && cfg->subclass == PCIS_BRIDGE_PCI) 642 cfg->hdrtype = PCIM_HDRTYPE_BRIDGE; 643 } 644 645 /* extract header type specific config data */ 646 647 static void 648 pci_hdrtypedata(device_t pcib, int b, int s, int f, pcicfgregs *cfg) 649 { 650 #define REG(n, w) PCIB_READ_CONFIG(pcib, b, s, f, n, w) 651 switch (cfg->hdrtype & PCIM_HDRTYPE) { 652 case PCIM_HDRTYPE_NORMAL: 653 cfg->subvendor = REG(PCIR_SUBVEND_0, 2); 654 cfg->subdevice = REG(PCIR_SUBDEV_0, 2); 655 cfg->mingnt = REG(PCIR_MINGNT, 1); 656 cfg->maxlat = REG(PCIR_MAXLAT, 1); 657 cfg->nummaps = PCI_MAXMAPS_0; 658 break; 659 case PCIM_HDRTYPE_BRIDGE: 660 cfg->bridge.br_seclat = REG(PCIR_SECLAT_1, 1); 661 cfg->bridge.br_subbus = REG(PCIR_SUBBUS_1, 1); 662 cfg->bridge.br_secbus = REG(PCIR_SECBUS_1, 1); 663 cfg->bridge.br_pribus = REG(PCIR_PRIBUS_1, 1); 664 cfg->bridge.br_control = REG(PCIR_BRIDGECTL_1, 2); 665 cfg->nummaps = PCI_MAXMAPS_1; 666 break; 667 case PCIM_HDRTYPE_CARDBUS: 668 cfg->bridge.br_seclat = REG(PCIR_SECLAT_2, 1); 669 cfg->bridge.br_subbus = REG(PCIR_SUBBUS_2, 1); 670 cfg->bridge.br_secbus = REG(PCIR_SECBUS_2, 1); 671 cfg->bridge.br_pribus = REG(PCIR_PRIBUS_2, 1); 672 cfg->bridge.br_control = REG(PCIR_BRIDGECTL_2, 2); 673 cfg->subvendor = REG(PCIR_SUBVEND_2, 2); 674 cfg->subdevice = REG(PCIR_SUBDEV_2, 2); 675 cfg->nummaps = PCI_MAXMAPS_2; 676 break; 677 } 678 #undef REG 679 } 680 681 /* read configuration header into pcicfgregs structure */ 682 struct pci_devinfo * 683 pci_read_device(device_t pcib, device_t bus, int d, int b, int s, int f) 684 { 685 #define REG(n, w) PCIB_READ_CONFIG(pcib, b, s, f, n, w) 686 uint16_t vid, did; 687 688 vid = REG(PCIR_VENDOR, 2); 689 if (vid == PCIV_INVALID) 690 return (NULL); 691 692 did = REG(PCIR_DEVICE, 2); 693 694 return (pci_fill_devinfo(pcib, bus, d, b, s, f, vid, did)); 695 } 696 697 struct pci_devinfo * 698 pci_alloc_devinfo_method(device_t dev) 699 { 700 701 return (malloc(sizeof(struct pci_devinfo), M_DEVBUF, 702 M_WAITOK | M_ZERO)); 703 } 704 705 static struct pci_devinfo * 706 pci_fill_devinfo(device_t pcib, device_t bus, int d, int b, int s, int f, 707 uint16_t vid, uint16_t did) 708 { 709 struct pci_devinfo *devlist_entry; 710 pcicfgregs *cfg; 711 712 devlist_entry = PCI_ALLOC_DEVINFO(bus); 713 714 cfg = &devlist_entry->cfg; 715 716 cfg->domain = d; 717 cfg->bus = b; 718 cfg->slot = s; 719 cfg->func = f; 720 cfg->vendor = vid; 721 cfg->device = did; 722 cfg->cmdreg = REG(PCIR_COMMAND, 2); 723 cfg->statreg = REG(PCIR_STATUS, 2); 724 cfg->baseclass = REG(PCIR_CLASS, 1); 725 cfg->subclass = REG(PCIR_SUBCLASS, 1); 726 cfg->progif = REG(PCIR_PROGIF, 1); 727 cfg->revid = REG(PCIR_REVID, 1); 728 cfg->hdrtype = REG(PCIR_HDRTYPE, 1); 729 cfg->cachelnsz = REG(PCIR_CACHELNSZ, 1); 730 cfg->lattimer = REG(PCIR_LATTIMER, 1); 731 cfg->intpin = REG(PCIR_INTPIN, 1); 732 cfg->intline = REG(PCIR_INTLINE, 1); 733 734 cfg->mfdev = (cfg->hdrtype & PCIM_MFDEV) != 0; 735 cfg->hdrtype &= ~PCIM_MFDEV; 736 STAILQ_INIT(&cfg->maps); 737 738 cfg->iov = NULL; 739 740 pci_fixancient(cfg); 741 pci_hdrtypedata(pcib, b, s, f, cfg); 742 743 if (REG(PCIR_STATUS, 2) & PCIM_STATUS_CAPPRESENT) 744 pci_read_cap(pcib, cfg); 745 746 STAILQ_INSERT_TAIL(&pci_devq, devlist_entry, pci_links); 747 748 devlist_entry->conf.pc_sel.pc_domain = cfg->domain; 749 devlist_entry->conf.pc_sel.pc_bus = cfg->bus; 750 devlist_entry->conf.pc_sel.pc_dev = cfg->slot; 751 devlist_entry->conf.pc_sel.pc_func = cfg->func; 752 devlist_entry->conf.pc_hdr = cfg->hdrtype; 753 754 devlist_entry->conf.pc_subvendor = cfg->subvendor; 755 devlist_entry->conf.pc_subdevice = cfg->subdevice; 756 devlist_entry->conf.pc_vendor = cfg->vendor; 757 devlist_entry->conf.pc_device = cfg->device; 758 759 devlist_entry->conf.pc_class = cfg->baseclass; 760 devlist_entry->conf.pc_subclass = cfg->subclass; 761 devlist_entry->conf.pc_progif = cfg->progif; 762 devlist_entry->conf.pc_revid = cfg->revid; 763 764 pci_numdevs++; 765 pci_generation++; 766 767 return (devlist_entry); 768 } 769 #undef REG 770 771 static void 772 pci_ea_fill_info(device_t pcib, pcicfgregs *cfg) 773 { 774 #define REG(n, w) PCIB_READ_CONFIG(pcib, cfg->bus, cfg->slot, cfg->func, \ 775 cfg->ea.ea_location + (n), w) 776 int num_ent; 777 int ptr; 778 int a, b; 779 uint32_t val; 780 int ent_size; 781 uint32_t dw[4]; 782 uint64_t base, max_offset; 783 struct pci_ea_entry *eae; 784 785 if (cfg->ea.ea_location == 0) 786 return; 787 788 STAILQ_INIT(&cfg->ea.ea_entries); 789 790 /* Determine the number of entries */ 791 num_ent = REG(PCIR_EA_NUM_ENT, 2); 792 num_ent &= PCIM_EA_NUM_ENT_MASK; 793 794 /* Find the first entry to care of */ 795 ptr = PCIR_EA_FIRST_ENT; 796 797 /* Skip DWORD 2 for type 1 functions */ 798 if ((cfg->hdrtype & PCIM_HDRTYPE) == PCIM_HDRTYPE_BRIDGE) 799 ptr += 4; 800 801 for (a = 0; a < num_ent; a++) { 802 eae = malloc(sizeof(*eae), M_DEVBUF, M_WAITOK | M_ZERO); 803 eae->eae_cfg_offset = cfg->ea.ea_location + ptr; 804 805 /* Read a number of dwords in the entry */ 806 val = REG(ptr, 4); 807 ptr += 4; 808 ent_size = (val & PCIM_EA_ES); 809 810 for (b = 0; b < ent_size; b++) { 811 dw[b] = REG(ptr, 4); 812 ptr += 4; 813 } 814 815 eae->eae_flags = val; 816 eae->eae_bei = (PCIM_EA_BEI & val) >> PCIM_EA_BEI_OFFSET; 817 818 base = dw[0] & PCIM_EA_FIELD_MASK; 819 max_offset = dw[1] | ~PCIM_EA_FIELD_MASK; 820 b = 2; 821 if (((dw[0] & PCIM_EA_IS_64) != 0) && (b < ent_size)) { 822 base |= (uint64_t)dw[b] << 32UL; 823 b++; 824 } 825 if (((dw[1] & PCIM_EA_IS_64) != 0) 826 && (b < ent_size)) { 827 max_offset |= (uint64_t)dw[b] << 32UL; 828 b++; 829 } 830 831 eae->eae_base = base; 832 eae->eae_max_offset = max_offset; 833 834 STAILQ_INSERT_TAIL(&cfg->ea.ea_entries, eae, eae_link); 835 836 if (bootverbose) { 837 printf("PCI(EA) dev %04x:%04x, bei %d, flags #%x, base #%jx, max_offset #%jx\n", 838 cfg->vendor, cfg->device, eae->eae_bei, eae->eae_flags, 839 (uintmax_t)eae->eae_base, (uintmax_t)eae->eae_max_offset); 840 } 841 } 842 } 843 #undef REG 844 845 static void 846 pci_read_cap(device_t pcib, pcicfgregs *cfg) 847 { 848 #define REG(n, w) PCIB_READ_CONFIG(pcib, cfg->bus, cfg->slot, cfg->func, n, w) 849 #define WREG(n, v, w) PCIB_WRITE_CONFIG(pcib, cfg->bus, cfg->slot, cfg->func, n, v, w) 850 #if defined(__i386__) || defined(__amd64__) || defined(__powerpc__) 851 uint64_t addr; 852 #endif 853 uint32_t val; 854 int ptr, nextptr, ptrptr; 855 856 switch (cfg->hdrtype & PCIM_HDRTYPE) { 857 case PCIM_HDRTYPE_NORMAL: 858 case PCIM_HDRTYPE_BRIDGE: 859 ptrptr = PCIR_CAP_PTR; 860 break; 861 case PCIM_HDRTYPE_CARDBUS: 862 ptrptr = PCIR_CAP_PTR_2; /* cardbus capabilities ptr */ 863 break; 864 default: 865 return; /* no extended capabilities support */ 866 } 867 nextptr = REG(ptrptr, 1); /* sanity check? */ 868 869 /* 870 * Read capability entries. 871 */ 872 while (nextptr != 0) { 873 /* Sanity check */ 874 if (nextptr > 255) { 875 printf("illegal PCI extended capability offset %d\n", 876 nextptr); 877 return; 878 } 879 /* Find the next entry */ 880 ptr = nextptr; 881 nextptr = REG(ptr + PCICAP_NEXTPTR, 1); 882 883 /* Process this entry */ 884 switch (REG(ptr + PCICAP_ID, 1)) { 885 case PCIY_PMG: /* PCI power management */ 886 if (cfg->pp.pp_cap == 0) { 887 cfg->pp.pp_cap = REG(ptr + PCIR_POWER_CAP, 2); 888 cfg->pp.pp_status = ptr + PCIR_POWER_STATUS; 889 cfg->pp.pp_bse = ptr + PCIR_POWER_BSE; 890 if ((nextptr - ptr) > PCIR_POWER_DATA) 891 cfg->pp.pp_data = ptr + PCIR_POWER_DATA; 892 } 893 break; 894 case PCIY_HT: /* HyperTransport */ 895 /* Determine HT-specific capability type. */ 896 val = REG(ptr + PCIR_HT_COMMAND, 2); 897 898 if ((val & 0xe000) == PCIM_HTCAP_SLAVE) 899 cfg->ht.ht_slave = ptr; 900 901 #if defined(__i386__) || defined(__amd64__) || defined(__powerpc__) 902 switch (val & PCIM_HTCMD_CAP_MASK) { 903 case PCIM_HTCAP_MSI_MAPPING: 904 if (!(val & PCIM_HTCMD_MSI_FIXED)) { 905 /* Sanity check the mapping window. */ 906 addr = REG(ptr + PCIR_HTMSI_ADDRESS_HI, 907 4); 908 addr <<= 32; 909 addr |= REG(ptr + PCIR_HTMSI_ADDRESS_LO, 910 4); 911 if (addr != MSI_INTEL_ADDR_BASE) 912 device_printf(pcib, 913 "HT device at pci%d:%d:%d:%d has non-default MSI window 0x%llx\n", 914 cfg->domain, cfg->bus, 915 cfg->slot, cfg->func, 916 (long long)addr); 917 } else 918 addr = MSI_INTEL_ADDR_BASE; 919 920 cfg->ht.ht_msimap = ptr; 921 cfg->ht.ht_msictrl = val; 922 cfg->ht.ht_msiaddr = addr; 923 break; 924 } 925 #endif 926 break; 927 case PCIY_MSI: /* PCI MSI */ 928 cfg->msi.msi_location = ptr; 929 cfg->msi.msi_ctrl = REG(ptr + PCIR_MSI_CTRL, 2); 930 cfg->msi.msi_msgnum = 1 << ((cfg->msi.msi_ctrl & 931 PCIM_MSICTRL_MMC_MASK)>>1); 932 break; 933 case PCIY_MSIX: /* PCI MSI-X */ 934 cfg->msix.msix_location = ptr; 935 cfg->msix.msix_ctrl = REG(ptr + PCIR_MSIX_CTRL, 2); 936 cfg->msix.msix_msgnum = (cfg->msix.msix_ctrl & 937 PCIM_MSIXCTRL_TABLE_SIZE) + 1; 938 val = REG(ptr + PCIR_MSIX_TABLE, 4); 939 cfg->msix.msix_table_bar = PCIR_BAR(val & 940 PCIM_MSIX_BIR_MASK); 941 cfg->msix.msix_table_offset = val & ~PCIM_MSIX_BIR_MASK; 942 val = REG(ptr + PCIR_MSIX_PBA, 4); 943 cfg->msix.msix_pba_bar = PCIR_BAR(val & 944 PCIM_MSIX_BIR_MASK); 945 cfg->msix.msix_pba_offset = val & ~PCIM_MSIX_BIR_MASK; 946 break; 947 case PCIY_VPD: /* PCI Vital Product Data */ 948 cfg->vpd.vpd_reg = ptr; 949 break; 950 case PCIY_SUBVENDOR: 951 /* Should always be true. */ 952 if ((cfg->hdrtype & PCIM_HDRTYPE) == 953 PCIM_HDRTYPE_BRIDGE) { 954 val = REG(ptr + PCIR_SUBVENDCAP_ID, 4); 955 cfg->subvendor = val & 0xffff; 956 cfg->subdevice = val >> 16; 957 } 958 break; 959 case PCIY_PCIX: /* PCI-X */ 960 /* 961 * Assume we have a PCI-X chipset if we have 962 * at least one PCI-PCI bridge with a PCI-X 963 * capability. Note that some systems with 964 * PCI-express or HT chipsets might match on 965 * this check as well. 966 */ 967 if ((cfg->hdrtype & PCIM_HDRTYPE) == 968 PCIM_HDRTYPE_BRIDGE) 969 pcix_chipset = 1; 970 cfg->pcix.pcix_location = ptr; 971 break; 972 case PCIY_EXPRESS: /* PCI-express */ 973 /* 974 * Assume we have a PCI-express chipset if we have 975 * at least one PCI-express device. 976 */ 977 pcie_chipset = 1; 978 cfg->pcie.pcie_location = ptr; 979 val = REG(ptr + PCIER_FLAGS, 2); 980 cfg->pcie.pcie_type = val & PCIEM_FLAGS_TYPE; 981 break; 982 case PCIY_EA: /* Enhanced Allocation */ 983 cfg->ea.ea_location = ptr; 984 pci_ea_fill_info(pcib, cfg); 985 break; 986 default: 987 break; 988 } 989 } 990 991 #if defined(__powerpc__) 992 /* 993 * Enable the MSI mapping window for all HyperTransport 994 * slaves. PCI-PCI bridges have their windows enabled via 995 * PCIB_MAP_MSI(). 996 */ 997 if (cfg->ht.ht_slave != 0 && cfg->ht.ht_msimap != 0 && 998 !(cfg->ht.ht_msictrl & PCIM_HTCMD_MSI_ENABLE)) { 999 device_printf(pcib, 1000 "Enabling MSI window for HyperTransport slave at pci%d:%d:%d:%d\n", 1001 cfg->domain, cfg->bus, cfg->slot, cfg->func); 1002 cfg->ht.ht_msictrl |= PCIM_HTCMD_MSI_ENABLE; 1003 WREG(cfg->ht.ht_msimap + PCIR_HT_COMMAND, cfg->ht.ht_msictrl, 1004 2); 1005 } 1006 #endif 1007 /* REG and WREG use carry through to next functions */ 1008 } 1009 1010 /* 1011 * PCI Vital Product Data 1012 */ 1013 1014 #define PCI_VPD_TIMEOUT 1000000 1015 1016 static int 1017 pci_read_vpd_reg(device_t pcib, pcicfgregs *cfg, int reg, uint32_t *data) 1018 { 1019 int count = PCI_VPD_TIMEOUT; 1020 1021 KASSERT((reg & 3) == 0, ("VPD register must by 4 byte aligned")); 1022 1023 WREG(cfg->vpd.vpd_reg + PCIR_VPD_ADDR, reg, 2); 1024 1025 while ((REG(cfg->vpd.vpd_reg + PCIR_VPD_ADDR, 2) & 0x8000) != 0x8000) { 1026 if (--count < 0) 1027 return (ENXIO); 1028 DELAY(1); /* limit looping */ 1029 } 1030 *data = (REG(cfg->vpd.vpd_reg + PCIR_VPD_DATA, 4)); 1031 1032 return (0); 1033 } 1034 1035 #if 0 1036 static int 1037 pci_write_vpd_reg(device_t pcib, pcicfgregs *cfg, int reg, uint32_t data) 1038 { 1039 int count = PCI_VPD_TIMEOUT; 1040 1041 KASSERT((reg & 3) == 0, ("VPD register must by 4 byte aligned")); 1042 1043 WREG(cfg->vpd.vpd_reg + PCIR_VPD_DATA, data, 4); 1044 WREG(cfg->vpd.vpd_reg + PCIR_VPD_ADDR, reg | 0x8000, 2); 1045 while ((REG(cfg->vpd.vpd_reg + PCIR_VPD_ADDR, 2) & 0x8000) == 0x8000) { 1046 if (--count < 0) 1047 return (ENXIO); 1048 DELAY(1); /* limit looping */ 1049 } 1050 1051 return (0); 1052 } 1053 #endif 1054 1055 #undef PCI_VPD_TIMEOUT 1056 1057 struct vpd_readstate { 1058 device_t pcib; 1059 pcicfgregs *cfg; 1060 uint32_t val; 1061 int bytesinval; 1062 int off; 1063 uint8_t cksum; 1064 }; 1065 1066 static int 1067 vpd_nextbyte(struct vpd_readstate *vrs, uint8_t *data) 1068 { 1069 uint32_t reg; 1070 uint8_t byte; 1071 1072 if (vrs->bytesinval == 0) { 1073 if (pci_read_vpd_reg(vrs->pcib, vrs->cfg, vrs->off, ®)) 1074 return (ENXIO); 1075 vrs->val = le32toh(reg); 1076 vrs->off += 4; 1077 byte = vrs->val & 0xff; 1078 vrs->bytesinval = 3; 1079 } else { 1080 vrs->val = vrs->val >> 8; 1081 byte = vrs->val & 0xff; 1082 vrs->bytesinval--; 1083 } 1084 1085 vrs->cksum += byte; 1086 *data = byte; 1087 return (0); 1088 } 1089 1090 static void 1091 pci_read_vpd(device_t pcib, pcicfgregs *cfg) 1092 { 1093 struct vpd_readstate vrs; 1094 int state; 1095 int name; 1096 int remain; 1097 int i; 1098 int alloc, off; /* alloc/off for RO/W arrays */ 1099 int cksumvalid; 1100 int dflen; 1101 int firstrecord; 1102 uint8_t byte; 1103 uint8_t byte2; 1104 1105 /* init vpd reader */ 1106 vrs.bytesinval = 0; 1107 vrs.off = 0; 1108 vrs.pcib = pcib; 1109 vrs.cfg = cfg; 1110 vrs.cksum = 0; 1111 1112 state = 0; 1113 name = remain = i = 0; /* shut up stupid gcc */ 1114 alloc = off = 0; /* shut up stupid gcc */ 1115 dflen = 0; /* shut up stupid gcc */ 1116 cksumvalid = -1; 1117 firstrecord = 1; 1118 while (state >= 0) { 1119 if (vpd_nextbyte(&vrs, &byte)) { 1120 pci_printf(cfg, "VPD read timed out\n"); 1121 state = -2; 1122 break; 1123 } 1124 #if 0 1125 pci_printf(cfg, "vpd: val: %#x, off: %d, bytesinval: %d, byte: " 1126 "%#hhx, state: %d, remain: %d, name: %#x, i: %d\n", vrs.val, 1127 vrs.off, vrs.bytesinval, byte, state, remain, name, i); 1128 #endif 1129 switch (state) { 1130 case 0: /* item name */ 1131 if (byte & 0x80) { 1132 if (vpd_nextbyte(&vrs, &byte2)) { 1133 state = -2; 1134 break; 1135 } 1136 remain = byte2; 1137 if (vpd_nextbyte(&vrs, &byte2)) { 1138 state = -2; 1139 break; 1140 } 1141 remain |= byte2 << 8; 1142 name = byte & 0x7f; 1143 } else { 1144 remain = byte & 0x7; 1145 name = (byte >> 3) & 0xf; 1146 } 1147 if (firstrecord) { 1148 if (name != 0x2) { 1149 pci_printf(cfg, "VPD data does not " \ 1150 "start with ident (%#x)\n", name); 1151 state = -2; 1152 break; 1153 } 1154 firstrecord = 0; 1155 } 1156 if (vrs.off + remain - vrs.bytesinval > 0x8000) { 1157 pci_printf(cfg, 1158 "VPD data overflow, remain %#x\n", remain); 1159 state = -1; 1160 break; 1161 } 1162 switch (name) { 1163 case 0x2: /* String */ 1164 if (cfg->vpd.vpd_ident != NULL) { 1165 pci_printf(cfg, 1166 "duplicate VPD ident record\n"); 1167 state = -2; 1168 break; 1169 } 1170 if (remain > 255) { 1171 pci_printf(cfg, 1172 "VPD ident length %d exceeds 255\n", 1173 remain); 1174 state = -2; 1175 break; 1176 } 1177 cfg->vpd.vpd_ident = malloc(remain + 1, 1178 M_DEVBUF, M_WAITOK); 1179 i = 0; 1180 state = 1; 1181 break; 1182 case 0xf: /* End */ 1183 state = -1; 1184 break; 1185 case 0x10: /* VPD-R */ 1186 alloc = 8; 1187 off = 0; 1188 cfg->vpd.vpd_ros = malloc(alloc * 1189 sizeof(*cfg->vpd.vpd_ros), M_DEVBUF, 1190 M_WAITOK | M_ZERO); 1191 state = 2; 1192 break; 1193 case 0x11: /* VPD-W */ 1194 alloc = 8; 1195 off = 0; 1196 cfg->vpd.vpd_w = malloc(alloc * 1197 sizeof(*cfg->vpd.vpd_w), M_DEVBUF, 1198 M_WAITOK | M_ZERO); 1199 state = 5; 1200 break; 1201 default: /* Invalid data, abort */ 1202 pci_printf(cfg, "invalid VPD name: %#x\n", name); 1203 state = -2; 1204 break; 1205 } 1206 break; 1207 1208 case 1: /* Identifier String */ 1209 cfg->vpd.vpd_ident[i++] = byte; 1210 remain--; 1211 if (remain == 0) { 1212 cfg->vpd.vpd_ident[i] = '\0'; 1213 state = 0; 1214 } 1215 break; 1216 1217 case 2: /* VPD-R Keyword Header */ 1218 if (off == alloc) { 1219 cfg->vpd.vpd_ros = reallocf(cfg->vpd.vpd_ros, 1220 (alloc *= 2) * sizeof(*cfg->vpd.vpd_ros), 1221 M_DEVBUF, M_WAITOK | M_ZERO); 1222 } 1223 cfg->vpd.vpd_ros[off].keyword[0] = byte; 1224 if (vpd_nextbyte(&vrs, &byte2)) { 1225 state = -2; 1226 break; 1227 } 1228 cfg->vpd.vpd_ros[off].keyword[1] = byte2; 1229 if (vpd_nextbyte(&vrs, &byte2)) { 1230 state = -2; 1231 break; 1232 } 1233 cfg->vpd.vpd_ros[off].len = dflen = byte2; 1234 if (dflen == 0 && 1235 strncmp(cfg->vpd.vpd_ros[off].keyword, "RV", 1236 2) == 0) { 1237 /* 1238 * if this happens, we can't trust the rest 1239 * of the VPD. 1240 */ 1241 pci_printf(cfg, "invalid VPD RV record"); 1242 cksumvalid = 0; 1243 state = -1; 1244 break; 1245 } else if (dflen == 0) { 1246 cfg->vpd.vpd_ros[off].value = malloc(1 * 1247 sizeof(*cfg->vpd.vpd_ros[off].value), 1248 M_DEVBUF, M_WAITOK); 1249 cfg->vpd.vpd_ros[off].value[0] = '\x00'; 1250 } else 1251 cfg->vpd.vpd_ros[off].value = malloc( 1252 (dflen + 1) * 1253 sizeof(*cfg->vpd.vpd_ros[off].value), 1254 M_DEVBUF, M_WAITOK); 1255 remain -= 3; 1256 i = 0; 1257 /* keep in sync w/ state 3's transitions */ 1258 if (dflen == 0 && remain == 0) 1259 state = 0; 1260 else if (dflen == 0) 1261 state = 2; 1262 else 1263 state = 3; 1264 break; 1265 1266 case 3: /* VPD-R Keyword Value */ 1267 cfg->vpd.vpd_ros[off].value[i++] = byte; 1268 if (strncmp(cfg->vpd.vpd_ros[off].keyword, 1269 "RV", 2) == 0 && cksumvalid == -1) { 1270 if (vrs.cksum == 0) 1271 cksumvalid = 1; 1272 else { 1273 if (bootverbose) 1274 pci_printf(cfg, 1275 "bad VPD cksum, remain %hhu\n", 1276 vrs.cksum); 1277 cksumvalid = 0; 1278 state = -1; 1279 break; 1280 } 1281 } 1282 dflen--; 1283 remain--; 1284 /* keep in sync w/ state 2's transitions */ 1285 if (dflen == 0) 1286 cfg->vpd.vpd_ros[off++].value[i++] = '\0'; 1287 if (dflen == 0 && remain == 0) { 1288 cfg->vpd.vpd_rocnt = off; 1289 cfg->vpd.vpd_ros = reallocf(cfg->vpd.vpd_ros, 1290 off * sizeof(*cfg->vpd.vpd_ros), 1291 M_DEVBUF, M_WAITOK | M_ZERO); 1292 state = 0; 1293 } else if (dflen == 0) 1294 state = 2; 1295 break; 1296 1297 case 4: 1298 remain--; 1299 if (remain == 0) 1300 state = 0; 1301 break; 1302 1303 case 5: /* VPD-W Keyword Header */ 1304 if (off == alloc) { 1305 cfg->vpd.vpd_w = reallocf(cfg->vpd.vpd_w, 1306 (alloc *= 2) * sizeof(*cfg->vpd.vpd_w), 1307 M_DEVBUF, M_WAITOK | M_ZERO); 1308 } 1309 cfg->vpd.vpd_w[off].keyword[0] = byte; 1310 if (vpd_nextbyte(&vrs, &byte2)) { 1311 state = -2; 1312 break; 1313 } 1314 cfg->vpd.vpd_w[off].keyword[1] = byte2; 1315 if (vpd_nextbyte(&vrs, &byte2)) { 1316 state = -2; 1317 break; 1318 } 1319 cfg->vpd.vpd_w[off].len = dflen = byte2; 1320 cfg->vpd.vpd_w[off].start = vrs.off - vrs.bytesinval; 1321 cfg->vpd.vpd_w[off].value = malloc((dflen + 1) * 1322 sizeof(*cfg->vpd.vpd_w[off].value), 1323 M_DEVBUF, M_WAITOK); 1324 remain -= 3; 1325 i = 0; 1326 /* keep in sync w/ state 6's transitions */ 1327 if (dflen == 0 && remain == 0) 1328 state = 0; 1329 else if (dflen == 0) 1330 state = 5; 1331 else 1332 state = 6; 1333 break; 1334 1335 case 6: /* VPD-W Keyword Value */ 1336 cfg->vpd.vpd_w[off].value[i++] = byte; 1337 dflen--; 1338 remain--; 1339 /* keep in sync w/ state 5's transitions */ 1340 if (dflen == 0) 1341 cfg->vpd.vpd_w[off++].value[i++] = '\0'; 1342 if (dflen == 0 && remain == 0) { 1343 cfg->vpd.vpd_wcnt = off; 1344 cfg->vpd.vpd_w = reallocf(cfg->vpd.vpd_w, 1345 off * sizeof(*cfg->vpd.vpd_w), 1346 M_DEVBUF, M_WAITOK | M_ZERO); 1347 state = 0; 1348 } else if (dflen == 0) 1349 state = 5; 1350 break; 1351 1352 default: 1353 pci_printf(cfg, "invalid state: %d\n", state); 1354 state = -1; 1355 break; 1356 } 1357 1358 if (cfg->vpd.vpd_ident == NULL || cfg->vpd.vpd_ident[0] == '\0') { 1359 pci_printf(cfg, "no valid vpd ident found\n"); 1360 state = -2; 1361 } 1362 } 1363 1364 if (cksumvalid <= 0 || state < -1) { 1365 /* read-only data bad, clean up */ 1366 if (cfg->vpd.vpd_ros != NULL) { 1367 for (off = 0; cfg->vpd.vpd_ros[off].value; off++) 1368 free(cfg->vpd.vpd_ros[off].value, M_DEVBUF); 1369 free(cfg->vpd.vpd_ros, M_DEVBUF); 1370 cfg->vpd.vpd_ros = NULL; 1371 } 1372 } 1373 if (state < -1) { 1374 /* I/O error, clean up */ 1375 pci_printf(cfg, "failed to read VPD data.\n"); 1376 if (cfg->vpd.vpd_ident != NULL) { 1377 free(cfg->vpd.vpd_ident, M_DEVBUF); 1378 cfg->vpd.vpd_ident = NULL; 1379 } 1380 if (cfg->vpd.vpd_w != NULL) { 1381 for (off = 0; cfg->vpd.vpd_w[off].value; off++) 1382 free(cfg->vpd.vpd_w[off].value, M_DEVBUF); 1383 free(cfg->vpd.vpd_w, M_DEVBUF); 1384 cfg->vpd.vpd_w = NULL; 1385 } 1386 } 1387 cfg->vpd.vpd_cached = 1; 1388 #undef REG 1389 #undef WREG 1390 } 1391 1392 int 1393 pci_get_vpd_ident_method(device_t dev, device_t child, const char **identptr) 1394 { 1395 struct pci_devinfo *dinfo = device_get_ivars(child); 1396 pcicfgregs *cfg = &dinfo->cfg; 1397 1398 if (!cfg->vpd.vpd_cached && cfg->vpd.vpd_reg != 0) 1399 pci_read_vpd(device_get_parent(dev), cfg); 1400 1401 *identptr = cfg->vpd.vpd_ident; 1402 1403 if (*identptr == NULL) 1404 return (ENXIO); 1405 1406 return (0); 1407 } 1408 1409 int 1410 pci_get_vpd_readonly_method(device_t dev, device_t child, const char *kw, 1411 const char **vptr) 1412 { 1413 struct pci_devinfo *dinfo = device_get_ivars(child); 1414 pcicfgregs *cfg = &dinfo->cfg; 1415 int i; 1416 1417 if (!cfg->vpd.vpd_cached && cfg->vpd.vpd_reg != 0) 1418 pci_read_vpd(device_get_parent(dev), cfg); 1419 1420 for (i = 0; i < cfg->vpd.vpd_rocnt; i++) 1421 if (memcmp(kw, cfg->vpd.vpd_ros[i].keyword, 1422 sizeof(cfg->vpd.vpd_ros[i].keyword)) == 0) { 1423 *vptr = cfg->vpd.vpd_ros[i].value; 1424 return (0); 1425 } 1426 1427 *vptr = NULL; 1428 return (ENXIO); 1429 } 1430 1431 struct pcicfg_vpd * 1432 pci_fetch_vpd_list(device_t dev) 1433 { 1434 struct pci_devinfo *dinfo = device_get_ivars(dev); 1435 pcicfgregs *cfg = &dinfo->cfg; 1436 1437 if (!cfg->vpd.vpd_cached && cfg->vpd.vpd_reg != 0) 1438 pci_read_vpd(device_get_parent(device_get_parent(dev)), cfg); 1439 return (&cfg->vpd); 1440 } 1441 1442 /* 1443 * Find the requested HyperTransport capability and return the offset 1444 * in configuration space via the pointer provided. The function 1445 * returns 0 on success and an error code otherwise. 1446 */ 1447 int 1448 pci_find_htcap_method(device_t dev, device_t child, int capability, int *capreg) 1449 { 1450 int ptr, error; 1451 uint16_t val; 1452 1453 error = pci_find_cap(child, PCIY_HT, &ptr); 1454 if (error) 1455 return (error); 1456 1457 /* 1458 * Traverse the capabilities list checking each HT capability 1459 * to see if it matches the requested HT capability. 1460 */ 1461 for (;;) { 1462 val = pci_read_config(child, ptr + PCIR_HT_COMMAND, 2); 1463 if (capability == PCIM_HTCAP_SLAVE || 1464 capability == PCIM_HTCAP_HOST) 1465 val &= 0xe000; 1466 else 1467 val &= PCIM_HTCMD_CAP_MASK; 1468 if (val == capability) { 1469 if (capreg != NULL) 1470 *capreg = ptr; 1471 return (0); 1472 } 1473 1474 /* Skip to the next HT capability. */ 1475 if (pci_find_next_cap(child, PCIY_HT, ptr, &ptr) != 0) 1476 break; 1477 } 1478 1479 return (ENOENT); 1480 } 1481 1482 /* 1483 * Find the next requested HyperTransport capability after start and return 1484 * the offset in configuration space via the pointer provided. The function 1485 * returns 0 on success and an error code otherwise. 1486 */ 1487 int 1488 pci_find_next_htcap_method(device_t dev, device_t child, int capability, 1489 int start, int *capreg) 1490 { 1491 int ptr; 1492 uint16_t val; 1493 1494 KASSERT(pci_read_config(child, start + PCICAP_ID, 1) == PCIY_HT, 1495 ("start capability is not HyperTransport capability")); 1496 ptr = start; 1497 1498 /* 1499 * Traverse the capabilities list checking each HT capability 1500 * to see if it matches the requested HT capability. 1501 */ 1502 for (;;) { 1503 /* Skip to the next HT capability. */ 1504 if (pci_find_next_cap(child, PCIY_HT, ptr, &ptr) != 0) 1505 break; 1506 1507 val = pci_read_config(child, ptr + PCIR_HT_COMMAND, 2); 1508 if (capability == PCIM_HTCAP_SLAVE || 1509 capability == PCIM_HTCAP_HOST) 1510 val &= 0xe000; 1511 else 1512 val &= PCIM_HTCMD_CAP_MASK; 1513 if (val == capability) { 1514 if (capreg != NULL) 1515 *capreg = ptr; 1516 return (0); 1517 } 1518 } 1519 1520 return (ENOENT); 1521 } 1522 1523 /* 1524 * Find the requested capability and return the offset in 1525 * configuration space via the pointer provided. The function returns 1526 * 0 on success and an error code otherwise. 1527 */ 1528 int 1529 pci_find_cap_method(device_t dev, device_t child, int capability, 1530 int *capreg) 1531 { 1532 struct pci_devinfo *dinfo = device_get_ivars(child); 1533 pcicfgregs *cfg = &dinfo->cfg; 1534 uint32_t status; 1535 uint8_t ptr; 1536 1537 /* 1538 * Check the CAP_LIST bit of the PCI status register first. 1539 */ 1540 status = pci_read_config(child, PCIR_STATUS, 2); 1541 if (!(status & PCIM_STATUS_CAPPRESENT)) 1542 return (ENXIO); 1543 1544 /* 1545 * Determine the start pointer of the capabilities list. 1546 */ 1547 switch (cfg->hdrtype & PCIM_HDRTYPE) { 1548 case PCIM_HDRTYPE_NORMAL: 1549 case PCIM_HDRTYPE_BRIDGE: 1550 ptr = PCIR_CAP_PTR; 1551 break; 1552 case PCIM_HDRTYPE_CARDBUS: 1553 ptr = PCIR_CAP_PTR_2; 1554 break; 1555 default: 1556 /* XXX: panic? */ 1557 return (ENXIO); /* no extended capabilities support */ 1558 } 1559 ptr = pci_read_config(child, ptr, 1); 1560 1561 /* 1562 * Traverse the capabilities list. 1563 */ 1564 while (ptr != 0) { 1565 if (pci_read_config(child, ptr + PCICAP_ID, 1) == capability) { 1566 if (capreg != NULL) 1567 *capreg = ptr; 1568 return (0); 1569 } 1570 ptr = pci_read_config(child, ptr + PCICAP_NEXTPTR, 1); 1571 } 1572 1573 return (ENOENT); 1574 } 1575 1576 /* 1577 * Find the next requested capability after start and return the offset in 1578 * configuration space via the pointer provided. The function returns 1579 * 0 on success and an error code otherwise. 1580 */ 1581 int 1582 pci_find_next_cap_method(device_t dev, device_t child, int capability, 1583 int start, int *capreg) 1584 { 1585 uint8_t ptr; 1586 1587 KASSERT(pci_read_config(child, start + PCICAP_ID, 1) == capability, 1588 ("start capability is not expected capability")); 1589 1590 ptr = pci_read_config(child, start + PCICAP_NEXTPTR, 1); 1591 while (ptr != 0) { 1592 if (pci_read_config(child, ptr + PCICAP_ID, 1) == capability) { 1593 if (capreg != NULL) 1594 *capreg = ptr; 1595 return (0); 1596 } 1597 ptr = pci_read_config(child, ptr + PCICAP_NEXTPTR, 1); 1598 } 1599 1600 return (ENOENT); 1601 } 1602 1603 /* 1604 * Find the requested extended capability and return the offset in 1605 * configuration space via the pointer provided. The function returns 1606 * 0 on success and an error code otherwise. 1607 */ 1608 int 1609 pci_find_extcap_method(device_t dev, device_t child, int capability, 1610 int *capreg) 1611 { 1612 struct pci_devinfo *dinfo = device_get_ivars(child); 1613 pcicfgregs *cfg = &dinfo->cfg; 1614 uint32_t ecap; 1615 uint16_t ptr; 1616 1617 /* Only supported for PCI-express devices. */ 1618 if (cfg->pcie.pcie_location == 0) 1619 return (ENXIO); 1620 1621 ptr = PCIR_EXTCAP; 1622 ecap = pci_read_config(child, ptr, 4); 1623 if (ecap == 0xffffffff || ecap == 0) 1624 return (ENOENT); 1625 for (;;) { 1626 if (PCI_EXTCAP_ID(ecap) == capability) { 1627 if (capreg != NULL) 1628 *capreg = ptr; 1629 return (0); 1630 } 1631 ptr = PCI_EXTCAP_NEXTPTR(ecap); 1632 if (ptr == 0) 1633 break; 1634 ecap = pci_read_config(child, ptr, 4); 1635 } 1636 1637 return (ENOENT); 1638 } 1639 1640 /* 1641 * Find the next requested extended capability after start and return the 1642 * offset in configuration space via the pointer provided. The function 1643 * returns 0 on success and an error code otherwise. 1644 */ 1645 int 1646 pci_find_next_extcap_method(device_t dev, device_t child, int capability, 1647 int start, int *capreg) 1648 { 1649 struct pci_devinfo *dinfo = device_get_ivars(child); 1650 pcicfgregs *cfg = &dinfo->cfg; 1651 uint32_t ecap; 1652 uint16_t ptr; 1653 1654 /* Only supported for PCI-express devices. */ 1655 if (cfg->pcie.pcie_location == 0) 1656 return (ENXIO); 1657 1658 ecap = pci_read_config(child, start, 4); 1659 KASSERT(PCI_EXTCAP_ID(ecap) == capability, 1660 ("start extended capability is not expected capability")); 1661 ptr = PCI_EXTCAP_NEXTPTR(ecap); 1662 while (ptr != 0) { 1663 ecap = pci_read_config(child, ptr, 4); 1664 if (PCI_EXTCAP_ID(ecap) == capability) { 1665 if (capreg != NULL) 1666 *capreg = ptr; 1667 return (0); 1668 } 1669 ptr = PCI_EXTCAP_NEXTPTR(ecap); 1670 } 1671 1672 return (ENOENT); 1673 } 1674 1675 /* 1676 * Support for MSI-X message interrupts. 1677 */ 1678 static void 1679 pci_write_msix_entry(device_t dev, u_int index, uint64_t address, uint32_t data) 1680 { 1681 struct pci_devinfo *dinfo = device_get_ivars(dev); 1682 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1683 uint32_t offset; 1684 1685 KASSERT(msix->msix_table_len > index, ("bogus index")); 1686 offset = msix->msix_table_offset + index * 16; 1687 bus_write_4(msix->msix_table_res, offset, address & 0xffffffff); 1688 bus_write_4(msix->msix_table_res, offset + 4, address >> 32); 1689 bus_write_4(msix->msix_table_res, offset + 8, data); 1690 } 1691 1692 void 1693 pci_enable_msix_method(device_t dev, device_t child, u_int index, 1694 uint64_t address, uint32_t data) 1695 { 1696 1697 if (pci_msix_rewrite_table) { 1698 struct pci_devinfo *dinfo = device_get_ivars(child); 1699 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1700 1701 /* 1702 * Some VM hosts require MSIX to be disabled in the 1703 * control register before updating the MSIX table 1704 * entries are allowed. It is not enough to only 1705 * disable MSIX while updating a single entry. MSIX 1706 * must be disabled while updating all entries in the 1707 * table. 1708 */ 1709 pci_write_config(child, 1710 msix->msix_location + PCIR_MSIX_CTRL, 1711 msix->msix_ctrl & ~PCIM_MSIXCTRL_MSIX_ENABLE, 2); 1712 pci_resume_msix(child); 1713 } else 1714 pci_write_msix_entry(child, index, address, data); 1715 1716 /* Enable MSI -> HT mapping. */ 1717 pci_ht_map_msi(child, address); 1718 } 1719 1720 void 1721 pci_mask_msix(device_t dev, u_int index) 1722 { 1723 struct pci_devinfo *dinfo = device_get_ivars(dev); 1724 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1725 uint32_t offset, val; 1726 1727 KASSERT(msix->msix_msgnum > index, ("bogus index")); 1728 offset = msix->msix_table_offset + index * 16 + 12; 1729 val = bus_read_4(msix->msix_table_res, offset); 1730 val |= PCIM_MSIX_VCTRL_MASK; 1731 1732 /* 1733 * Some devices (e.g. Samsung PM961) do not support reads of this 1734 * register, so always write the new value. 1735 */ 1736 bus_write_4(msix->msix_table_res, offset, val); 1737 } 1738 1739 void 1740 pci_unmask_msix(device_t dev, u_int index) 1741 { 1742 struct pci_devinfo *dinfo = device_get_ivars(dev); 1743 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1744 uint32_t offset, val; 1745 1746 KASSERT(msix->msix_table_len > index, ("bogus index")); 1747 offset = msix->msix_table_offset + index * 16 + 12; 1748 val = bus_read_4(msix->msix_table_res, offset); 1749 val &= ~PCIM_MSIX_VCTRL_MASK; 1750 1751 /* 1752 * Some devices (e.g. Samsung PM961) do not support reads of this 1753 * register, so always write the new value. 1754 */ 1755 bus_write_4(msix->msix_table_res, offset, val); 1756 } 1757 1758 int 1759 pci_pending_msix(device_t dev, u_int index) 1760 { 1761 struct pci_devinfo *dinfo = device_get_ivars(dev); 1762 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1763 uint32_t offset, bit; 1764 1765 KASSERT(msix->msix_table_len > index, ("bogus index")); 1766 offset = msix->msix_pba_offset + (index / 32) * 4; 1767 bit = 1 << index % 32; 1768 return (bus_read_4(msix->msix_pba_res, offset) & bit); 1769 } 1770 1771 /* 1772 * Restore MSI-X registers and table during resume. If MSI-X is 1773 * enabled then walk the virtual table to restore the actual MSI-X 1774 * table. 1775 */ 1776 static void 1777 pci_resume_msix(device_t dev) 1778 { 1779 struct pci_devinfo *dinfo = device_get_ivars(dev); 1780 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1781 struct msix_table_entry *mte; 1782 struct msix_vector *mv; 1783 int i; 1784 1785 if (msix->msix_alloc > 0) { 1786 /* First, mask all vectors. */ 1787 for (i = 0; i < msix->msix_msgnum; i++) 1788 pci_mask_msix(dev, i); 1789 1790 /* Second, program any messages with at least one handler. */ 1791 for (i = 0; i < msix->msix_table_len; i++) { 1792 mte = &msix->msix_table[i]; 1793 if (mte->mte_vector == 0 || mte->mte_handlers == 0) 1794 continue; 1795 mv = &msix->msix_vectors[mte->mte_vector - 1]; 1796 pci_write_msix_entry(dev, i, mv->mv_address, 1797 mv->mv_data); 1798 pci_unmask_msix(dev, i); 1799 } 1800 } 1801 pci_write_config(dev, msix->msix_location + PCIR_MSIX_CTRL, 1802 msix->msix_ctrl, 2); 1803 } 1804 1805 /* 1806 * Attempt to allocate *count MSI-X messages. The actual number allocated is 1807 * returned in *count. After this function returns, each message will be 1808 * available to the driver as SYS_RES_IRQ resources starting at rid 1. 1809 */ 1810 int 1811 pci_alloc_msix_method(device_t dev, device_t child, int *count) 1812 { 1813 struct pci_devinfo *dinfo = device_get_ivars(child); 1814 pcicfgregs *cfg = &dinfo->cfg; 1815 struct resource_list_entry *rle; 1816 int actual, error, i, irq, max; 1817 1818 /* Don't let count == 0 get us into trouble. */ 1819 if (*count == 0) 1820 return (EINVAL); 1821 1822 /* If rid 0 is allocated, then fail. */ 1823 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, 0); 1824 if (rle != NULL && rle->res != NULL) 1825 return (ENXIO); 1826 1827 /* Already have allocated messages? */ 1828 if (cfg->msi.msi_alloc != 0 || cfg->msix.msix_alloc != 0) 1829 return (ENXIO); 1830 1831 /* If MSI-X is blacklisted for this system, fail. */ 1832 if (pci_msix_blacklisted()) 1833 return (ENXIO); 1834 1835 /* MSI-X capability present? */ 1836 if (cfg->msix.msix_location == 0 || !pci_do_msix) 1837 return (ENODEV); 1838 1839 /* Make sure the appropriate BARs are mapped. */ 1840 rle = resource_list_find(&dinfo->resources, SYS_RES_MEMORY, 1841 cfg->msix.msix_table_bar); 1842 if (rle == NULL || rle->res == NULL || 1843 !(rman_get_flags(rle->res) & RF_ACTIVE)) 1844 return (ENXIO); 1845 cfg->msix.msix_table_res = rle->res; 1846 if (cfg->msix.msix_pba_bar != cfg->msix.msix_table_bar) { 1847 rle = resource_list_find(&dinfo->resources, SYS_RES_MEMORY, 1848 cfg->msix.msix_pba_bar); 1849 if (rle == NULL || rle->res == NULL || 1850 !(rman_get_flags(rle->res) & RF_ACTIVE)) 1851 return (ENXIO); 1852 } 1853 cfg->msix.msix_pba_res = rle->res; 1854 1855 if (bootverbose) 1856 device_printf(child, 1857 "attempting to allocate %d MSI-X vectors (%d supported)\n", 1858 *count, cfg->msix.msix_msgnum); 1859 max = min(*count, cfg->msix.msix_msgnum); 1860 for (i = 0; i < max; i++) { 1861 /* Allocate a message. */ 1862 error = PCIB_ALLOC_MSIX(device_get_parent(dev), child, &irq); 1863 if (error) { 1864 if (i == 0) 1865 return (error); 1866 break; 1867 } 1868 resource_list_add(&dinfo->resources, SYS_RES_IRQ, i + 1, irq, 1869 irq, 1); 1870 } 1871 actual = i; 1872 1873 if (bootverbose) { 1874 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, 1); 1875 if (actual == 1) 1876 device_printf(child, "using IRQ %ju for MSI-X\n", 1877 rle->start); 1878 else { 1879 int run; 1880 1881 /* 1882 * Be fancy and try to print contiguous runs of 1883 * IRQ values as ranges. 'irq' is the previous IRQ. 1884 * 'run' is true if we are in a range. 1885 */ 1886 device_printf(child, "using IRQs %ju", rle->start); 1887 irq = rle->start; 1888 run = 0; 1889 for (i = 1; i < actual; i++) { 1890 rle = resource_list_find(&dinfo->resources, 1891 SYS_RES_IRQ, i + 1); 1892 1893 /* Still in a run? */ 1894 if (rle->start == irq + 1) { 1895 run = 1; 1896 irq++; 1897 continue; 1898 } 1899 1900 /* Finish previous range. */ 1901 if (run) { 1902 printf("-%d", irq); 1903 run = 0; 1904 } 1905 1906 /* Start new range. */ 1907 printf(",%ju", rle->start); 1908 irq = rle->start; 1909 } 1910 1911 /* Unfinished range? */ 1912 if (run) 1913 printf("-%d", irq); 1914 printf(" for MSI-X\n"); 1915 } 1916 } 1917 1918 /* Mask all vectors. */ 1919 for (i = 0; i < cfg->msix.msix_msgnum; i++) 1920 pci_mask_msix(child, i); 1921 1922 /* Allocate and initialize vector data and virtual table. */ 1923 cfg->msix.msix_vectors = malloc(sizeof(struct msix_vector) * actual, 1924 M_DEVBUF, M_WAITOK | M_ZERO); 1925 cfg->msix.msix_table = malloc(sizeof(struct msix_table_entry) * actual, 1926 M_DEVBUF, M_WAITOK | M_ZERO); 1927 for (i = 0; i < actual; i++) { 1928 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, i + 1); 1929 cfg->msix.msix_vectors[i].mv_irq = rle->start; 1930 cfg->msix.msix_table[i].mte_vector = i + 1; 1931 } 1932 1933 /* Update control register to enable MSI-X. */ 1934 cfg->msix.msix_ctrl |= PCIM_MSIXCTRL_MSIX_ENABLE; 1935 pci_write_config(child, cfg->msix.msix_location + PCIR_MSIX_CTRL, 1936 cfg->msix.msix_ctrl, 2); 1937 1938 /* Update counts of alloc'd messages. */ 1939 cfg->msix.msix_alloc = actual; 1940 cfg->msix.msix_table_len = actual; 1941 *count = actual; 1942 return (0); 1943 } 1944 1945 /* 1946 * By default, pci_alloc_msix() will assign the allocated IRQ 1947 * resources consecutively to the first N messages in the MSI-X table. 1948 * However, device drivers may want to use different layouts if they 1949 * either receive fewer messages than they asked for, or they wish to 1950 * populate the MSI-X table sparsely. This method allows the driver 1951 * to specify what layout it wants. It must be called after a 1952 * successful pci_alloc_msix() but before any of the associated 1953 * SYS_RES_IRQ resources are allocated via bus_alloc_resource(). 1954 * 1955 * The 'vectors' array contains 'count' message vectors. The array 1956 * maps directly to the MSI-X table in that index 0 in the array 1957 * specifies the vector for the first message in the MSI-X table, etc. 1958 * The vector value in each array index can either be 0 to indicate 1959 * that no vector should be assigned to a message slot, or it can be a 1960 * number from 1 to N (where N is the count returned from a 1961 * succcessful call to pci_alloc_msix()) to indicate which message 1962 * vector (IRQ) to be used for the corresponding message. 1963 * 1964 * On successful return, each message with a non-zero vector will have 1965 * an associated SYS_RES_IRQ whose rid is equal to the array index + 1966 * 1. Additionally, if any of the IRQs allocated via the previous 1967 * call to pci_alloc_msix() are not used in the mapping, those IRQs 1968 * will be freed back to the system automatically. 1969 * 1970 * For example, suppose a driver has a MSI-X table with 6 messages and 1971 * asks for 6 messages, but pci_alloc_msix() only returns a count of 1972 * 3. Call the three vectors allocated by pci_alloc_msix() A, B, and 1973 * C. After the call to pci_alloc_msix(), the device will be setup to 1974 * have an MSI-X table of ABC--- (where - means no vector assigned). 1975 * If the driver then passes a vector array of { 1, 0, 1, 2, 0, 2 }, 1976 * then the MSI-X table will look like A-AB-B, and the 'C' vector will 1977 * be freed back to the system. This device will also have valid 1978 * SYS_RES_IRQ rids of 1, 3, 4, and 6. 1979 * 1980 * In any case, the SYS_RES_IRQ rid X will always map to the message 1981 * at MSI-X table index X - 1 and will only be valid if a vector is 1982 * assigned to that table entry. 1983 */ 1984 int 1985 pci_remap_msix_method(device_t dev, device_t child, int count, 1986 const u_int *vectors) 1987 { 1988 struct pci_devinfo *dinfo = device_get_ivars(child); 1989 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1990 struct resource_list_entry *rle; 1991 int i, irq, j, *used; 1992 1993 /* 1994 * Have to have at least one message in the table but the 1995 * table can't be bigger than the actual MSI-X table in the 1996 * device. 1997 */ 1998 if (count == 0 || count > msix->msix_msgnum) 1999 return (EINVAL); 2000 2001 /* Sanity check the vectors. */ 2002 for (i = 0; i < count; i++) 2003 if (vectors[i] > msix->msix_alloc) 2004 return (EINVAL); 2005 2006 /* 2007 * Make sure there aren't any holes in the vectors to be used. 2008 * It's a big pain to support it, and it doesn't really make 2009 * sense anyway. Also, at least one vector must be used. 2010 */ 2011 used = malloc(sizeof(int) * msix->msix_alloc, M_DEVBUF, M_WAITOK | 2012 M_ZERO); 2013 for (i = 0; i < count; i++) 2014 if (vectors[i] != 0) 2015 used[vectors[i] - 1] = 1; 2016 for (i = 0; i < msix->msix_alloc - 1; i++) 2017 if (used[i] == 0 && used[i + 1] == 1) { 2018 free(used, M_DEVBUF); 2019 return (EINVAL); 2020 } 2021 if (used[0] != 1) { 2022 free(used, M_DEVBUF); 2023 return (EINVAL); 2024 } 2025 2026 /* Make sure none of the resources are allocated. */ 2027 for (i = 0; i < msix->msix_table_len; i++) { 2028 if (msix->msix_table[i].mte_vector == 0) 2029 continue; 2030 if (msix->msix_table[i].mte_handlers > 0) { 2031 free(used, M_DEVBUF); 2032 return (EBUSY); 2033 } 2034 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, i + 1); 2035 KASSERT(rle != NULL, ("missing resource")); 2036 if (rle->res != NULL) { 2037 free(used, M_DEVBUF); 2038 return (EBUSY); 2039 } 2040 } 2041 2042 /* Free the existing resource list entries. */ 2043 for (i = 0; i < msix->msix_table_len; i++) { 2044 if (msix->msix_table[i].mte_vector == 0) 2045 continue; 2046 resource_list_delete(&dinfo->resources, SYS_RES_IRQ, i + 1); 2047 } 2048 2049 /* 2050 * Build the new virtual table keeping track of which vectors are 2051 * used. 2052 */ 2053 free(msix->msix_table, M_DEVBUF); 2054 msix->msix_table = malloc(sizeof(struct msix_table_entry) * count, 2055 M_DEVBUF, M_WAITOK | M_ZERO); 2056 for (i = 0; i < count; i++) 2057 msix->msix_table[i].mte_vector = vectors[i]; 2058 msix->msix_table_len = count; 2059 2060 /* Free any unused IRQs and resize the vectors array if necessary. */ 2061 j = msix->msix_alloc - 1; 2062 if (used[j] == 0) { 2063 struct msix_vector *vec; 2064 2065 while (used[j] == 0) { 2066 PCIB_RELEASE_MSIX(device_get_parent(dev), child, 2067 msix->msix_vectors[j].mv_irq); 2068 j--; 2069 } 2070 vec = malloc(sizeof(struct msix_vector) * (j + 1), M_DEVBUF, 2071 M_WAITOK); 2072 bcopy(msix->msix_vectors, vec, sizeof(struct msix_vector) * 2073 (j + 1)); 2074 free(msix->msix_vectors, M_DEVBUF); 2075 msix->msix_vectors = vec; 2076 msix->msix_alloc = j + 1; 2077 } 2078 free(used, M_DEVBUF); 2079 2080 /* Map the IRQs onto the rids. */ 2081 for (i = 0; i < count; i++) { 2082 if (vectors[i] == 0) 2083 continue; 2084 irq = msix->msix_vectors[vectors[i] - 1].mv_irq; 2085 resource_list_add(&dinfo->resources, SYS_RES_IRQ, i + 1, irq, 2086 irq, 1); 2087 } 2088 2089 if (bootverbose) { 2090 device_printf(child, "Remapped MSI-X IRQs as: "); 2091 for (i = 0; i < count; i++) { 2092 if (i != 0) 2093 printf(", "); 2094 if (vectors[i] == 0) 2095 printf("---"); 2096 else 2097 printf("%d", 2098 msix->msix_vectors[vectors[i] - 1].mv_irq); 2099 } 2100 printf("\n"); 2101 } 2102 2103 return (0); 2104 } 2105 2106 static int 2107 pci_release_msix(device_t dev, device_t child) 2108 { 2109 struct pci_devinfo *dinfo = device_get_ivars(child); 2110 struct pcicfg_msix *msix = &dinfo->cfg.msix; 2111 struct resource_list_entry *rle; 2112 int i; 2113 2114 /* Do we have any messages to release? */ 2115 if (msix->msix_alloc == 0) 2116 return (ENODEV); 2117 2118 /* Make sure none of the resources are allocated. */ 2119 for (i = 0; i < msix->msix_table_len; i++) { 2120 if (msix->msix_table[i].mte_vector == 0) 2121 continue; 2122 if (msix->msix_table[i].mte_handlers > 0) 2123 return (EBUSY); 2124 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, i + 1); 2125 KASSERT(rle != NULL, ("missing resource")); 2126 if (rle->res != NULL) 2127 return (EBUSY); 2128 } 2129 2130 /* Update control register to disable MSI-X. */ 2131 msix->msix_ctrl &= ~PCIM_MSIXCTRL_MSIX_ENABLE; 2132 pci_write_config(child, msix->msix_location + PCIR_MSIX_CTRL, 2133 msix->msix_ctrl, 2); 2134 2135 /* Free the resource list entries. */ 2136 for (i = 0; i < msix->msix_table_len; i++) { 2137 if (msix->msix_table[i].mte_vector == 0) 2138 continue; 2139 resource_list_delete(&dinfo->resources, SYS_RES_IRQ, i + 1); 2140 } 2141 free(msix->msix_table, M_DEVBUF); 2142 msix->msix_table_len = 0; 2143 2144 /* Release the IRQs. */ 2145 for (i = 0; i < msix->msix_alloc; i++) 2146 PCIB_RELEASE_MSIX(device_get_parent(dev), child, 2147 msix->msix_vectors[i].mv_irq); 2148 free(msix->msix_vectors, M_DEVBUF); 2149 msix->msix_alloc = 0; 2150 return (0); 2151 } 2152 2153 /* 2154 * Return the max supported MSI-X messages this device supports. 2155 * Basically, assuming the MD code can alloc messages, this function 2156 * should return the maximum value that pci_alloc_msix() can return. 2157 * Thus, it is subject to the tunables, etc. 2158 */ 2159 int 2160 pci_msix_count_method(device_t dev, device_t child) 2161 { 2162 struct pci_devinfo *dinfo = device_get_ivars(child); 2163 struct pcicfg_msix *msix = &dinfo->cfg.msix; 2164 2165 if (pci_do_msix && msix->msix_location != 0) 2166 return (msix->msix_msgnum); 2167 return (0); 2168 } 2169 2170 int 2171 pci_msix_pba_bar_method(device_t dev, device_t child) 2172 { 2173 struct pci_devinfo *dinfo = device_get_ivars(child); 2174 struct pcicfg_msix *msix = &dinfo->cfg.msix; 2175 2176 if (pci_do_msix && msix->msix_location != 0) 2177 return (msix->msix_pba_bar); 2178 return (-1); 2179 } 2180 2181 int 2182 pci_msix_table_bar_method(device_t dev, device_t child) 2183 { 2184 struct pci_devinfo *dinfo = device_get_ivars(child); 2185 struct pcicfg_msix *msix = &dinfo->cfg.msix; 2186 2187 if (pci_do_msix && msix->msix_location != 0) 2188 return (msix->msix_table_bar); 2189 return (-1); 2190 } 2191 2192 /* 2193 * HyperTransport MSI mapping control 2194 */ 2195 void 2196 pci_ht_map_msi(device_t dev, uint64_t addr) 2197 { 2198 struct pci_devinfo *dinfo = device_get_ivars(dev); 2199 struct pcicfg_ht *ht = &dinfo->cfg.ht; 2200 2201 if (!ht->ht_msimap) 2202 return; 2203 2204 if (addr && !(ht->ht_msictrl & PCIM_HTCMD_MSI_ENABLE) && 2205 ht->ht_msiaddr >> 20 == addr >> 20) { 2206 /* Enable MSI -> HT mapping. */ 2207 ht->ht_msictrl |= PCIM_HTCMD_MSI_ENABLE; 2208 pci_write_config(dev, ht->ht_msimap + PCIR_HT_COMMAND, 2209 ht->ht_msictrl, 2); 2210 } 2211 2212 if (!addr && ht->ht_msictrl & PCIM_HTCMD_MSI_ENABLE) { 2213 /* Disable MSI -> HT mapping. */ 2214 ht->ht_msictrl &= ~PCIM_HTCMD_MSI_ENABLE; 2215 pci_write_config(dev, ht->ht_msimap + PCIR_HT_COMMAND, 2216 ht->ht_msictrl, 2); 2217 } 2218 } 2219 2220 int 2221 pci_get_relaxed_ordering_enabled(device_t dev) 2222 { 2223 struct pci_devinfo *dinfo = device_get_ivars(dev); 2224 int cap; 2225 uint16_t val; 2226 2227 cap = dinfo->cfg.pcie.pcie_location; 2228 if (cap == 0) 2229 return (0); 2230 val = pci_read_config(dev, cap + PCIER_DEVICE_CTL, 2); 2231 val &= PCIEM_CTL_RELAXED_ORD_ENABLE; 2232 return (val != 0); 2233 } 2234 2235 int 2236 pci_get_max_payload(device_t dev) 2237 { 2238 struct pci_devinfo *dinfo = device_get_ivars(dev); 2239 int cap; 2240 uint16_t val; 2241 2242 cap = dinfo->cfg.pcie.pcie_location; 2243 if (cap == 0) 2244 return (0); 2245 val = pci_read_config(dev, cap + PCIER_DEVICE_CTL, 2); 2246 val &= PCIEM_CTL_MAX_PAYLOAD; 2247 val >>= 5; 2248 return (1 << (val + 7)); 2249 } 2250 2251 int 2252 pci_get_max_read_req(device_t dev) 2253 { 2254 struct pci_devinfo *dinfo = device_get_ivars(dev); 2255 int cap; 2256 uint16_t val; 2257 2258 cap = dinfo->cfg.pcie.pcie_location; 2259 if (cap == 0) 2260 return (0); 2261 val = pci_read_config(dev, cap + PCIER_DEVICE_CTL, 2); 2262 val &= PCIEM_CTL_MAX_READ_REQUEST; 2263 val >>= 12; 2264 return (1 << (val + 7)); 2265 } 2266 2267 int 2268 pci_set_max_read_req(device_t dev, int size) 2269 { 2270 struct pci_devinfo *dinfo = device_get_ivars(dev); 2271 int cap; 2272 uint16_t val; 2273 2274 cap = dinfo->cfg.pcie.pcie_location; 2275 if (cap == 0) 2276 return (0); 2277 if (size < 128) 2278 size = 128; 2279 if (size > 4096) 2280 size = 4096; 2281 size = (1 << (fls(size) - 1)); 2282 val = pci_read_config(dev, cap + PCIER_DEVICE_CTL, 2); 2283 val &= ~PCIEM_CTL_MAX_READ_REQUEST; 2284 val |= (fls(size) - 8) << 12; 2285 pci_write_config(dev, cap + PCIER_DEVICE_CTL, val, 2); 2286 return (size); 2287 } 2288 2289 uint32_t 2290 pcie_read_config(device_t dev, int reg, int width) 2291 { 2292 struct pci_devinfo *dinfo = device_get_ivars(dev); 2293 int cap; 2294 2295 cap = dinfo->cfg.pcie.pcie_location; 2296 if (cap == 0) { 2297 if (width == 2) 2298 return (0xffff); 2299 return (0xffffffff); 2300 } 2301 2302 return (pci_read_config(dev, cap + reg, width)); 2303 } 2304 2305 void 2306 pcie_write_config(device_t dev, int reg, uint32_t value, int width) 2307 { 2308 struct pci_devinfo *dinfo = device_get_ivars(dev); 2309 int cap; 2310 2311 cap = dinfo->cfg.pcie.pcie_location; 2312 if (cap == 0) 2313 return; 2314 pci_write_config(dev, cap + reg, value, width); 2315 } 2316 2317 /* 2318 * Adjusts a PCI-e capability register by clearing the bits in mask 2319 * and setting the bits in (value & mask). Bits not set in mask are 2320 * not adjusted. 2321 * 2322 * Returns the old value on success or all ones on failure. 2323 */ 2324 uint32_t 2325 pcie_adjust_config(device_t dev, int reg, uint32_t mask, uint32_t value, 2326 int width) 2327 { 2328 struct pci_devinfo *dinfo = device_get_ivars(dev); 2329 uint32_t old, new; 2330 int cap; 2331 2332 cap = dinfo->cfg.pcie.pcie_location; 2333 if (cap == 0) { 2334 if (width == 2) 2335 return (0xffff); 2336 return (0xffffffff); 2337 } 2338 2339 old = pci_read_config(dev, cap + reg, width); 2340 new = old & ~mask; 2341 new |= (value & mask); 2342 pci_write_config(dev, cap + reg, new, width); 2343 return (old); 2344 } 2345 2346 /* 2347 * Support for MSI message signalled interrupts. 2348 */ 2349 void 2350 pci_enable_msi_method(device_t dev, device_t child, uint64_t address, 2351 uint16_t data) 2352 { 2353 struct pci_devinfo *dinfo = device_get_ivars(child); 2354 struct pcicfg_msi *msi = &dinfo->cfg.msi; 2355 2356 /* Write data and address values. */ 2357 pci_write_config(child, msi->msi_location + PCIR_MSI_ADDR, 2358 address & 0xffffffff, 4); 2359 if (msi->msi_ctrl & PCIM_MSICTRL_64BIT) { 2360 pci_write_config(child, msi->msi_location + PCIR_MSI_ADDR_HIGH, 2361 address >> 32, 4); 2362 pci_write_config(child, msi->msi_location + PCIR_MSI_DATA_64BIT, 2363 data, 2); 2364 } else 2365 pci_write_config(child, msi->msi_location + PCIR_MSI_DATA, data, 2366 2); 2367 2368 /* Enable MSI in the control register. */ 2369 msi->msi_ctrl |= PCIM_MSICTRL_MSI_ENABLE; 2370 pci_write_config(child, msi->msi_location + PCIR_MSI_CTRL, 2371 msi->msi_ctrl, 2); 2372 2373 /* Enable MSI -> HT mapping. */ 2374 pci_ht_map_msi(child, address); 2375 } 2376 2377 void 2378 pci_disable_msi_method(device_t dev, device_t child) 2379 { 2380 struct pci_devinfo *dinfo = device_get_ivars(child); 2381 struct pcicfg_msi *msi = &dinfo->cfg.msi; 2382 2383 /* Disable MSI -> HT mapping. */ 2384 pci_ht_map_msi(child, 0); 2385 2386 /* Disable MSI in the control register. */ 2387 msi->msi_ctrl &= ~PCIM_MSICTRL_MSI_ENABLE; 2388 pci_write_config(child, msi->msi_location + PCIR_MSI_CTRL, 2389 msi->msi_ctrl, 2); 2390 } 2391 2392 /* 2393 * Restore MSI registers during resume. If MSI is enabled then 2394 * restore the data and address registers in addition to the control 2395 * register. 2396 */ 2397 static void 2398 pci_resume_msi(device_t dev) 2399 { 2400 struct pci_devinfo *dinfo = device_get_ivars(dev); 2401 struct pcicfg_msi *msi = &dinfo->cfg.msi; 2402 uint64_t address; 2403 uint16_t data; 2404 2405 if (msi->msi_ctrl & PCIM_MSICTRL_MSI_ENABLE) { 2406 address = msi->msi_addr; 2407 data = msi->msi_data; 2408 pci_write_config(dev, msi->msi_location + PCIR_MSI_ADDR, 2409 address & 0xffffffff, 4); 2410 if (msi->msi_ctrl & PCIM_MSICTRL_64BIT) { 2411 pci_write_config(dev, msi->msi_location + 2412 PCIR_MSI_ADDR_HIGH, address >> 32, 4); 2413 pci_write_config(dev, msi->msi_location + 2414 PCIR_MSI_DATA_64BIT, data, 2); 2415 } else 2416 pci_write_config(dev, msi->msi_location + PCIR_MSI_DATA, 2417 data, 2); 2418 } 2419 pci_write_config(dev, msi->msi_location + PCIR_MSI_CTRL, msi->msi_ctrl, 2420 2); 2421 } 2422 2423 static int 2424 pci_remap_intr_method(device_t bus, device_t dev, u_int irq) 2425 { 2426 struct pci_devinfo *dinfo = device_get_ivars(dev); 2427 pcicfgregs *cfg = &dinfo->cfg; 2428 struct resource_list_entry *rle; 2429 struct msix_table_entry *mte; 2430 struct msix_vector *mv; 2431 uint64_t addr; 2432 uint32_t data; 2433 int error, i, j; 2434 2435 /* 2436 * Handle MSI first. We try to find this IRQ among our list 2437 * of MSI IRQs. If we find it, we request updated address and 2438 * data registers and apply the results. 2439 */ 2440 if (cfg->msi.msi_alloc > 0) { 2441 /* If we don't have any active handlers, nothing to do. */ 2442 if (cfg->msi.msi_handlers == 0) 2443 return (0); 2444 for (i = 0; i < cfg->msi.msi_alloc; i++) { 2445 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, 2446 i + 1); 2447 if (rle->start == irq) { 2448 error = PCIB_MAP_MSI(device_get_parent(bus), 2449 dev, irq, &addr, &data); 2450 if (error) 2451 return (error); 2452 pci_disable_msi(dev); 2453 dinfo->cfg.msi.msi_addr = addr; 2454 dinfo->cfg.msi.msi_data = data; 2455 pci_enable_msi(dev, addr, data); 2456 return (0); 2457 } 2458 } 2459 return (ENOENT); 2460 } 2461 2462 /* 2463 * For MSI-X, we check to see if we have this IRQ. If we do, 2464 * we request the updated mapping info. If that works, we go 2465 * through all the slots that use this IRQ and update them. 2466 */ 2467 if (cfg->msix.msix_alloc > 0) { 2468 for (i = 0; i < cfg->msix.msix_alloc; i++) { 2469 mv = &cfg->msix.msix_vectors[i]; 2470 if (mv->mv_irq == irq) { 2471 error = PCIB_MAP_MSI(device_get_parent(bus), 2472 dev, irq, &addr, &data); 2473 if (error) 2474 return (error); 2475 mv->mv_address = addr; 2476 mv->mv_data = data; 2477 for (j = 0; j < cfg->msix.msix_table_len; j++) { 2478 mte = &cfg->msix.msix_table[j]; 2479 if (mte->mte_vector != i + 1) 2480 continue; 2481 if (mte->mte_handlers == 0) 2482 continue; 2483 pci_mask_msix(dev, j); 2484 pci_enable_msix(dev, j, addr, data); 2485 pci_unmask_msix(dev, j); 2486 } 2487 } 2488 } 2489 return (ENOENT); 2490 } 2491 2492 return (ENOENT); 2493 } 2494 2495 /* 2496 * Returns true if the specified device is blacklisted because MSI 2497 * doesn't work. 2498 */ 2499 int 2500 pci_msi_device_blacklisted(device_t dev) 2501 { 2502 2503 if (!pci_honor_msi_blacklist) 2504 return (0); 2505 2506 return (pci_has_quirk(pci_get_devid(dev), PCI_QUIRK_DISABLE_MSI)); 2507 } 2508 2509 /* 2510 * Determine if MSI is blacklisted globally on this system. Currently, 2511 * we just check for blacklisted chipsets as represented by the 2512 * host-PCI bridge at device 0:0:0. In the future, it may become 2513 * necessary to check other system attributes, such as the kenv values 2514 * that give the motherboard manufacturer and model number. 2515 */ 2516 static int 2517 pci_msi_blacklisted(void) 2518 { 2519 device_t dev; 2520 2521 if (!pci_honor_msi_blacklist) 2522 return (0); 2523 2524 /* Blacklist all non-PCI-express and non-PCI-X chipsets. */ 2525 if (!(pcie_chipset || pcix_chipset)) { 2526 if (vm_guest != VM_GUEST_NO) { 2527 /* 2528 * Whitelist older chipsets in virtual 2529 * machines known to support MSI. 2530 */ 2531 dev = pci_find_bsf(0, 0, 0); 2532 if (dev != NULL) 2533 return (!pci_has_quirk(pci_get_devid(dev), 2534 PCI_QUIRK_ENABLE_MSI_VM)); 2535 } 2536 return (1); 2537 } 2538 2539 dev = pci_find_bsf(0, 0, 0); 2540 if (dev != NULL) 2541 return (pci_msi_device_blacklisted(dev)); 2542 return (0); 2543 } 2544 2545 /* 2546 * Returns true if the specified device is blacklisted because MSI-X 2547 * doesn't work. Note that this assumes that if MSI doesn't work, 2548 * MSI-X doesn't either. 2549 */ 2550 int 2551 pci_msix_device_blacklisted(device_t dev) 2552 { 2553 2554 if (!pci_honor_msi_blacklist) 2555 return (0); 2556 2557 if (pci_has_quirk(pci_get_devid(dev), PCI_QUIRK_DISABLE_MSIX)) 2558 return (1); 2559 2560 return (pci_msi_device_blacklisted(dev)); 2561 } 2562 2563 /* 2564 * Determine if MSI-X is blacklisted globally on this system. If MSI 2565 * is blacklisted, assume that MSI-X is as well. Check for additional 2566 * chipsets where MSI works but MSI-X does not. 2567 */ 2568 static int 2569 pci_msix_blacklisted(void) 2570 { 2571 device_t dev; 2572 2573 if (!pci_honor_msi_blacklist) 2574 return (0); 2575 2576 dev = pci_find_bsf(0, 0, 0); 2577 if (dev != NULL && pci_has_quirk(pci_get_devid(dev), 2578 PCI_QUIRK_DISABLE_MSIX)) 2579 return (1); 2580 2581 return (pci_msi_blacklisted()); 2582 } 2583 2584 /* 2585 * Attempt to allocate *count MSI messages. The actual number allocated is 2586 * returned in *count. After this function returns, each message will be 2587 * available to the driver as SYS_RES_IRQ resources starting at a rid 1. 2588 */ 2589 int 2590 pci_alloc_msi_method(device_t dev, device_t child, int *count) 2591 { 2592 struct pci_devinfo *dinfo = device_get_ivars(child); 2593 pcicfgregs *cfg = &dinfo->cfg; 2594 struct resource_list_entry *rle; 2595 int actual, error, i, irqs[32]; 2596 uint16_t ctrl; 2597 2598 /* Don't let count == 0 get us into trouble. */ 2599 if (*count == 0) 2600 return (EINVAL); 2601 2602 /* If rid 0 is allocated, then fail. */ 2603 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, 0); 2604 if (rle != NULL && rle->res != NULL) 2605 return (ENXIO); 2606 2607 /* Already have allocated messages? */ 2608 if (cfg->msi.msi_alloc != 0 || cfg->msix.msix_alloc != 0) 2609 return (ENXIO); 2610 2611 /* If MSI is blacklisted for this system, fail. */ 2612 if (pci_msi_blacklisted()) 2613 return (ENXIO); 2614 2615 /* MSI capability present? */ 2616 if (cfg->msi.msi_location == 0 || !pci_do_msi) 2617 return (ENODEV); 2618 2619 if (bootverbose) 2620 device_printf(child, 2621 "attempting to allocate %d MSI vectors (%d supported)\n", 2622 *count, cfg->msi.msi_msgnum); 2623 2624 /* Don't ask for more than the device supports. */ 2625 actual = min(*count, cfg->msi.msi_msgnum); 2626 2627 /* Don't ask for more than 32 messages. */ 2628 actual = min(actual, 32); 2629 2630 /* MSI requires power of 2 number of messages. */ 2631 if (!powerof2(actual)) 2632 return (EINVAL); 2633 2634 for (;;) { 2635 /* Try to allocate N messages. */ 2636 error = PCIB_ALLOC_MSI(device_get_parent(dev), child, actual, 2637 actual, irqs); 2638 if (error == 0) 2639 break; 2640 if (actual == 1) 2641 return (error); 2642 2643 /* Try N / 2. */ 2644 actual >>= 1; 2645 } 2646 2647 /* 2648 * We now have N actual messages mapped onto SYS_RES_IRQ 2649 * resources in the irqs[] array, so add new resources 2650 * starting at rid 1. 2651 */ 2652 for (i = 0; i < actual; i++) 2653 resource_list_add(&dinfo->resources, SYS_RES_IRQ, i + 1, 2654 irqs[i], irqs[i], 1); 2655 2656 if (bootverbose) { 2657 if (actual == 1) 2658 device_printf(child, "using IRQ %d for MSI\n", irqs[0]); 2659 else { 2660 int run; 2661 2662 /* 2663 * Be fancy and try to print contiguous runs 2664 * of IRQ values as ranges. 'run' is true if 2665 * we are in a range. 2666 */ 2667 device_printf(child, "using IRQs %d", irqs[0]); 2668 run = 0; 2669 for (i = 1; i < actual; i++) { 2670 /* Still in a run? */ 2671 if (irqs[i] == irqs[i - 1] + 1) { 2672 run = 1; 2673 continue; 2674 } 2675 2676 /* Finish previous range. */ 2677 if (run) { 2678 printf("-%d", irqs[i - 1]); 2679 run = 0; 2680 } 2681 2682 /* Start new range. */ 2683 printf(",%d", irqs[i]); 2684 } 2685 2686 /* Unfinished range? */ 2687 if (run) 2688 printf("-%d", irqs[actual - 1]); 2689 printf(" for MSI\n"); 2690 } 2691 } 2692 2693 /* Update control register with actual count. */ 2694 ctrl = cfg->msi.msi_ctrl; 2695 ctrl &= ~PCIM_MSICTRL_MME_MASK; 2696 ctrl |= (ffs(actual) - 1) << 4; 2697 cfg->msi.msi_ctrl = ctrl; 2698 pci_write_config(child, cfg->msi.msi_location + PCIR_MSI_CTRL, ctrl, 2); 2699 2700 /* Update counts of alloc'd messages. */ 2701 cfg->msi.msi_alloc = actual; 2702 cfg->msi.msi_handlers = 0; 2703 *count = actual; 2704 return (0); 2705 } 2706 2707 /* Release the MSI messages associated with this device. */ 2708 int 2709 pci_release_msi_method(device_t dev, device_t child) 2710 { 2711 struct pci_devinfo *dinfo = device_get_ivars(child); 2712 struct pcicfg_msi *msi = &dinfo->cfg.msi; 2713 struct resource_list_entry *rle; 2714 int error, i, irqs[32]; 2715 2716 /* Try MSI-X first. */ 2717 error = pci_release_msix(dev, child); 2718 if (error != ENODEV) 2719 return (error); 2720 2721 /* Do we have any messages to release? */ 2722 if (msi->msi_alloc == 0) 2723 return (ENODEV); 2724 KASSERT(msi->msi_alloc <= 32, ("more than 32 alloc'd messages")); 2725 2726 /* Make sure none of the resources are allocated. */ 2727 if (msi->msi_handlers > 0) 2728 return (EBUSY); 2729 for (i = 0; i < msi->msi_alloc; i++) { 2730 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, i + 1); 2731 KASSERT(rle != NULL, ("missing MSI resource")); 2732 if (rle->res != NULL) 2733 return (EBUSY); 2734 irqs[i] = rle->start; 2735 } 2736 2737 /* Update control register with 0 count. */ 2738 KASSERT(!(msi->msi_ctrl & PCIM_MSICTRL_MSI_ENABLE), 2739 ("%s: MSI still enabled", __func__)); 2740 msi->msi_ctrl &= ~PCIM_MSICTRL_MME_MASK; 2741 pci_write_config(child, msi->msi_location + PCIR_MSI_CTRL, 2742 msi->msi_ctrl, 2); 2743 2744 /* Release the messages. */ 2745 PCIB_RELEASE_MSI(device_get_parent(dev), child, msi->msi_alloc, irqs); 2746 for (i = 0; i < msi->msi_alloc; i++) 2747 resource_list_delete(&dinfo->resources, SYS_RES_IRQ, i + 1); 2748 2749 /* Update alloc count. */ 2750 msi->msi_alloc = 0; 2751 msi->msi_addr = 0; 2752 msi->msi_data = 0; 2753 return (0); 2754 } 2755 2756 /* 2757 * Return the max supported MSI messages this device supports. 2758 * Basically, assuming the MD code can alloc messages, this function 2759 * should return the maximum value that pci_alloc_msi() can return. 2760 * Thus, it is subject to the tunables, etc. 2761 */ 2762 int 2763 pci_msi_count_method(device_t dev, device_t child) 2764 { 2765 struct pci_devinfo *dinfo = device_get_ivars(child); 2766 struct pcicfg_msi *msi = &dinfo->cfg.msi; 2767 2768 if (pci_do_msi && msi->msi_location != 0) 2769 return (msi->msi_msgnum); 2770 return (0); 2771 } 2772 2773 /* free pcicfgregs structure and all depending data structures */ 2774 2775 int 2776 pci_freecfg(struct pci_devinfo *dinfo) 2777 { 2778 struct devlist *devlist_head; 2779 struct pci_map *pm, *next; 2780 int i; 2781 2782 devlist_head = &pci_devq; 2783 2784 if (dinfo->cfg.vpd.vpd_reg) { 2785 free(dinfo->cfg.vpd.vpd_ident, M_DEVBUF); 2786 for (i = 0; i < dinfo->cfg.vpd.vpd_rocnt; i++) 2787 free(dinfo->cfg.vpd.vpd_ros[i].value, M_DEVBUF); 2788 free(dinfo->cfg.vpd.vpd_ros, M_DEVBUF); 2789 for (i = 0; i < dinfo->cfg.vpd.vpd_wcnt; i++) 2790 free(dinfo->cfg.vpd.vpd_w[i].value, M_DEVBUF); 2791 free(dinfo->cfg.vpd.vpd_w, M_DEVBUF); 2792 } 2793 STAILQ_FOREACH_SAFE(pm, &dinfo->cfg.maps, pm_link, next) { 2794 free(pm, M_DEVBUF); 2795 } 2796 STAILQ_REMOVE(devlist_head, dinfo, pci_devinfo, pci_links); 2797 free(dinfo, M_DEVBUF); 2798 2799 /* increment the generation count */ 2800 pci_generation++; 2801 2802 /* we're losing one device */ 2803 pci_numdevs--; 2804 return (0); 2805 } 2806 2807 /* 2808 * PCI power manangement 2809 */ 2810 int 2811 pci_set_powerstate_method(device_t dev, device_t child, int state) 2812 { 2813 struct pci_devinfo *dinfo = device_get_ivars(child); 2814 pcicfgregs *cfg = &dinfo->cfg; 2815 uint16_t status; 2816 int oldstate, highest, delay; 2817 2818 if (cfg->pp.pp_cap == 0) 2819 return (EOPNOTSUPP); 2820 2821 /* 2822 * Optimize a no state change request away. While it would be OK to 2823 * write to the hardware in theory, some devices have shown odd 2824 * behavior when going from D3 -> D3. 2825 */ 2826 oldstate = pci_get_powerstate(child); 2827 if (oldstate == state) 2828 return (0); 2829 2830 /* 2831 * The PCI power management specification states that after a state 2832 * transition between PCI power states, system software must 2833 * guarantee a minimal delay before the function accesses the device. 2834 * Compute the worst case delay that we need to guarantee before we 2835 * access the device. Many devices will be responsive much more 2836 * quickly than this delay, but there are some that don't respond 2837 * instantly to state changes. Transitions to/from D3 state require 2838 * 10ms, while D2 requires 200us, and D0/1 require none. The delay 2839 * is done below with DELAY rather than a sleeper function because 2840 * this function can be called from contexts where we cannot sleep. 2841 */ 2842 highest = (oldstate > state) ? oldstate : state; 2843 if (highest == PCI_POWERSTATE_D3) 2844 delay = 10000; 2845 else if (highest == PCI_POWERSTATE_D2) 2846 delay = 200; 2847 else 2848 delay = 0; 2849 status = PCI_READ_CONFIG(dev, child, cfg->pp.pp_status, 2) 2850 & ~PCIM_PSTAT_DMASK; 2851 switch (state) { 2852 case PCI_POWERSTATE_D0: 2853 status |= PCIM_PSTAT_D0; 2854 break; 2855 case PCI_POWERSTATE_D1: 2856 if ((cfg->pp.pp_cap & PCIM_PCAP_D1SUPP) == 0) 2857 return (EOPNOTSUPP); 2858 status |= PCIM_PSTAT_D1; 2859 break; 2860 case PCI_POWERSTATE_D2: 2861 if ((cfg->pp.pp_cap & PCIM_PCAP_D2SUPP) == 0) 2862 return (EOPNOTSUPP); 2863 status |= PCIM_PSTAT_D2; 2864 break; 2865 case PCI_POWERSTATE_D3: 2866 status |= PCIM_PSTAT_D3; 2867 break; 2868 default: 2869 return (EINVAL); 2870 } 2871 2872 if (bootverbose) 2873 pci_printf(cfg, "Transition from D%d to D%d\n", oldstate, 2874 state); 2875 2876 PCI_WRITE_CONFIG(dev, child, cfg->pp.pp_status, status, 2); 2877 if (delay) 2878 DELAY(delay); 2879 return (0); 2880 } 2881 2882 int 2883 pci_get_powerstate_method(device_t dev, device_t child) 2884 { 2885 struct pci_devinfo *dinfo = device_get_ivars(child); 2886 pcicfgregs *cfg = &dinfo->cfg; 2887 uint16_t status; 2888 int result; 2889 2890 if (cfg->pp.pp_cap != 0) { 2891 status = PCI_READ_CONFIG(dev, child, cfg->pp.pp_status, 2); 2892 switch (status & PCIM_PSTAT_DMASK) { 2893 case PCIM_PSTAT_D0: 2894 result = PCI_POWERSTATE_D0; 2895 break; 2896 case PCIM_PSTAT_D1: 2897 result = PCI_POWERSTATE_D1; 2898 break; 2899 case PCIM_PSTAT_D2: 2900 result = PCI_POWERSTATE_D2; 2901 break; 2902 case PCIM_PSTAT_D3: 2903 result = PCI_POWERSTATE_D3; 2904 break; 2905 default: 2906 result = PCI_POWERSTATE_UNKNOWN; 2907 break; 2908 } 2909 } else { 2910 /* No support, device is always at D0 */ 2911 result = PCI_POWERSTATE_D0; 2912 } 2913 return (result); 2914 } 2915 2916 /* 2917 * Some convenience functions for PCI device drivers. 2918 */ 2919 2920 static __inline void 2921 pci_set_command_bit(device_t dev, device_t child, uint16_t bit) 2922 { 2923 uint16_t command; 2924 2925 command = PCI_READ_CONFIG(dev, child, PCIR_COMMAND, 2); 2926 command |= bit; 2927 PCI_WRITE_CONFIG(dev, child, PCIR_COMMAND, command, 2); 2928 } 2929 2930 static __inline void 2931 pci_clear_command_bit(device_t dev, device_t child, uint16_t bit) 2932 { 2933 uint16_t command; 2934 2935 command = PCI_READ_CONFIG(dev, child, PCIR_COMMAND, 2); 2936 command &= ~bit; 2937 PCI_WRITE_CONFIG(dev, child, PCIR_COMMAND, command, 2); 2938 } 2939 2940 int 2941 pci_enable_busmaster_method(device_t dev, device_t child) 2942 { 2943 pci_set_command_bit(dev, child, PCIM_CMD_BUSMASTEREN); 2944 return (0); 2945 } 2946 2947 int 2948 pci_disable_busmaster_method(device_t dev, device_t child) 2949 { 2950 pci_clear_command_bit(dev, child, PCIM_CMD_BUSMASTEREN); 2951 return (0); 2952 } 2953 2954 int 2955 pci_enable_io_method(device_t dev, device_t child, int space) 2956 { 2957 uint16_t bit; 2958 2959 switch(space) { 2960 case SYS_RES_IOPORT: 2961 bit = PCIM_CMD_PORTEN; 2962 break; 2963 case SYS_RES_MEMORY: 2964 bit = PCIM_CMD_MEMEN; 2965 break; 2966 default: 2967 return (EINVAL); 2968 } 2969 pci_set_command_bit(dev, child, bit); 2970 return (0); 2971 } 2972 2973 int 2974 pci_disable_io_method(device_t dev, device_t child, int space) 2975 { 2976 uint16_t bit; 2977 2978 switch(space) { 2979 case SYS_RES_IOPORT: 2980 bit = PCIM_CMD_PORTEN; 2981 break; 2982 case SYS_RES_MEMORY: 2983 bit = PCIM_CMD_MEMEN; 2984 break; 2985 default: 2986 return (EINVAL); 2987 } 2988 pci_clear_command_bit(dev, child, bit); 2989 return (0); 2990 } 2991 2992 /* 2993 * New style pci driver. Parent device is either a pci-host-bridge or a 2994 * pci-pci-bridge. Both kinds are represented by instances of pcib. 2995 */ 2996 2997 void 2998 pci_print_verbose(struct pci_devinfo *dinfo) 2999 { 3000 3001 if (bootverbose) { 3002 pcicfgregs *cfg = &dinfo->cfg; 3003 3004 printf("found->\tvendor=0x%04x, dev=0x%04x, revid=0x%02x\n", 3005 cfg->vendor, cfg->device, cfg->revid); 3006 printf("\tdomain=%d, bus=%d, slot=%d, func=%d\n", 3007 cfg->domain, cfg->bus, cfg->slot, cfg->func); 3008 printf("\tclass=%02x-%02x-%02x, hdrtype=0x%02x, mfdev=%d\n", 3009 cfg->baseclass, cfg->subclass, cfg->progif, cfg->hdrtype, 3010 cfg->mfdev); 3011 printf("\tcmdreg=0x%04x, statreg=0x%04x, cachelnsz=%d (dwords)\n", 3012 cfg->cmdreg, cfg->statreg, cfg->cachelnsz); 3013 printf("\tlattimer=0x%02x (%d ns), mingnt=0x%02x (%d ns), maxlat=0x%02x (%d ns)\n", 3014 cfg->lattimer, cfg->lattimer * 30, cfg->mingnt, 3015 cfg->mingnt * 250, cfg->maxlat, cfg->maxlat * 250); 3016 if (cfg->intpin > 0) 3017 printf("\tintpin=%c, irq=%d\n", 3018 cfg->intpin +'a' -1, cfg->intline); 3019 if (cfg->pp.pp_cap) { 3020 uint16_t status; 3021 3022 status = pci_read_config(cfg->dev, cfg->pp.pp_status, 2); 3023 printf("\tpowerspec %d supports D0%s%s D3 current D%d\n", 3024 cfg->pp.pp_cap & PCIM_PCAP_SPEC, 3025 cfg->pp.pp_cap & PCIM_PCAP_D1SUPP ? " D1" : "", 3026 cfg->pp.pp_cap & PCIM_PCAP_D2SUPP ? " D2" : "", 3027 status & PCIM_PSTAT_DMASK); 3028 } 3029 if (cfg->msi.msi_location) { 3030 int ctrl; 3031 3032 ctrl = cfg->msi.msi_ctrl; 3033 printf("\tMSI supports %d message%s%s%s\n", 3034 cfg->msi.msi_msgnum, 3035 (cfg->msi.msi_msgnum == 1) ? "" : "s", 3036 (ctrl & PCIM_MSICTRL_64BIT) ? ", 64 bit" : "", 3037 (ctrl & PCIM_MSICTRL_VECTOR) ? ", vector masks":""); 3038 } 3039 if (cfg->msix.msix_location) { 3040 printf("\tMSI-X supports %d message%s ", 3041 cfg->msix.msix_msgnum, 3042 (cfg->msix.msix_msgnum == 1) ? "" : "s"); 3043 if (cfg->msix.msix_table_bar == cfg->msix.msix_pba_bar) 3044 printf("in map 0x%x\n", 3045 cfg->msix.msix_table_bar); 3046 else 3047 printf("in maps 0x%x and 0x%x\n", 3048 cfg->msix.msix_table_bar, 3049 cfg->msix.msix_pba_bar); 3050 } 3051 } 3052 } 3053 3054 static int 3055 pci_porten(device_t dev) 3056 { 3057 return (pci_read_config(dev, PCIR_COMMAND, 2) & PCIM_CMD_PORTEN) != 0; 3058 } 3059 3060 static int 3061 pci_memen(device_t dev) 3062 { 3063 return (pci_read_config(dev, PCIR_COMMAND, 2) & PCIM_CMD_MEMEN) != 0; 3064 } 3065 3066 void 3067 pci_read_bar(device_t dev, int reg, pci_addr_t *mapp, pci_addr_t *testvalp, 3068 int *bar64) 3069 { 3070 struct pci_devinfo *dinfo; 3071 pci_addr_t map, testval; 3072 int ln2range; 3073 uint16_t cmd; 3074 3075 /* 3076 * The device ROM BAR is special. It is always a 32-bit 3077 * memory BAR. Bit 0 is special and should not be set when 3078 * sizing the BAR. 3079 */ 3080 dinfo = device_get_ivars(dev); 3081 if (PCIR_IS_BIOS(&dinfo->cfg, reg)) { 3082 map = pci_read_config(dev, reg, 4); 3083 pci_write_config(dev, reg, 0xfffffffe, 4); 3084 testval = pci_read_config(dev, reg, 4); 3085 pci_write_config(dev, reg, map, 4); 3086 *mapp = map; 3087 *testvalp = testval; 3088 if (bar64 != NULL) 3089 *bar64 = 0; 3090 return; 3091 } 3092 3093 map = pci_read_config(dev, reg, 4); 3094 ln2range = pci_maprange(map); 3095 if (ln2range == 64) 3096 map |= (pci_addr_t)pci_read_config(dev, reg + 4, 4) << 32; 3097 3098 /* 3099 * Disable decoding via the command register before 3100 * determining the BAR's length since we will be placing it in 3101 * a weird state. 3102 */ 3103 cmd = pci_read_config(dev, PCIR_COMMAND, 2); 3104 pci_write_config(dev, PCIR_COMMAND, 3105 cmd & ~(PCI_BAR_MEM(map) ? PCIM_CMD_MEMEN : PCIM_CMD_PORTEN), 2); 3106 3107 /* 3108 * Determine the BAR's length by writing all 1's. The bottom 3109 * log_2(size) bits of the BAR will stick as 0 when we read 3110 * the value back. 3111 * 3112 * NB: according to the PCI Local Bus Specification, rev. 3.0: 3113 * "Software writes 0FFFFFFFFh to both registers, reads them back, 3114 * and combines the result into a 64-bit value." (section 6.2.5.1) 3115 * 3116 * Writes to both registers must be performed before attempting to 3117 * read back the size value. 3118 */ 3119 testval = 0; 3120 pci_write_config(dev, reg, 0xffffffff, 4); 3121 if (ln2range == 64) { 3122 pci_write_config(dev, reg + 4, 0xffffffff, 4); 3123 testval |= (pci_addr_t)pci_read_config(dev, reg + 4, 4) << 32; 3124 } 3125 testval |= pci_read_config(dev, reg, 4); 3126 3127 /* 3128 * Restore the original value of the BAR. We may have reprogrammed 3129 * the BAR of the low-level console device and when booting verbose, 3130 * we need the console device addressable. 3131 */ 3132 pci_write_config(dev, reg, map, 4); 3133 if (ln2range == 64) 3134 pci_write_config(dev, reg + 4, map >> 32, 4); 3135 pci_write_config(dev, PCIR_COMMAND, cmd, 2); 3136 3137 *mapp = map; 3138 *testvalp = testval; 3139 if (bar64 != NULL) 3140 *bar64 = (ln2range == 64); 3141 } 3142 3143 static void 3144 pci_write_bar(device_t dev, struct pci_map *pm, pci_addr_t base) 3145 { 3146 struct pci_devinfo *dinfo; 3147 int ln2range; 3148 3149 /* The device ROM BAR is always a 32-bit memory BAR. */ 3150 dinfo = device_get_ivars(dev); 3151 if (PCIR_IS_BIOS(&dinfo->cfg, pm->pm_reg)) 3152 ln2range = 32; 3153 else 3154 ln2range = pci_maprange(pm->pm_value); 3155 pci_write_config(dev, pm->pm_reg, base, 4); 3156 if (ln2range == 64) 3157 pci_write_config(dev, pm->pm_reg + 4, base >> 32, 4); 3158 pm->pm_value = pci_read_config(dev, pm->pm_reg, 4); 3159 if (ln2range == 64) 3160 pm->pm_value |= (pci_addr_t)pci_read_config(dev, 3161 pm->pm_reg + 4, 4) << 32; 3162 } 3163 3164 struct pci_map * 3165 pci_find_bar(device_t dev, int reg) 3166 { 3167 struct pci_devinfo *dinfo; 3168 struct pci_map *pm; 3169 3170 dinfo = device_get_ivars(dev); 3171 STAILQ_FOREACH(pm, &dinfo->cfg.maps, pm_link) { 3172 if (pm->pm_reg == reg) 3173 return (pm); 3174 } 3175 return (NULL); 3176 } 3177 3178 struct pci_map * 3179 pci_first_bar(device_t dev) 3180 { 3181 struct pci_devinfo *dinfo; 3182 3183 dinfo = device_get_ivars(dev); 3184 return (STAILQ_FIRST(&dinfo->cfg.maps)); 3185 } 3186 3187 struct pci_map * 3188 pci_next_bar(struct pci_map *pm) 3189 { 3190 return (STAILQ_NEXT(pm, pm_link)); 3191 } 3192 3193 int 3194 pci_bar_enabled(device_t dev, struct pci_map *pm) 3195 { 3196 struct pci_devinfo *dinfo; 3197 uint16_t cmd; 3198 3199 dinfo = device_get_ivars(dev); 3200 if (PCIR_IS_BIOS(&dinfo->cfg, pm->pm_reg) && 3201 !(pm->pm_value & PCIM_BIOS_ENABLE)) 3202 return (0); 3203 #ifdef PCI_IOV 3204 if ((dinfo->cfg.flags & PCICFG_VF) != 0) { 3205 struct pcicfg_iov *iov; 3206 3207 iov = dinfo->cfg.iov; 3208 cmd = pci_read_config(iov->iov_pf, 3209 iov->iov_pos + PCIR_SRIOV_CTL, 2); 3210 return ((cmd & PCIM_SRIOV_VF_MSE) != 0); 3211 } 3212 #endif 3213 cmd = pci_read_config(dev, PCIR_COMMAND, 2); 3214 if (PCIR_IS_BIOS(&dinfo->cfg, pm->pm_reg) || PCI_BAR_MEM(pm->pm_value)) 3215 return ((cmd & PCIM_CMD_MEMEN) != 0); 3216 else 3217 return ((cmd & PCIM_CMD_PORTEN) != 0); 3218 } 3219 3220 struct pci_map * 3221 pci_add_bar(device_t dev, int reg, pci_addr_t value, pci_addr_t size) 3222 { 3223 struct pci_devinfo *dinfo; 3224 struct pci_map *pm, *prev; 3225 3226 dinfo = device_get_ivars(dev); 3227 pm = malloc(sizeof(*pm), M_DEVBUF, M_WAITOK | M_ZERO); 3228 pm->pm_reg = reg; 3229 pm->pm_value = value; 3230 pm->pm_size = size; 3231 STAILQ_FOREACH(prev, &dinfo->cfg.maps, pm_link) { 3232 KASSERT(prev->pm_reg != pm->pm_reg, ("duplicate map %02x", 3233 reg)); 3234 if (STAILQ_NEXT(prev, pm_link) == NULL || 3235 STAILQ_NEXT(prev, pm_link)->pm_reg > pm->pm_reg) 3236 break; 3237 } 3238 if (prev != NULL) 3239 STAILQ_INSERT_AFTER(&dinfo->cfg.maps, prev, pm, pm_link); 3240 else 3241 STAILQ_INSERT_TAIL(&dinfo->cfg.maps, pm, pm_link); 3242 return (pm); 3243 } 3244 3245 static void 3246 pci_restore_bars(device_t dev) 3247 { 3248 struct pci_devinfo *dinfo; 3249 struct pci_map *pm; 3250 int ln2range; 3251 3252 dinfo = device_get_ivars(dev); 3253 STAILQ_FOREACH(pm, &dinfo->cfg.maps, pm_link) { 3254 if (PCIR_IS_BIOS(&dinfo->cfg, pm->pm_reg)) 3255 ln2range = 32; 3256 else 3257 ln2range = pci_maprange(pm->pm_value); 3258 pci_write_config(dev, pm->pm_reg, pm->pm_value, 4); 3259 if (ln2range == 64) 3260 pci_write_config(dev, pm->pm_reg + 4, 3261 pm->pm_value >> 32, 4); 3262 } 3263 } 3264 3265 /* 3266 * Add a resource based on a pci map register. Return 1 if the map 3267 * register is a 32bit map register or 2 if it is a 64bit register. 3268 */ 3269 static int 3270 pci_add_map(device_t bus, device_t dev, int reg, struct resource_list *rl, 3271 int force, int prefetch) 3272 { 3273 struct pci_map *pm; 3274 pci_addr_t base, map, testval; 3275 pci_addr_t start, end, count; 3276 int barlen, basezero, flags, maprange, mapsize, type; 3277 uint16_t cmd; 3278 struct resource *res; 3279 3280 /* 3281 * The BAR may already exist if the device is a CardBus card 3282 * whose CIS is stored in this BAR. 3283 */ 3284 pm = pci_find_bar(dev, reg); 3285 if (pm != NULL) { 3286 maprange = pci_maprange(pm->pm_value); 3287 barlen = maprange == 64 ? 2 : 1; 3288 return (barlen); 3289 } 3290 3291 pci_read_bar(dev, reg, &map, &testval, NULL); 3292 if (PCI_BAR_MEM(map)) { 3293 type = SYS_RES_MEMORY; 3294 if (map & PCIM_BAR_MEM_PREFETCH) 3295 prefetch = 1; 3296 } else 3297 type = SYS_RES_IOPORT; 3298 mapsize = pci_mapsize(testval); 3299 base = pci_mapbase(map); 3300 #ifdef __PCI_BAR_ZERO_VALID 3301 basezero = 0; 3302 #else 3303 basezero = base == 0; 3304 #endif 3305 maprange = pci_maprange(map); 3306 barlen = maprange == 64 ? 2 : 1; 3307 3308 /* 3309 * For I/O registers, if bottom bit is set, and the next bit up 3310 * isn't clear, we know we have a BAR that doesn't conform to the 3311 * spec, so ignore it. Also, sanity check the size of the data 3312 * areas to the type of memory involved. Memory must be at least 3313 * 16 bytes in size, while I/O ranges must be at least 4. 3314 */ 3315 if (PCI_BAR_IO(testval) && (testval & PCIM_BAR_IO_RESERVED) != 0) 3316 return (barlen); 3317 if ((type == SYS_RES_MEMORY && mapsize < 4) || 3318 (type == SYS_RES_IOPORT && mapsize < 2)) 3319 return (barlen); 3320 3321 /* Save a record of this BAR. */ 3322 pm = pci_add_bar(dev, reg, map, mapsize); 3323 if (bootverbose) { 3324 printf("\tmap[%02x]: type %s, range %2d, base %#jx, size %2d", 3325 reg, pci_maptype(map), maprange, (uintmax_t)base, mapsize); 3326 if (type == SYS_RES_IOPORT && !pci_porten(dev)) 3327 printf(", port disabled\n"); 3328 else if (type == SYS_RES_MEMORY && !pci_memen(dev)) 3329 printf(", memory disabled\n"); 3330 else 3331 printf(", enabled\n"); 3332 } 3333 3334 /* 3335 * If base is 0, then we have problems if this architecture does 3336 * not allow that. It is best to ignore such entries for the 3337 * moment. These will be allocated later if the driver specifically 3338 * requests them. However, some removable buses look better when 3339 * all resources are allocated, so allow '0' to be overridden. 3340 * 3341 * Similarly treat maps whose values is the same as the test value 3342 * read back. These maps have had all f's written to them by the 3343 * BIOS in an attempt to disable the resources. 3344 */ 3345 if (!force && (basezero || map == testval)) 3346 return (barlen); 3347 if ((u_long)base != base) { 3348 device_printf(bus, 3349 "pci%d:%d:%d:%d bar %#x too many address bits", 3350 pci_get_domain(dev), pci_get_bus(dev), pci_get_slot(dev), 3351 pci_get_function(dev), reg); 3352 return (barlen); 3353 } 3354 3355 /* 3356 * This code theoretically does the right thing, but has 3357 * undesirable side effects in some cases where peripherals 3358 * respond oddly to having these bits enabled. Let the user 3359 * be able to turn them off (since pci_enable_io_modes is 1 by 3360 * default). 3361 */ 3362 if (pci_enable_io_modes) { 3363 /* Turn on resources that have been left off by a lazy BIOS */ 3364 if (type == SYS_RES_IOPORT && !pci_porten(dev)) { 3365 cmd = pci_read_config(dev, PCIR_COMMAND, 2); 3366 cmd |= PCIM_CMD_PORTEN; 3367 pci_write_config(dev, PCIR_COMMAND, cmd, 2); 3368 } 3369 if (type == SYS_RES_MEMORY && !pci_memen(dev)) { 3370 cmd = pci_read_config(dev, PCIR_COMMAND, 2); 3371 cmd |= PCIM_CMD_MEMEN; 3372 pci_write_config(dev, PCIR_COMMAND, cmd, 2); 3373 } 3374 } else { 3375 if (type == SYS_RES_IOPORT && !pci_porten(dev)) 3376 return (barlen); 3377 if (type == SYS_RES_MEMORY && !pci_memen(dev)) 3378 return (barlen); 3379 } 3380 3381 count = (pci_addr_t)1 << mapsize; 3382 flags = RF_ALIGNMENT_LOG2(mapsize); 3383 if (prefetch) 3384 flags |= RF_PREFETCHABLE; 3385 if (basezero || base == pci_mapbase(testval) || pci_clear_bars) { 3386 start = 0; /* Let the parent decide. */ 3387 end = ~0; 3388 } else { 3389 start = base; 3390 end = base + count - 1; 3391 } 3392 resource_list_add(rl, type, reg, start, end, count); 3393 3394 /* 3395 * Try to allocate the resource for this BAR from our parent 3396 * so that this resource range is already reserved. The 3397 * driver for this device will later inherit this resource in 3398 * pci_alloc_resource(). 3399 */ 3400 res = resource_list_reserve(rl, bus, dev, type, ®, start, end, count, 3401 flags); 3402 if ((pci_do_realloc_bars 3403 || pci_has_quirk(pci_get_devid(dev), PCI_QUIRK_REALLOC_BAR)) 3404 && res == NULL && (start != 0 || end != ~0)) { 3405 /* 3406 * If the allocation fails, try to allocate a resource for 3407 * this BAR using any available range. The firmware felt 3408 * it was important enough to assign a resource, so don't 3409 * disable decoding if we can help it. 3410 */ 3411 resource_list_delete(rl, type, reg); 3412 resource_list_add(rl, type, reg, 0, ~0, count); 3413 res = resource_list_reserve(rl, bus, dev, type, ®, 0, ~0, 3414 count, flags); 3415 } 3416 if (res == NULL) { 3417 /* 3418 * If the allocation fails, delete the resource list entry 3419 * and disable decoding for this device. 3420 * 3421 * If the driver requests this resource in the future, 3422 * pci_reserve_map() will try to allocate a fresh 3423 * resource range. 3424 */ 3425 resource_list_delete(rl, type, reg); 3426 pci_disable_io(dev, type); 3427 if (bootverbose) 3428 device_printf(bus, 3429 "pci%d:%d:%d:%d bar %#x failed to allocate\n", 3430 pci_get_domain(dev), pci_get_bus(dev), 3431 pci_get_slot(dev), pci_get_function(dev), reg); 3432 } else { 3433 start = rman_get_start(res); 3434 pci_write_bar(dev, pm, start); 3435 } 3436 return (barlen); 3437 } 3438 3439 /* 3440 * For ATA devices we need to decide early what addressing mode to use. 3441 * Legacy demands that the primary and secondary ATA ports sits on the 3442 * same addresses that old ISA hardware did. This dictates that we use 3443 * those addresses and ignore the BAR's if we cannot set PCI native 3444 * addressing mode. 3445 */ 3446 static void 3447 pci_ata_maps(device_t bus, device_t dev, struct resource_list *rl, int force, 3448 uint32_t prefetchmask) 3449 { 3450 int rid, type, progif; 3451 #if 0 3452 /* if this device supports PCI native addressing use it */ 3453 progif = pci_read_config(dev, PCIR_PROGIF, 1); 3454 if ((progif & 0x8a) == 0x8a) { 3455 if (pci_mapbase(pci_read_config(dev, PCIR_BAR(0), 4)) && 3456 pci_mapbase(pci_read_config(dev, PCIR_BAR(2), 4))) { 3457 printf("Trying ATA native PCI addressing mode\n"); 3458 pci_write_config(dev, PCIR_PROGIF, progif | 0x05, 1); 3459 } 3460 } 3461 #endif 3462 progif = pci_read_config(dev, PCIR_PROGIF, 1); 3463 type = SYS_RES_IOPORT; 3464 if (progif & PCIP_STORAGE_IDE_MODEPRIM) { 3465 pci_add_map(bus, dev, PCIR_BAR(0), rl, force, 3466 prefetchmask & (1 << 0)); 3467 pci_add_map(bus, dev, PCIR_BAR(1), rl, force, 3468 prefetchmask & (1 << 1)); 3469 } else { 3470 rid = PCIR_BAR(0); 3471 resource_list_add(rl, type, rid, 0x1f0, 0x1f7, 8); 3472 (void)resource_list_reserve(rl, bus, dev, type, &rid, 0x1f0, 3473 0x1f7, 8, 0); 3474 rid = PCIR_BAR(1); 3475 resource_list_add(rl, type, rid, 0x3f6, 0x3f6, 1); 3476 (void)resource_list_reserve(rl, bus, dev, type, &rid, 0x3f6, 3477 0x3f6, 1, 0); 3478 } 3479 if (progif & PCIP_STORAGE_IDE_MODESEC) { 3480 pci_add_map(bus, dev, PCIR_BAR(2), rl, force, 3481 prefetchmask & (1 << 2)); 3482 pci_add_map(bus, dev, PCIR_BAR(3), rl, force, 3483 prefetchmask & (1 << 3)); 3484 } else { 3485 rid = PCIR_BAR(2); 3486 resource_list_add(rl, type, rid, 0x170, 0x177, 8); 3487 (void)resource_list_reserve(rl, bus, dev, type, &rid, 0x170, 3488 0x177, 8, 0); 3489 rid = PCIR_BAR(3); 3490 resource_list_add(rl, type, rid, 0x376, 0x376, 1); 3491 (void)resource_list_reserve(rl, bus, dev, type, &rid, 0x376, 3492 0x376, 1, 0); 3493 } 3494 pci_add_map(bus, dev, PCIR_BAR(4), rl, force, 3495 prefetchmask & (1 << 4)); 3496 pci_add_map(bus, dev, PCIR_BAR(5), rl, force, 3497 prefetchmask & (1 << 5)); 3498 } 3499 3500 static void 3501 pci_assign_interrupt(device_t bus, device_t dev, int force_route) 3502 { 3503 struct pci_devinfo *dinfo = device_get_ivars(dev); 3504 pcicfgregs *cfg = &dinfo->cfg; 3505 char tunable_name[64]; 3506 int irq; 3507 3508 /* Has to have an intpin to have an interrupt. */ 3509 if (cfg->intpin == 0) 3510 return; 3511 3512 /* Let the user override the IRQ with a tunable. */ 3513 irq = PCI_INVALID_IRQ; 3514 snprintf(tunable_name, sizeof(tunable_name), 3515 "hw.pci%d.%d.%d.INT%c.irq", 3516 cfg->domain, cfg->bus, cfg->slot, cfg->intpin + 'A' - 1); 3517 if (TUNABLE_INT_FETCH(tunable_name, &irq) && (irq >= 255 || irq <= 0)) 3518 irq = PCI_INVALID_IRQ; 3519 3520 /* 3521 * If we didn't get an IRQ via the tunable, then we either use the 3522 * IRQ value in the intline register or we ask the bus to route an 3523 * interrupt for us. If force_route is true, then we only use the 3524 * value in the intline register if the bus was unable to assign an 3525 * IRQ. 3526 */ 3527 if (!PCI_INTERRUPT_VALID(irq)) { 3528 if (!PCI_INTERRUPT_VALID(cfg->intline) || force_route) 3529 irq = PCI_ASSIGN_INTERRUPT(bus, dev); 3530 if (!PCI_INTERRUPT_VALID(irq)) 3531 irq = cfg->intline; 3532 } 3533 3534 /* If after all that we don't have an IRQ, just bail. */ 3535 if (!PCI_INTERRUPT_VALID(irq)) 3536 return; 3537 3538 /* Update the config register if it changed. */ 3539 if (irq != cfg->intline) { 3540 cfg->intline = irq; 3541 pci_write_config(dev, PCIR_INTLINE, irq, 1); 3542 } 3543 3544 /* Add this IRQ as rid 0 interrupt resource. */ 3545 resource_list_add(&dinfo->resources, SYS_RES_IRQ, 0, irq, irq, 1); 3546 } 3547 3548 /* Perform early OHCI takeover from SMM. */ 3549 static void 3550 ohci_early_takeover(device_t self) 3551 { 3552 struct resource *res; 3553 uint32_t ctl; 3554 int rid; 3555 int i; 3556 3557 rid = PCIR_BAR(0); 3558 res = bus_alloc_resource_any(self, SYS_RES_MEMORY, &rid, RF_ACTIVE); 3559 if (res == NULL) 3560 return; 3561 3562 ctl = bus_read_4(res, OHCI_CONTROL); 3563 if (ctl & OHCI_IR) { 3564 if (bootverbose) 3565 printf("ohci early: " 3566 "SMM active, request owner change\n"); 3567 bus_write_4(res, OHCI_COMMAND_STATUS, OHCI_OCR); 3568 for (i = 0; (i < 100) && (ctl & OHCI_IR); i++) { 3569 DELAY(1000); 3570 ctl = bus_read_4(res, OHCI_CONTROL); 3571 } 3572 if (ctl & OHCI_IR) { 3573 if (bootverbose) 3574 printf("ohci early: " 3575 "SMM does not respond, resetting\n"); 3576 bus_write_4(res, OHCI_CONTROL, OHCI_HCFS_RESET); 3577 } 3578 /* Disable interrupts */ 3579 bus_write_4(res, OHCI_INTERRUPT_DISABLE, OHCI_ALL_INTRS); 3580 } 3581 3582 bus_release_resource(self, SYS_RES_MEMORY, rid, res); 3583 } 3584 3585 /* Perform early UHCI takeover from SMM. */ 3586 static void 3587 uhci_early_takeover(device_t self) 3588 { 3589 struct resource *res; 3590 int rid; 3591 3592 /* 3593 * Set the PIRQD enable bit and switch off all the others. We don't 3594 * want legacy support to interfere with us XXX Does this also mean 3595 * that the BIOS won't touch the keyboard anymore if it is connected 3596 * to the ports of the root hub? 3597 */ 3598 pci_write_config(self, PCI_LEGSUP, PCI_LEGSUP_USBPIRQDEN, 2); 3599 3600 /* Disable interrupts */ 3601 rid = PCI_UHCI_BASE_REG; 3602 res = bus_alloc_resource_any(self, SYS_RES_IOPORT, &rid, RF_ACTIVE); 3603 if (res != NULL) { 3604 bus_write_2(res, UHCI_INTR, 0); 3605 bus_release_resource(self, SYS_RES_IOPORT, rid, res); 3606 } 3607 } 3608 3609 /* Perform early EHCI takeover from SMM. */ 3610 static void 3611 ehci_early_takeover(device_t self) 3612 { 3613 struct resource *res; 3614 uint32_t cparams; 3615 uint32_t eec; 3616 uint8_t eecp; 3617 uint8_t bios_sem; 3618 uint8_t offs; 3619 int rid; 3620 int i; 3621 3622 rid = PCIR_BAR(0); 3623 res = bus_alloc_resource_any(self, SYS_RES_MEMORY, &rid, RF_ACTIVE); 3624 if (res == NULL) 3625 return; 3626 3627 cparams = bus_read_4(res, EHCI_HCCPARAMS); 3628 3629 /* Synchronise with the BIOS if it owns the controller. */ 3630 for (eecp = EHCI_HCC_EECP(cparams); eecp != 0; 3631 eecp = EHCI_EECP_NEXT(eec)) { 3632 eec = pci_read_config(self, eecp, 4); 3633 if (EHCI_EECP_ID(eec) != EHCI_EC_LEGSUP) { 3634 continue; 3635 } 3636 bios_sem = pci_read_config(self, eecp + 3637 EHCI_LEGSUP_BIOS_SEM, 1); 3638 if (bios_sem == 0) { 3639 continue; 3640 } 3641 if (bootverbose) 3642 printf("ehci early: " 3643 "SMM active, request owner change\n"); 3644 3645 pci_write_config(self, eecp + EHCI_LEGSUP_OS_SEM, 1, 1); 3646 3647 for (i = 0; (i < 100) && (bios_sem != 0); i++) { 3648 DELAY(1000); 3649 bios_sem = pci_read_config(self, eecp + 3650 EHCI_LEGSUP_BIOS_SEM, 1); 3651 } 3652 3653 if (bios_sem != 0) { 3654 if (bootverbose) 3655 printf("ehci early: " 3656 "SMM does not respond\n"); 3657 } 3658 /* Disable interrupts */ 3659 offs = EHCI_CAPLENGTH(bus_read_4(res, EHCI_CAPLEN_HCIVERSION)); 3660 bus_write_4(res, offs + EHCI_USBINTR, 0); 3661 } 3662 bus_release_resource(self, SYS_RES_MEMORY, rid, res); 3663 } 3664 3665 /* Perform early XHCI takeover from SMM. */ 3666 static void 3667 xhci_early_takeover(device_t self) 3668 { 3669 struct resource *res; 3670 uint32_t cparams; 3671 uint32_t eec; 3672 uint8_t eecp; 3673 uint8_t bios_sem; 3674 uint8_t offs; 3675 int rid; 3676 int i; 3677 3678 rid = PCIR_BAR(0); 3679 res = bus_alloc_resource_any(self, SYS_RES_MEMORY, &rid, RF_ACTIVE); 3680 if (res == NULL) 3681 return; 3682 3683 cparams = bus_read_4(res, XHCI_HCSPARAMS0); 3684 3685 eec = -1; 3686 3687 /* Synchronise with the BIOS if it owns the controller. */ 3688 for (eecp = XHCI_HCS0_XECP(cparams) << 2; eecp != 0 && XHCI_XECP_NEXT(eec); 3689 eecp += XHCI_XECP_NEXT(eec) << 2) { 3690 eec = bus_read_4(res, eecp); 3691 3692 if (XHCI_XECP_ID(eec) != XHCI_ID_USB_LEGACY) 3693 continue; 3694 3695 bios_sem = bus_read_1(res, eecp + XHCI_XECP_BIOS_SEM); 3696 if (bios_sem == 0) 3697 continue; 3698 3699 if (bootverbose) 3700 printf("xhci early: " 3701 "SMM active, request owner change\n"); 3702 3703 bus_write_1(res, eecp + XHCI_XECP_OS_SEM, 1); 3704 3705 /* wait a maximum of 5 second */ 3706 3707 for (i = 0; (i < 5000) && (bios_sem != 0); i++) { 3708 DELAY(1000); 3709 bios_sem = bus_read_1(res, eecp + 3710 XHCI_XECP_BIOS_SEM); 3711 } 3712 3713 if (bios_sem != 0) { 3714 if (bootverbose) 3715 printf("xhci early: " 3716 "SMM does not respond\n"); 3717 } 3718 3719 /* Disable interrupts */ 3720 offs = bus_read_1(res, XHCI_CAPLENGTH); 3721 bus_write_4(res, offs + XHCI_USBCMD, 0); 3722 bus_read_4(res, offs + XHCI_USBSTS); 3723 } 3724 bus_release_resource(self, SYS_RES_MEMORY, rid, res); 3725 } 3726 3727 #if defined(NEW_PCIB) && defined(PCI_RES_BUS) 3728 static void 3729 pci_reserve_secbus(device_t bus, device_t dev, pcicfgregs *cfg, 3730 struct resource_list *rl) 3731 { 3732 struct resource *res; 3733 char *cp; 3734 rman_res_t start, end, count; 3735 int rid, sec_bus, sec_reg, sub_bus, sub_reg, sup_bus; 3736 3737 switch (cfg->hdrtype & PCIM_HDRTYPE) { 3738 case PCIM_HDRTYPE_BRIDGE: 3739 sec_reg = PCIR_SECBUS_1; 3740 sub_reg = PCIR_SUBBUS_1; 3741 break; 3742 case PCIM_HDRTYPE_CARDBUS: 3743 sec_reg = PCIR_SECBUS_2; 3744 sub_reg = PCIR_SUBBUS_2; 3745 break; 3746 default: 3747 return; 3748 } 3749 3750 /* 3751 * If the existing bus range is valid, attempt to reserve it 3752 * from our parent. If this fails for any reason, clear the 3753 * secbus and subbus registers. 3754 * 3755 * XXX: Should we reset sub_bus to sec_bus if it is < sec_bus? 3756 * This would at least preserve the existing sec_bus if it is 3757 * valid. 3758 */ 3759 sec_bus = PCI_READ_CONFIG(bus, dev, sec_reg, 1); 3760 sub_bus = PCI_READ_CONFIG(bus, dev, sub_reg, 1); 3761 3762 /* Quirk handling. */ 3763 switch (pci_get_devid(dev)) { 3764 case 0x12258086: /* Intel 82454KX/GX (Orion) */ 3765 sup_bus = pci_read_config(dev, 0x41, 1); 3766 if (sup_bus != 0xff) { 3767 sec_bus = sup_bus + 1; 3768 sub_bus = sup_bus + 1; 3769 PCI_WRITE_CONFIG(bus, dev, sec_reg, sec_bus, 1); 3770 PCI_WRITE_CONFIG(bus, dev, sub_reg, sub_bus, 1); 3771 } 3772 break; 3773 3774 case 0x00dd10de: 3775 /* Compaq R3000 BIOS sets wrong subordinate bus number. */ 3776 if ((cp = kern_getenv("smbios.planar.maker")) == NULL) 3777 break; 3778 if (strncmp(cp, "Compal", 6) != 0) { 3779 freeenv(cp); 3780 break; 3781 } 3782 freeenv(cp); 3783 if ((cp = kern_getenv("smbios.planar.product")) == NULL) 3784 break; 3785 if (strncmp(cp, "08A0", 4) != 0) { 3786 freeenv(cp); 3787 break; 3788 } 3789 freeenv(cp); 3790 if (sub_bus < 0xa) { 3791 sub_bus = 0xa; 3792 PCI_WRITE_CONFIG(bus, dev, sub_reg, sub_bus, 1); 3793 } 3794 break; 3795 } 3796 3797 if (bootverbose) 3798 printf("\tsecbus=%d, subbus=%d\n", sec_bus, sub_bus); 3799 if (sec_bus > 0 && sub_bus >= sec_bus) { 3800 start = sec_bus; 3801 end = sub_bus; 3802 count = end - start + 1; 3803 3804 resource_list_add(rl, PCI_RES_BUS, 0, 0, ~0, count); 3805 3806 /* 3807 * If requested, clear secondary bus registers in 3808 * bridge devices to force a complete renumbering 3809 * rather than reserving the existing range. However, 3810 * preserve the existing size. 3811 */ 3812 if (pci_clear_buses) 3813 goto clear; 3814 3815 rid = 0; 3816 res = resource_list_reserve(rl, bus, dev, PCI_RES_BUS, &rid, 3817 start, end, count, 0); 3818 if (res != NULL) 3819 return; 3820 3821 if (bootverbose) 3822 device_printf(bus, 3823 "pci%d:%d:%d:%d secbus failed to allocate\n", 3824 pci_get_domain(dev), pci_get_bus(dev), 3825 pci_get_slot(dev), pci_get_function(dev)); 3826 } 3827 3828 clear: 3829 PCI_WRITE_CONFIG(bus, dev, sec_reg, 0, 1); 3830 PCI_WRITE_CONFIG(bus, dev, sub_reg, 0, 1); 3831 } 3832 3833 static struct resource * 3834 pci_alloc_secbus(device_t dev, device_t child, int *rid, rman_res_t start, 3835 rman_res_t end, rman_res_t count, u_int flags) 3836 { 3837 struct pci_devinfo *dinfo; 3838 pcicfgregs *cfg; 3839 struct resource_list *rl; 3840 struct resource *res; 3841 int sec_reg, sub_reg; 3842 3843 dinfo = device_get_ivars(child); 3844 cfg = &dinfo->cfg; 3845 rl = &dinfo->resources; 3846 switch (cfg->hdrtype & PCIM_HDRTYPE) { 3847 case PCIM_HDRTYPE_BRIDGE: 3848 sec_reg = PCIR_SECBUS_1; 3849 sub_reg = PCIR_SUBBUS_1; 3850 break; 3851 case PCIM_HDRTYPE_CARDBUS: 3852 sec_reg = PCIR_SECBUS_2; 3853 sub_reg = PCIR_SUBBUS_2; 3854 break; 3855 default: 3856 return (NULL); 3857 } 3858 3859 if (*rid != 0) 3860 return (NULL); 3861 3862 if (resource_list_find(rl, PCI_RES_BUS, *rid) == NULL) 3863 resource_list_add(rl, PCI_RES_BUS, *rid, start, end, count); 3864 if (!resource_list_reserved(rl, PCI_RES_BUS, *rid)) { 3865 res = resource_list_reserve(rl, dev, child, PCI_RES_BUS, rid, 3866 start, end, count, flags & ~RF_ACTIVE); 3867 if (res == NULL) { 3868 resource_list_delete(rl, PCI_RES_BUS, *rid); 3869 device_printf(child, "allocating %ju bus%s failed\n", 3870 count, count == 1 ? "" : "es"); 3871 return (NULL); 3872 } 3873 if (bootverbose) 3874 device_printf(child, 3875 "Lazy allocation of %ju bus%s at %ju\n", count, 3876 count == 1 ? "" : "es", rman_get_start(res)); 3877 PCI_WRITE_CONFIG(dev, child, sec_reg, rman_get_start(res), 1); 3878 PCI_WRITE_CONFIG(dev, child, sub_reg, rman_get_end(res), 1); 3879 } 3880 return (resource_list_alloc(rl, dev, child, PCI_RES_BUS, rid, start, 3881 end, count, flags)); 3882 } 3883 #endif 3884 3885 static int 3886 pci_ea_bei_to_rid(device_t dev, int bei) 3887 { 3888 #ifdef PCI_IOV 3889 struct pci_devinfo *dinfo; 3890 int iov_pos; 3891 struct pcicfg_iov *iov; 3892 3893 dinfo = device_get_ivars(dev); 3894 iov = dinfo->cfg.iov; 3895 if (iov != NULL) 3896 iov_pos = iov->iov_pos; 3897 else 3898 iov_pos = 0; 3899 #endif 3900 3901 /* Check if matches BAR */ 3902 if ((bei >= PCIM_EA_BEI_BAR_0) && 3903 (bei <= PCIM_EA_BEI_BAR_5)) 3904 return (PCIR_BAR(bei)); 3905 3906 /* Check ROM */ 3907 if (bei == PCIM_EA_BEI_ROM) 3908 return (PCIR_BIOS); 3909 3910 #ifdef PCI_IOV 3911 /* Check if matches VF_BAR */ 3912 if ((iov != NULL) && (bei >= PCIM_EA_BEI_VF_BAR_0) && 3913 (bei <= PCIM_EA_BEI_VF_BAR_5)) 3914 return (PCIR_SRIOV_BAR(bei - PCIM_EA_BEI_VF_BAR_0) + 3915 iov_pos); 3916 #endif 3917 3918 return (-1); 3919 } 3920 3921 int 3922 pci_ea_is_enabled(device_t dev, int rid) 3923 { 3924 struct pci_ea_entry *ea; 3925 struct pci_devinfo *dinfo; 3926 3927 dinfo = device_get_ivars(dev); 3928 3929 STAILQ_FOREACH(ea, &dinfo->cfg.ea.ea_entries, eae_link) { 3930 if (pci_ea_bei_to_rid(dev, ea->eae_bei) == rid) 3931 return ((ea->eae_flags & PCIM_EA_ENABLE) > 0); 3932 } 3933 3934 return (0); 3935 } 3936 3937 void 3938 pci_add_resources_ea(device_t bus, device_t dev, int alloc_iov) 3939 { 3940 struct pci_ea_entry *ea; 3941 struct pci_devinfo *dinfo; 3942 pci_addr_t start, end, count; 3943 struct resource_list *rl; 3944 int type, flags, rid; 3945 struct resource *res; 3946 uint32_t tmp; 3947 #ifdef PCI_IOV 3948 struct pcicfg_iov *iov; 3949 #endif 3950 3951 dinfo = device_get_ivars(dev); 3952 rl = &dinfo->resources; 3953 flags = 0; 3954 3955 #ifdef PCI_IOV 3956 iov = dinfo->cfg.iov; 3957 #endif 3958 3959 if (dinfo->cfg.ea.ea_location == 0) 3960 return; 3961 3962 STAILQ_FOREACH(ea, &dinfo->cfg.ea.ea_entries, eae_link) { 3963 /* 3964 * TODO: Ignore EA-BAR if is not enabled. 3965 * Currently the EA implementation supports 3966 * only situation, where EA structure contains 3967 * predefined entries. In case they are not enabled 3968 * leave them unallocated and proceed with 3969 * a legacy-BAR mechanism. 3970 */ 3971 if ((ea->eae_flags & PCIM_EA_ENABLE) == 0) 3972 continue; 3973 3974 switch ((ea->eae_flags & PCIM_EA_PP) >> PCIM_EA_PP_OFFSET) { 3975 case PCIM_EA_P_MEM_PREFETCH: 3976 case PCIM_EA_P_VF_MEM_PREFETCH: 3977 flags = RF_PREFETCHABLE; 3978 /* FALLTHROUGH */ 3979 case PCIM_EA_P_VF_MEM: 3980 case PCIM_EA_P_MEM: 3981 type = SYS_RES_MEMORY; 3982 break; 3983 case PCIM_EA_P_IO: 3984 type = SYS_RES_IOPORT; 3985 break; 3986 default: 3987 continue; 3988 } 3989 3990 if (alloc_iov != 0) { 3991 #ifdef PCI_IOV 3992 /* Allocating IOV, confirm BEI matches */ 3993 if ((ea->eae_bei < PCIM_EA_BEI_VF_BAR_0) || 3994 (ea->eae_bei > PCIM_EA_BEI_VF_BAR_5)) 3995 continue; 3996 #else 3997 continue; 3998 #endif 3999 } else { 4000 /* Allocating BAR, confirm BEI matches */ 4001 if (((ea->eae_bei < PCIM_EA_BEI_BAR_0) || 4002 (ea->eae_bei > PCIM_EA_BEI_BAR_5)) && 4003 (ea->eae_bei != PCIM_EA_BEI_ROM)) 4004 continue; 4005 } 4006 4007 rid = pci_ea_bei_to_rid(dev, ea->eae_bei); 4008 if (rid < 0) 4009 continue; 4010 4011 /* Skip resources already allocated by EA */ 4012 if ((resource_list_find(rl, SYS_RES_MEMORY, rid) != NULL) || 4013 (resource_list_find(rl, SYS_RES_IOPORT, rid) != NULL)) 4014 continue; 4015 4016 start = ea->eae_base; 4017 count = ea->eae_max_offset + 1; 4018 #ifdef PCI_IOV 4019 if (iov != NULL) 4020 count = count * iov->iov_num_vfs; 4021 #endif 4022 end = start + count - 1; 4023 if (count == 0) 4024 continue; 4025 4026 resource_list_add(rl, type, rid, start, end, count); 4027 res = resource_list_reserve(rl, bus, dev, type, &rid, start, end, count, 4028 flags); 4029 if (res == NULL) { 4030 resource_list_delete(rl, type, rid); 4031 4032 /* 4033 * Failed to allocate using EA, disable entry. 4034 * Another attempt to allocation will be performed 4035 * further, but this time using legacy BAR registers 4036 */ 4037 tmp = pci_read_config(dev, ea->eae_cfg_offset, 4); 4038 tmp &= ~PCIM_EA_ENABLE; 4039 pci_write_config(dev, ea->eae_cfg_offset, tmp, 4); 4040 4041 /* 4042 * Disabling entry might fail in case it is hardwired. 4043 * Read flags again to match current status. 4044 */ 4045 ea->eae_flags = pci_read_config(dev, ea->eae_cfg_offset, 4); 4046 4047 continue; 4048 } 4049 4050 /* As per specification, fill BAR with zeros */ 4051 pci_write_config(dev, rid, 0, 4); 4052 } 4053 } 4054 4055 void 4056 pci_add_resources(device_t bus, device_t dev, int force, uint32_t prefetchmask) 4057 { 4058 struct pci_devinfo *dinfo; 4059 pcicfgregs *cfg; 4060 struct resource_list *rl; 4061 const struct pci_quirk *q; 4062 uint32_t devid; 4063 int i; 4064 4065 dinfo = device_get_ivars(dev); 4066 cfg = &dinfo->cfg; 4067 rl = &dinfo->resources; 4068 devid = (cfg->device << 16) | cfg->vendor; 4069 4070 /* Allocate resources using Enhanced Allocation */ 4071 pci_add_resources_ea(bus, dev, 0); 4072 4073 /* ATA devices needs special map treatment */ 4074 if ((pci_get_class(dev) == PCIC_STORAGE) && 4075 (pci_get_subclass(dev) == PCIS_STORAGE_IDE) && 4076 ((pci_get_progif(dev) & PCIP_STORAGE_IDE_MASTERDEV) || 4077 (!pci_read_config(dev, PCIR_BAR(0), 4) && 4078 !pci_read_config(dev, PCIR_BAR(2), 4))) ) 4079 pci_ata_maps(bus, dev, rl, force, prefetchmask); 4080 else 4081 for (i = 0; i < cfg->nummaps;) { 4082 /* Skip resources already managed by EA */ 4083 if ((resource_list_find(rl, SYS_RES_MEMORY, PCIR_BAR(i)) != NULL) || 4084 (resource_list_find(rl, SYS_RES_IOPORT, PCIR_BAR(i)) != NULL) || 4085 pci_ea_is_enabled(dev, PCIR_BAR(i))) { 4086 i++; 4087 continue; 4088 } 4089 4090 /* 4091 * Skip quirked resources. 4092 */ 4093 for (q = &pci_quirks[0]; q->devid != 0; q++) 4094 if (q->devid == devid && 4095 q->type == PCI_QUIRK_UNMAP_REG && 4096 q->arg1 == PCIR_BAR(i)) 4097 break; 4098 if (q->devid != 0) { 4099 i++; 4100 continue; 4101 } 4102 i += pci_add_map(bus, dev, PCIR_BAR(i), rl, force, 4103 prefetchmask & (1 << i)); 4104 } 4105 4106 /* 4107 * Add additional, quirked resources. 4108 */ 4109 for (q = &pci_quirks[0]; q->devid != 0; q++) 4110 if (q->devid == devid && q->type == PCI_QUIRK_MAP_REG) 4111 pci_add_map(bus, dev, q->arg1, rl, force, 0); 4112 4113 if (cfg->intpin > 0 && PCI_INTERRUPT_VALID(cfg->intline)) { 4114 #ifdef __PCI_REROUTE_INTERRUPT 4115 /* 4116 * Try to re-route interrupts. Sometimes the BIOS or 4117 * firmware may leave bogus values in these registers. 4118 * If the re-route fails, then just stick with what we 4119 * have. 4120 */ 4121 pci_assign_interrupt(bus, dev, 1); 4122 #else 4123 pci_assign_interrupt(bus, dev, 0); 4124 #endif 4125 } 4126 4127 if (pci_usb_takeover && pci_get_class(dev) == PCIC_SERIALBUS && 4128 pci_get_subclass(dev) == PCIS_SERIALBUS_USB) { 4129 if (pci_get_progif(dev) == PCIP_SERIALBUS_USB_XHCI) 4130 xhci_early_takeover(dev); 4131 else if (pci_get_progif(dev) == PCIP_SERIALBUS_USB_EHCI) 4132 ehci_early_takeover(dev); 4133 else if (pci_get_progif(dev) == PCIP_SERIALBUS_USB_OHCI) 4134 ohci_early_takeover(dev); 4135 else if (pci_get_progif(dev) == PCIP_SERIALBUS_USB_UHCI) 4136 uhci_early_takeover(dev); 4137 } 4138 4139 #if defined(NEW_PCIB) && defined(PCI_RES_BUS) 4140 /* 4141 * Reserve resources for secondary bus ranges behind bridge 4142 * devices. 4143 */ 4144 pci_reserve_secbus(bus, dev, cfg, rl); 4145 #endif 4146 } 4147 4148 static struct pci_devinfo * 4149 pci_identify_function(device_t pcib, device_t dev, int domain, int busno, 4150 int slot, int func) 4151 { 4152 struct pci_devinfo *dinfo; 4153 4154 dinfo = pci_read_device(pcib, dev, domain, busno, slot, func); 4155 if (dinfo != NULL) 4156 pci_add_child(dev, dinfo); 4157 4158 return (dinfo); 4159 } 4160 4161 void 4162 pci_add_children(device_t dev, int domain, int busno) 4163 { 4164 #define REG(n, w) PCIB_READ_CONFIG(pcib, busno, s, f, n, w) 4165 device_t pcib = device_get_parent(dev); 4166 struct pci_devinfo *dinfo; 4167 int maxslots; 4168 int s, f, pcifunchigh; 4169 uint8_t hdrtype; 4170 int first_func; 4171 4172 /* 4173 * Try to detect a device at slot 0, function 0. If it exists, try to 4174 * enable ARI. We must enable ARI before detecting the rest of the 4175 * functions on this bus as ARI changes the set of slots and functions 4176 * that are legal on this bus. 4177 */ 4178 dinfo = pci_identify_function(pcib, dev, domain, busno, 0, 0); 4179 if (dinfo != NULL && pci_enable_ari) 4180 PCIB_TRY_ENABLE_ARI(pcib, dinfo->cfg.dev); 4181 4182 /* 4183 * Start looking for new devices on slot 0 at function 1 because we 4184 * just identified the device at slot 0, function 0. 4185 */ 4186 first_func = 1; 4187 4188 maxslots = PCIB_MAXSLOTS(pcib); 4189 for (s = 0; s <= maxslots; s++, first_func = 0) { 4190 pcifunchigh = 0; 4191 f = 0; 4192 DELAY(1); 4193 4194 /* If function 0 is not present, skip to the next slot. */ 4195 if (REG(PCIR_VENDOR, 2) == PCIV_INVALID) 4196 continue; 4197 hdrtype = REG(PCIR_HDRTYPE, 1); 4198 if ((hdrtype & PCIM_HDRTYPE) > PCI_MAXHDRTYPE) 4199 continue; 4200 if (hdrtype & PCIM_MFDEV) 4201 pcifunchigh = PCIB_MAXFUNCS(pcib); 4202 for (f = first_func; f <= pcifunchigh; f++) 4203 pci_identify_function(pcib, dev, domain, busno, s, f); 4204 } 4205 #undef REG 4206 } 4207 4208 int 4209 pci_rescan_method(device_t dev) 4210 { 4211 #define REG(n, w) PCIB_READ_CONFIG(pcib, busno, s, f, n, w) 4212 device_t pcib = device_get_parent(dev); 4213 device_t child, *devlist, *unchanged; 4214 int devcount, error, i, j, maxslots, oldcount; 4215 int busno, domain, s, f, pcifunchigh; 4216 uint8_t hdrtype; 4217 4218 /* No need to check for ARI on a rescan. */ 4219 error = device_get_children(dev, &devlist, &devcount); 4220 if (error) 4221 return (error); 4222 if (devcount != 0) { 4223 unchanged = malloc(devcount * sizeof(device_t), M_TEMP, 4224 M_NOWAIT | M_ZERO); 4225 if (unchanged == NULL) { 4226 free(devlist, M_TEMP); 4227 return (ENOMEM); 4228 } 4229 } else 4230 unchanged = NULL; 4231 4232 domain = pcib_get_domain(dev); 4233 busno = pcib_get_bus(dev); 4234 maxslots = PCIB_MAXSLOTS(pcib); 4235 for (s = 0; s <= maxslots; s++) { 4236 /* If function 0 is not present, skip to the next slot. */ 4237 f = 0; 4238 if (REG(PCIR_VENDOR, 2) == PCIV_INVALID) 4239 continue; 4240 pcifunchigh = 0; 4241 hdrtype = REG(PCIR_HDRTYPE, 1); 4242 if ((hdrtype & PCIM_HDRTYPE) > PCI_MAXHDRTYPE) 4243 continue; 4244 if (hdrtype & PCIM_MFDEV) 4245 pcifunchigh = PCIB_MAXFUNCS(pcib); 4246 for (f = 0; f <= pcifunchigh; f++) { 4247 if (REG(PCIR_VENDOR, 2) == PCIV_INVALID) 4248 continue; 4249 4250 /* 4251 * Found a valid function. Check if a 4252 * device_t for this device already exists. 4253 */ 4254 for (i = 0; i < devcount; i++) { 4255 child = devlist[i]; 4256 if (child == NULL) 4257 continue; 4258 if (pci_get_slot(child) == s && 4259 pci_get_function(child) == f) { 4260 unchanged[i] = child; 4261 goto next_func; 4262 } 4263 } 4264 4265 pci_identify_function(pcib, dev, domain, busno, s, f); 4266 next_func:; 4267 } 4268 } 4269 4270 /* Remove devices that are no longer present. */ 4271 for (i = 0; i < devcount; i++) { 4272 if (unchanged[i] != NULL) 4273 continue; 4274 device_delete_child(dev, devlist[i]); 4275 } 4276 4277 free(devlist, M_TEMP); 4278 oldcount = devcount; 4279 4280 /* Try to attach the devices just added. */ 4281 error = device_get_children(dev, &devlist, &devcount); 4282 if (error) { 4283 free(unchanged, M_TEMP); 4284 return (error); 4285 } 4286 4287 for (i = 0; i < devcount; i++) { 4288 for (j = 0; j < oldcount; j++) { 4289 if (devlist[i] == unchanged[j]) 4290 goto next_device; 4291 } 4292 4293 device_probe_and_attach(devlist[i]); 4294 next_device:; 4295 } 4296 4297 free(unchanged, M_TEMP); 4298 free(devlist, M_TEMP); 4299 return (0); 4300 #undef REG 4301 } 4302 4303 #ifdef PCI_IOV 4304 device_t 4305 pci_add_iov_child(device_t bus, device_t pf, uint16_t rid, uint16_t vid, 4306 uint16_t did) 4307 { 4308 struct pci_devinfo *vf_dinfo; 4309 device_t pcib; 4310 int busno, slot, func; 4311 4312 pcib = device_get_parent(bus); 4313 4314 PCIB_DECODE_RID(pcib, rid, &busno, &slot, &func); 4315 4316 vf_dinfo = pci_fill_devinfo(pcib, bus, pci_get_domain(pcib), busno, 4317 slot, func, vid, did); 4318 4319 vf_dinfo->cfg.flags |= PCICFG_VF; 4320 pci_add_child(bus, vf_dinfo); 4321 4322 return (vf_dinfo->cfg.dev); 4323 } 4324 4325 device_t 4326 pci_create_iov_child_method(device_t bus, device_t pf, uint16_t rid, 4327 uint16_t vid, uint16_t did) 4328 { 4329 4330 return (pci_add_iov_child(bus, pf, rid, vid, did)); 4331 } 4332 #endif 4333 4334 /* 4335 * For PCIe device set Max_Payload_Size to match PCIe root's. 4336 */ 4337 static void 4338 pcie_setup_mps(device_t dev) 4339 { 4340 struct pci_devinfo *dinfo = device_get_ivars(dev); 4341 device_t root; 4342 uint16_t rmps, mmps, mps; 4343 4344 if (dinfo->cfg.pcie.pcie_location == 0) 4345 return; 4346 root = pci_find_pcie_root_port(dev); 4347 if (root == NULL) 4348 return; 4349 /* Check whether the MPS is already configured. */ 4350 rmps = pcie_read_config(root, PCIER_DEVICE_CTL, 2) & 4351 PCIEM_CTL_MAX_PAYLOAD; 4352 mps = pcie_read_config(dev, PCIER_DEVICE_CTL, 2) & 4353 PCIEM_CTL_MAX_PAYLOAD; 4354 if (mps == rmps) 4355 return; 4356 /* Check whether the device is capable of the root's MPS. */ 4357 mmps = (pcie_read_config(dev, PCIER_DEVICE_CAP, 2) & 4358 PCIEM_CAP_MAX_PAYLOAD) << 5; 4359 if (rmps > mmps) { 4360 /* 4361 * The device is unable to handle root's MPS. Limit root. 4362 * XXX: We should traverse through all the tree, applying 4363 * it to all the devices. 4364 */ 4365 pcie_adjust_config(root, PCIER_DEVICE_CTL, 4366 PCIEM_CTL_MAX_PAYLOAD, mmps, 2); 4367 } else { 4368 pcie_adjust_config(dev, PCIER_DEVICE_CTL, 4369 PCIEM_CTL_MAX_PAYLOAD, rmps, 2); 4370 } 4371 } 4372 4373 static void 4374 pci_add_child_clear_aer(device_t dev, struct pci_devinfo *dinfo) 4375 { 4376 int aer; 4377 uint32_t r; 4378 uint16_t r2; 4379 4380 if (dinfo->cfg.pcie.pcie_location != 0 && 4381 dinfo->cfg.pcie.pcie_type == PCIEM_TYPE_ROOT_PORT) { 4382 r2 = pci_read_config(dev, dinfo->cfg.pcie.pcie_location + 4383 PCIER_ROOT_CTL, 2); 4384 r2 &= ~(PCIEM_ROOT_CTL_SERR_CORR | 4385 PCIEM_ROOT_CTL_SERR_NONFATAL | PCIEM_ROOT_CTL_SERR_FATAL); 4386 pci_write_config(dev, dinfo->cfg.pcie.pcie_location + 4387 PCIER_ROOT_CTL, r2, 2); 4388 } 4389 if (pci_find_extcap(dev, PCIZ_AER, &aer) == 0) { 4390 r = pci_read_config(dev, aer + PCIR_AER_UC_STATUS, 4); 4391 pci_write_config(dev, aer + PCIR_AER_UC_STATUS, r, 4); 4392 if (r != 0 && bootverbose) { 4393 pci_printf(&dinfo->cfg, 4394 "clearing AER UC 0x%08x -> 0x%08x\n", 4395 r, pci_read_config(dev, aer + PCIR_AER_UC_STATUS, 4396 4)); 4397 } 4398 4399 r = pci_read_config(dev, aer + PCIR_AER_UC_MASK, 4); 4400 r &= ~(PCIM_AER_UC_TRAINING_ERROR | 4401 PCIM_AER_UC_DL_PROTOCOL_ERROR | 4402 PCIM_AER_UC_SURPRISE_LINK_DOWN | 4403 PCIM_AER_UC_POISONED_TLP | 4404 PCIM_AER_UC_FC_PROTOCOL_ERROR | 4405 PCIM_AER_UC_COMPLETION_TIMEOUT | 4406 PCIM_AER_UC_COMPLETER_ABORT | 4407 PCIM_AER_UC_UNEXPECTED_COMPLETION | 4408 PCIM_AER_UC_RECEIVER_OVERFLOW | 4409 PCIM_AER_UC_MALFORMED_TLP | 4410 PCIM_AER_UC_ECRC_ERROR | 4411 PCIM_AER_UC_UNSUPPORTED_REQUEST | 4412 PCIM_AER_UC_ACS_VIOLATION | 4413 PCIM_AER_UC_INTERNAL_ERROR | 4414 PCIM_AER_UC_MC_BLOCKED_TLP | 4415 PCIM_AER_UC_ATOMIC_EGRESS_BLK | 4416 PCIM_AER_UC_TLP_PREFIX_BLOCKED); 4417 pci_write_config(dev, aer + PCIR_AER_UC_MASK, r, 4); 4418 4419 r = pci_read_config(dev, aer + PCIR_AER_COR_STATUS, 4); 4420 pci_write_config(dev, aer + PCIR_AER_COR_STATUS, r, 4); 4421 if (r != 0 && bootverbose) { 4422 pci_printf(&dinfo->cfg, 4423 "clearing AER COR 0x%08x -> 0x%08x\n", 4424 r, pci_read_config(dev, aer + PCIR_AER_COR_STATUS, 4425 4)); 4426 } 4427 4428 r = pci_read_config(dev, aer + PCIR_AER_COR_MASK, 4); 4429 r &= ~(PCIM_AER_COR_RECEIVER_ERROR | 4430 PCIM_AER_COR_BAD_TLP | 4431 PCIM_AER_COR_BAD_DLLP | 4432 PCIM_AER_COR_REPLAY_ROLLOVER | 4433 PCIM_AER_COR_REPLAY_TIMEOUT | 4434 PCIM_AER_COR_ADVISORY_NF_ERROR | 4435 PCIM_AER_COR_INTERNAL_ERROR | 4436 PCIM_AER_COR_HEADER_LOG_OVFLOW); 4437 pci_write_config(dev, aer + PCIR_AER_COR_MASK, r, 4); 4438 4439 r = pci_read_config(dev, dinfo->cfg.pcie.pcie_location + 4440 PCIER_DEVICE_CTL, 2); 4441 r |= PCIEM_CTL_COR_ENABLE | PCIEM_CTL_NFER_ENABLE | 4442 PCIEM_CTL_FER_ENABLE | PCIEM_CTL_URR_ENABLE; 4443 pci_write_config(dev, dinfo->cfg.pcie.pcie_location + 4444 PCIER_DEVICE_CTL, r, 2); 4445 } 4446 } 4447 4448 void 4449 pci_add_child(device_t bus, struct pci_devinfo *dinfo) 4450 { 4451 device_t dev; 4452 4453 dinfo->cfg.dev = dev = device_add_child(bus, NULL, -1); 4454 device_set_ivars(dev, dinfo); 4455 resource_list_init(&dinfo->resources); 4456 pci_cfg_save(dev, dinfo, 0); 4457 pci_cfg_restore(dev, dinfo); 4458 pci_print_verbose(dinfo); 4459 pci_add_resources(bus, dev, 0, 0); 4460 if (pci_enable_mps_tune) 4461 pcie_setup_mps(dev); 4462 pci_child_added(dinfo->cfg.dev); 4463 4464 if (pci_clear_aer_on_attach) 4465 pci_add_child_clear_aer(dev, dinfo); 4466 4467 EVENTHANDLER_INVOKE(pci_add_device, dinfo->cfg.dev); 4468 } 4469 4470 void 4471 pci_child_added_method(device_t dev, device_t child) 4472 { 4473 4474 } 4475 4476 static int 4477 pci_probe(device_t dev) 4478 { 4479 4480 device_set_desc(dev, "PCI bus"); 4481 4482 /* Allow other subclasses to override this driver. */ 4483 return (BUS_PROBE_GENERIC); 4484 } 4485 4486 int 4487 pci_attach_common(device_t dev) 4488 { 4489 struct pci_softc *sc; 4490 int busno, domain; 4491 #ifdef PCI_RES_BUS 4492 int rid; 4493 #endif 4494 4495 sc = device_get_softc(dev); 4496 domain = pcib_get_domain(dev); 4497 busno = pcib_get_bus(dev); 4498 #ifdef PCI_RES_BUS 4499 rid = 0; 4500 sc->sc_bus = bus_alloc_resource(dev, PCI_RES_BUS, &rid, busno, busno, 4501 1, 0); 4502 if (sc->sc_bus == NULL) { 4503 device_printf(dev, "failed to allocate bus number\n"); 4504 return (ENXIO); 4505 } 4506 #endif 4507 if (bootverbose) 4508 device_printf(dev, "domain=%d, physical bus=%d\n", 4509 domain, busno); 4510 sc->sc_dma_tag = bus_get_dma_tag(dev); 4511 return (0); 4512 } 4513 4514 int 4515 pci_attach(device_t dev) 4516 { 4517 int busno, domain, error; 4518 4519 error = pci_attach_common(dev); 4520 if (error) 4521 return (error); 4522 4523 /* 4524 * Since there can be multiple independently numbered PCI 4525 * buses on systems with multiple PCI domains, we can't use 4526 * the unit number to decide which bus we are probing. We ask 4527 * the parent pcib what our domain and bus numbers are. 4528 */ 4529 domain = pcib_get_domain(dev); 4530 busno = pcib_get_bus(dev); 4531 pci_add_children(dev, domain, busno); 4532 return (bus_generic_attach(dev)); 4533 } 4534 4535 int 4536 pci_detach(device_t dev) 4537 { 4538 #ifdef PCI_RES_BUS 4539 struct pci_softc *sc; 4540 #endif 4541 int error; 4542 4543 error = bus_generic_detach(dev); 4544 if (error) 4545 return (error); 4546 #ifdef PCI_RES_BUS 4547 sc = device_get_softc(dev); 4548 error = bus_release_resource(dev, PCI_RES_BUS, 0, sc->sc_bus); 4549 if (error) 4550 return (error); 4551 #endif 4552 return (device_delete_children(dev)); 4553 } 4554 4555 static void 4556 pci_hint_device_unit(device_t dev, device_t child, const char *name, int *unitp) 4557 { 4558 int line, unit; 4559 const char *at; 4560 char me1[24], me2[32]; 4561 uint8_t b, s, f; 4562 uint32_t d; 4563 device_location_cache_t *cache; 4564 4565 d = pci_get_domain(child); 4566 b = pci_get_bus(child); 4567 s = pci_get_slot(child); 4568 f = pci_get_function(child); 4569 snprintf(me1, sizeof(me1), "pci%u:%u:%u", b, s, f); 4570 snprintf(me2, sizeof(me2), "pci%u:%u:%u:%u", d, b, s, f); 4571 line = 0; 4572 cache = dev_wired_cache_init(); 4573 while (resource_find_dev(&line, name, &unit, "at", NULL) == 0) { 4574 resource_string_value(name, unit, "at", &at); 4575 if (strcmp(at, me1) == 0 || strcmp(at, me2) == 0) { 4576 *unitp = unit; 4577 break; 4578 } 4579 if (dev_wired_cache_match(cache, child, at)) { 4580 *unitp = unit; 4581 break; 4582 } 4583 } 4584 dev_wired_cache_fini(cache); 4585 } 4586 4587 static void 4588 pci_set_power_child(device_t dev, device_t child, int state) 4589 { 4590 device_t pcib; 4591 int dstate; 4592 4593 /* 4594 * Set the device to the given state. If the firmware suggests 4595 * a different power state, use it instead. If power management 4596 * is not present, the firmware is responsible for managing 4597 * device power. Skip children who aren't attached since they 4598 * are handled separately. 4599 */ 4600 pcib = device_get_parent(dev); 4601 dstate = state; 4602 if (device_is_attached(child) && 4603 PCIB_POWER_FOR_SLEEP(pcib, child, &dstate) == 0) 4604 pci_set_powerstate(child, dstate); 4605 } 4606 4607 int 4608 pci_suspend_child(device_t dev, device_t child) 4609 { 4610 struct pci_devinfo *dinfo; 4611 struct resource_list_entry *rle; 4612 int error; 4613 4614 dinfo = device_get_ivars(child); 4615 4616 /* 4617 * Save the PCI configuration space for the child and set the 4618 * device in the appropriate power state for this sleep state. 4619 */ 4620 pci_cfg_save(child, dinfo, 0); 4621 4622 /* Suspend devices before potentially powering them down. */ 4623 error = bus_generic_suspend_child(dev, child); 4624 4625 if (error) 4626 return (error); 4627 4628 if (pci_do_power_suspend) { 4629 /* 4630 * Make sure this device's interrupt handler is not invoked 4631 * in the case the device uses a shared interrupt that can 4632 * be raised by some other device. 4633 * This is applicable only to regular (legacy) PCI interrupts 4634 * as MSI/MSI-X interrupts are never shared. 4635 */ 4636 rle = resource_list_find(&dinfo->resources, 4637 SYS_RES_IRQ, 0); 4638 if (rle != NULL && rle->res != NULL) 4639 (void)bus_suspend_intr(child, rle->res); 4640 pci_set_power_child(dev, child, PCI_POWERSTATE_D3); 4641 } 4642 4643 return (0); 4644 } 4645 4646 int 4647 pci_resume_child(device_t dev, device_t child) 4648 { 4649 struct pci_devinfo *dinfo; 4650 struct resource_list_entry *rle; 4651 4652 if (pci_do_power_resume) 4653 pci_set_power_child(dev, child, PCI_POWERSTATE_D0); 4654 4655 dinfo = device_get_ivars(child); 4656 pci_cfg_restore(child, dinfo); 4657 if (!device_is_attached(child)) 4658 pci_cfg_save(child, dinfo, 1); 4659 4660 bus_generic_resume_child(dev, child); 4661 4662 /* 4663 * Allow interrupts only after fully resuming the driver and hardware. 4664 */ 4665 if (pci_do_power_suspend) { 4666 /* See pci_suspend_child for details. */ 4667 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, 0); 4668 if (rle != NULL && rle->res != NULL) 4669 (void)bus_resume_intr(child, rle->res); 4670 } 4671 4672 return (0); 4673 } 4674 4675 int 4676 pci_resume(device_t dev) 4677 { 4678 device_t child, *devlist; 4679 int error, i, numdevs; 4680 4681 if ((error = device_get_children(dev, &devlist, &numdevs)) != 0) 4682 return (error); 4683 4684 /* 4685 * Resume critical devices first, then everything else later. 4686 */ 4687 for (i = 0; i < numdevs; i++) { 4688 child = devlist[i]; 4689 switch (pci_get_class(child)) { 4690 case PCIC_DISPLAY: 4691 case PCIC_MEMORY: 4692 case PCIC_BRIDGE: 4693 case PCIC_BASEPERIPH: 4694 BUS_RESUME_CHILD(dev, child); 4695 break; 4696 } 4697 } 4698 for (i = 0; i < numdevs; i++) { 4699 child = devlist[i]; 4700 switch (pci_get_class(child)) { 4701 case PCIC_DISPLAY: 4702 case PCIC_MEMORY: 4703 case PCIC_BRIDGE: 4704 case PCIC_BASEPERIPH: 4705 break; 4706 default: 4707 BUS_RESUME_CHILD(dev, child); 4708 } 4709 } 4710 free(devlist, M_TEMP); 4711 return (0); 4712 } 4713 4714 static void 4715 pci_load_vendor_data(void) 4716 { 4717 caddr_t data; 4718 void *ptr; 4719 size_t sz; 4720 4721 data = preload_search_by_type("pci_vendor_data"); 4722 if (data != NULL) { 4723 ptr = preload_fetch_addr(data); 4724 sz = preload_fetch_size(data); 4725 if (ptr != NULL && sz != 0) { 4726 pci_vendordata = ptr; 4727 pci_vendordata_size = sz; 4728 /* terminate the database */ 4729 pci_vendordata[pci_vendordata_size] = '\n'; 4730 } 4731 } 4732 } 4733 4734 void 4735 pci_driver_added(device_t dev, driver_t *driver) 4736 { 4737 int numdevs; 4738 device_t *devlist; 4739 device_t child; 4740 struct pci_devinfo *dinfo; 4741 int i; 4742 4743 if (bootverbose) 4744 device_printf(dev, "driver added\n"); 4745 DEVICE_IDENTIFY(driver, dev); 4746 if (device_get_children(dev, &devlist, &numdevs) != 0) 4747 return; 4748 for (i = 0; i < numdevs; i++) { 4749 child = devlist[i]; 4750 if (device_get_state(child) != DS_NOTPRESENT) 4751 continue; 4752 dinfo = device_get_ivars(child); 4753 pci_print_verbose(dinfo); 4754 if (bootverbose) 4755 pci_printf(&dinfo->cfg, "reprobing on driver added\n"); 4756 pci_cfg_restore(child, dinfo); 4757 if (device_probe_and_attach(child) != 0) 4758 pci_child_detached(dev, child); 4759 } 4760 free(devlist, M_TEMP); 4761 } 4762 4763 int 4764 pci_setup_intr(device_t dev, device_t child, struct resource *irq, int flags, 4765 driver_filter_t *filter, driver_intr_t *intr, void *arg, void **cookiep) 4766 { 4767 struct pci_devinfo *dinfo; 4768 struct msix_table_entry *mte; 4769 struct msix_vector *mv; 4770 uint64_t addr; 4771 uint32_t data; 4772 void *cookie; 4773 int error, rid; 4774 4775 error = bus_generic_setup_intr(dev, child, irq, flags, filter, intr, 4776 arg, &cookie); 4777 if (error) 4778 return (error); 4779 4780 /* If this is not a direct child, just bail out. */ 4781 if (device_get_parent(child) != dev) { 4782 *cookiep = cookie; 4783 return(0); 4784 } 4785 4786 rid = rman_get_rid(irq); 4787 if (rid == 0) { 4788 /* Make sure that INTx is enabled */ 4789 pci_clear_command_bit(dev, child, PCIM_CMD_INTxDIS); 4790 } else { 4791 /* 4792 * Check to see if the interrupt is MSI or MSI-X. 4793 * Ask our parent to map the MSI and give 4794 * us the address and data register values. 4795 * If we fail for some reason, teardown the 4796 * interrupt handler. 4797 */ 4798 dinfo = device_get_ivars(child); 4799 if (dinfo->cfg.msi.msi_alloc > 0) { 4800 if (dinfo->cfg.msi.msi_addr == 0) { 4801 KASSERT(dinfo->cfg.msi.msi_handlers == 0, 4802 ("MSI has handlers, but vectors not mapped")); 4803 error = PCIB_MAP_MSI(device_get_parent(dev), 4804 child, rman_get_start(irq), &addr, &data); 4805 if (error) 4806 goto bad; 4807 dinfo->cfg.msi.msi_addr = addr; 4808 dinfo->cfg.msi.msi_data = data; 4809 } 4810 if (dinfo->cfg.msi.msi_handlers == 0) 4811 pci_enable_msi(child, dinfo->cfg.msi.msi_addr, 4812 dinfo->cfg.msi.msi_data); 4813 dinfo->cfg.msi.msi_handlers++; 4814 } else { 4815 KASSERT(dinfo->cfg.msix.msix_alloc > 0, 4816 ("No MSI or MSI-X interrupts allocated")); 4817 KASSERT(rid <= dinfo->cfg.msix.msix_table_len, 4818 ("MSI-X index too high")); 4819 mte = &dinfo->cfg.msix.msix_table[rid - 1]; 4820 KASSERT(mte->mte_vector != 0, ("no message vector")); 4821 mv = &dinfo->cfg.msix.msix_vectors[mte->mte_vector - 1]; 4822 KASSERT(mv->mv_irq == rman_get_start(irq), 4823 ("IRQ mismatch")); 4824 if (mv->mv_address == 0) { 4825 KASSERT(mte->mte_handlers == 0, 4826 ("MSI-X table entry has handlers, but vector not mapped")); 4827 error = PCIB_MAP_MSI(device_get_parent(dev), 4828 child, rman_get_start(irq), &addr, &data); 4829 if (error) 4830 goto bad; 4831 mv->mv_address = addr; 4832 mv->mv_data = data; 4833 } 4834 4835 /* 4836 * The MSIX table entry must be made valid by 4837 * incrementing the mte_handlers before 4838 * calling pci_enable_msix() and 4839 * pci_resume_msix(). Else the MSIX rewrite 4840 * table quirk will not work as expected. 4841 */ 4842 mte->mte_handlers++; 4843 if (mte->mte_handlers == 1) { 4844 pci_enable_msix(child, rid - 1, mv->mv_address, 4845 mv->mv_data); 4846 pci_unmask_msix(child, rid - 1); 4847 } 4848 } 4849 4850 /* 4851 * Make sure that INTx is disabled if we are using MSI/MSI-X, 4852 * unless the device is affected by PCI_QUIRK_MSI_INTX_BUG, 4853 * in which case we "enable" INTx so MSI/MSI-X actually works. 4854 */ 4855 if (!pci_has_quirk(pci_get_devid(child), 4856 PCI_QUIRK_MSI_INTX_BUG)) 4857 pci_set_command_bit(dev, child, PCIM_CMD_INTxDIS); 4858 else 4859 pci_clear_command_bit(dev, child, PCIM_CMD_INTxDIS); 4860 bad: 4861 if (error) { 4862 (void)bus_generic_teardown_intr(dev, child, irq, 4863 cookie); 4864 return (error); 4865 } 4866 } 4867 *cookiep = cookie; 4868 return (0); 4869 } 4870 4871 int 4872 pci_teardown_intr(device_t dev, device_t child, struct resource *irq, 4873 void *cookie) 4874 { 4875 struct msix_table_entry *mte; 4876 struct resource_list_entry *rle; 4877 struct pci_devinfo *dinfo; 4878 int error, rid; 4879 4880 if (irq == NULL || !(rman_get_flags(irq) & RF_ACTIVE)) 4881 return (EINVAL); 4882 4883 /* If this isn't a direct child, just bail out */ 4884 if (device_get_parent(child) != dev) 4885 return(bus_generic_teardown_intr(dev, child, irq, cookie)); 4886 4887 rid = rman_get_rid(irq); 4888 if (rid == 0) { 4889 /* Mask INTx */ 4890 pci_set_command_bit(dev, child, PCIM_CMD_INTxDIS); 4891 } else { 4892 /* 4893 * Check to see if the interrupt is MSI or MSI-X. If so, 4894 * decrement the appropriate handlers count and mask the 4895 * MSI-X message, or disable MSI messages if the count 4896 * drops to 0. 4897 */ 4898 dinfo = device_get_ivars(child); 4899 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, rid); 4900 if (rle->res != irq) 4901 return (EINVAL); 4902 if (dinfo->cfg.msi.msi_alloc > 0) { 4903 KASSERT(rid <= dinfo->cfg.msi.msi_alloc, 4904 ("MSI-X index too high")); 4905 if (dinfo->cfg.msi.msi_handlers == 0) 4906 return (EINVAL); 4907 dinfo->cfg.msi.msi_handlers--; 4908 if (dinfo->cfg.msi.msi_handlers == 0) 4909 pci_disable_msi(child); 4910 } else { 4911 KASSERT(dinfo->cfg.msix.msix_alloc > 0, 4912 ("No MSI or MSI-X interrupts allocated")); 4913 KASSERT(rid <= dinfo->cfg.msix.msix_table_len, 4914 ("MSI-X index too high")); 4915 mte = &dinfo->cfg.msix.msix_table[rid - 1]; 4916 if (mte->mte_handlers == 0) 4917 return (EINVAL); 4918 mte->mte_handlers--; 4919 if (mte->mte_handlers == 0) 4920 pci_mask_msix(child, rid - 1); 4921 } 4922 } 4923 error = bus_generic_teardown_intr(dev, child, irq, cookie); 4924 if (rid > 0) 4925 KASSERT(error == 0, 4926 ("%s: generic teardown failed for MSI/MSI-X", __func__)); 4927 return (error); 4928 } 4929 4930 int 4931 pci_print_child(device_t dev, device_t child) 4932 { 4933 struct pci_devinfo *dinfo; 4934 struct resource_list *rl; 4935 int retval = 0; 4936 4937 dinfo = device_get_ivars(child); 4938 rl = &dinfo->resources; 4939 4940 retval += bus_print_child_header(dev, child); 4941 4942 retval += resource_list_print_type(rl, "port", SYS_RES_IOPORT, "%#jx"); 4943 retval += resource_list_print_type(rl, "mem", SYS_RES_MEMORY, "%#jx"); 4944 retval += resource_list_print_type(rl, "irq", SYS_RES_IRQ, "%jd"); 4945 if (device_get_flags(dev)) 4946 retval += printf(" flags %#x", device_get_flags(dev)); 4947 4948 retval += printf(" at device %d.%d", pci_get_slot(child), 4949 pci_get_function(child)); 4950 4951 retval += bus_print_child_domain(dev, child); 4952 retval += bus_print_child_footer(dev, child); 4953 4954 return (retval); 4955 } 4956 4957 static const struct 4958 { 4959 int class; 4960 int subclass; 4961 int report; /* 0 = bootverbose, 1 = always */ 4962 const char *desc; 4963 } pci_nomatch_tab[] = { 4964 {PCIC_OLD, -1, 1, "old"}, 4965 {PCIC_OLD, PCIS_OLD_NONVGA, 1, "non-VGA display device"}, 4966 {PCIC_OLD, PCIS_OLD_VGA, 1, "VGA-compatible display device"}, 4967 {PCIC_STORAGE, -1, 1, "mass storage"}, 4968 {PCIC_STORAGE, PCIS_STORAGE_SCSI, 1, "SCSI"}, 4969 {PCIC_STORAGE, PCIS_STORAGE_IDE, 1, "ATA"}, 4970 {PCIC_STORAGE, PCIS_STORAGE_FLOPPY, 1, "floppy disk"}, 4971 {PCIC_STORAGE, PCIS_STORAGE_IPI, 1, "IPI"}, 4972 {PCIC_STORAGE, PCIS_STORAGE_RAID, 1, "RAID"}, 4973 {PCIC_STORAGE, PCIS_STORAGE_ATA_ADMA, 1, "ATA (ADMA)"}, 4974 {PCIC_STORAGE, PCIS_STORAGE_SATA, 1, "SATA"}, 4975 {PCIC_STORAGE, PCIS_STORAGE_SAS, 1, "SAS"}, 4976 {PCIC_STORAGE, PCIS_STORAGE_NVM, 1, "NVM"}, 4977 {PCIC_NETWORK, -1, 1, "network"}, 4978 {PCIC_NETWORK, PCIS_NETWORK_ETHERNET, 1, "ethernet"}, 4979 {PCIC_NETWORK, PCIS_NETWORK_TOKENRING, 1, "token ring"}, 4980 {PCIC_NETWORK, PCIS_NETWORK_FDDI, 1, "fddi"}, 4981 {PCIC_NETWORK, PCIS_NETWORK_ATM, 1, "ATM"}, 4982 {PCIC_NETWORK, PCIS_NETWORK_ISDN, 1, "ISDN"}, 4983 {PCIC_DISPLAY, -1, 1, "display"}, 4984 {PCIC_DISPLAY, PCIS_DISPLAY_VGA, 1, "VGA"}, 4985 {PCIC_DISPLAY, PCIS_DISPLAY_XGA, 1, "XGA"}, 4986 {PCIC_DISPLAY, PCIS_DISPLAY_3D, 1, "3D"}, 4987 {PCIC_MULTIMEDIA, -1, 1, "multimedia"}, 4988 {PCIC_MULTIMEDIA, PCIS_MULTIMEDIA_VIDEO, 1, "video"}, 4989 {PCIC_MULTIMEDIA, PCIS_MULTIMEDIA_AUDIO, 1, "audio"}, 4990 {PCIC_MULTIMEDIA, PCIS_MULTIMEDIA_TELE, 1, "telephony"}, 4991 {PCIC_MULTIMEDIA, PCIS_MULTIMEDIA_HDA, 1, "HDA"}, 4992 {PCIC_MEMORY, -1, 1, "memory"}, 4993 {PCIC_MEMORY, PCIS_MEMORY_RAM, 1, "RAM"}, 4994 {PCIC_MEMORY, PCIS_MEMORY_FLASH, 1, "flash"}, 4995 {PCIC_BRIDGE, -1, 1, "bridge"}, 4996 {PCIC_BRIDGE, PCIS_BRIDGE_HOST, 1, "HOST-PCI"}, 4997 {PCIC_BRIDGE, PCIS_BRIDGE_ISA, 1, "PCI-ISA"}, 4998 {PCIC_BRIDGE, PCIS_BRIDGE_EISA, 1, "PCI-EISA"}, 4999 {PCIC_BRIDGE, PCIS_BRIDGE_MCA, 1, "PCI-MCA"}, 5000 {PCIC_BRIDGE, PCIS_BRIDGE_PCI, 1, "PCI-PCI"}, 5001 {PCIC_BRIDGE, PCIS_BRIDGE_PCMCIA, 1, "PCI-PCMCIA"}, 5002 {PCIC_BRIDGE, PCIS_BRIDGE_NUBUS, 1, "PCI-NuBus"}, 5003 {PCIC_BRIDGE, PCIS_BRIDGE_CARDBUS, 1, "PCI-CardBus"}, 5004 {PCIC_BRIDGE, PCIS_BRIDGE_RACEWAY, 1, "PCI-RACEway"}, 5005 {PCIC_SIMPLECOMM, -1, 1, "simple comms"}, 5006 {PCIC_SIMPLECOMM, PCIS_SIMPLECOMM_UART, 1, "UART"}, /* could detect 16550 */ 5007 {PCIC_SIMPLECOMM, PCIS_SIMPLECOMM_PAR, 1, "parallel port"}, 5008 {PCIC_SIMPLECOMM, PCIS_SIMPLECOMM_MULSER, 1, "multiport serial"}, 5009 {PCIC_SIMPLECOMM, PCIS_SIMPLECOMM_MODEM, 1, "generic modem"}, 5010 {PCIC_BASEPERIPH, -1, 0, "base peripheral"}, 5011 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_PIC, 1, "interrupt controller"}, 5012 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_DMA, 1, "DMA controller"}, 5013 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_TIMER, 1, "timer"}, 5014 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_RTC, 1, "realtime clock"}, 5015 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_PCIHOT, 1, "PCI hot-plug controller"}, 5016 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_SDHC, 1, "SD host controller"}, 5017 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_IOMMU, 1, "IOMMU"}, 5018 {PCIC_INPUTDEV, -1, 1, "input device"}, 5019 {PCIC_INPUTDEV, PCIS_INPUTDEV_KEYBOARD, 1, "keyboard"}, 5020 {PCIC_INPUTDEV, PCIS_INPUTDEV_DIGITIZER,1, "digitizer"}, 5021 {PCIC_INPUTDEV, PCIS_INPUTDEV_MOUSE, 1, "mouse"}, 5022 {PCIC_INPUTDEV, PCIS_INPUTDEV_SCANNER, 1, "scanner"}, 5023 {PCIC_INPUTDEV, PCIS_INPUTDEV_GAMEPORT, 1, "gameport"}, 5024 {PCIC_DOCKING, -1, 1, "docking station"}, 5025 {PCIC_PROCESSOR, -1, 1, "processor"}, 5026 {PCIC_SERIALBUS, -1, 1, "serial bus"}, 5027 {PCIC_SERIALBUS, PCIS_SERIALBUS_FW, 1, "FireWire"}, 5028 {PCIC_SERIALBUS, PCIS_SERIALBUS_ACCESS, 1, "AccessBus"}, 5029 {PCIC_SERIALBUS, PCIS_SERIALBUS_SSA, 1, "SSA"}, 5030 {PCIC_SERIALBUS, PCIS_SERIALBUS_USB, 1, "USB"}, 5031 {PCIC_SERIALBUS, PCIS_SERIALBUS_FC, 1, "Fibre Channel"}, 5032 {PCIC_SERIALBUS, PCIS_SERIALBUS_SMBUS, 0, "SMBus"}, 5033 {PCIC_WIRELESS, -1, 1, "wireless controller"}, 5034 {PCIC_WIRELESS, PCIS_WIRELESS_IRDA, 1, "iRDA"}, 5035 {PCIC_WIRELESS, PCIS_WIRELESS_IR, 1, "IR"}, 5036 {PCIC_WIRELESS, PCIS_WIRELESS_RF, 1, "RF"}, 5037 {PCIC_INTELLIIO, -1, 1, "intelligent I/O controller"}, 5038 {PCIC_INTELLIIO, PCIS_INTELLIIO_I2O, 1, "I2O"}, 5039 {PCIC_SATCOM, -1, 1, "satellite communication"}, 5040 {PCIC_SATCOM, PCIS_SATCOM_TV, 1, "sat TV"}, 5041 {PCIC_SATCOM, PCIS_SATCOM_AUDIO, 1, "sat audio"}, 5042 {PCIC_SATCOM, PCIS_SATCOM_VOICE, 1, "sat voice"}, 5043 {PCIC_SATCOM, PCIS_SATCOM_DATA, 1, "sat data"}, 5044 {PCIC_CRYPTO, -1, 1, "encrypt/decrypt"}, 5045 {PCIC_CRYPTO, PCIS_CRYPTO_NETCOMP, 1, "network/computer crypto"}, 5046 {PCIC_CRYPTO, PCIS_CRYPTO_ENTERTAIN, 1, "entertainment crypto"}, 5047 {PCIC_DASP, -1, 0, "dasp"}, 5048 {PCIC_DASP, PCIS_DASP_DPIO, 1, "DPIO module"}, 5049 {PCIC_DASP, PCIS_DASP_PERFCNTRS, 1, "performance counters"}, 5050 {PCIC_DASP, PCIS_DASP_COMM_SYNC, 1, "communication synchronizer"}, 5051 {PCIC_DASP, PCIS_DASP_MGMT_CARD, 1, "signal processing management"}, 5052 {PCIC_INSTRUMENT, -1, 0, "non-essential instrumentation"}, 5053 {0, 0, 0, NULL} 5054 }; 5055 5056 void 5057 pci_probe_nomatch(device_t dev, device_t child) 5058 { 5059 int i, report; 5060 const char *cp, *scp; 5061 char *device; 5062 5063 /* 5064 * Look for a listing for this device in a loaded device database. 5065 */ 5066 report = 1; 5067 if ((device = pci_describe_device(child)) != NULL) { 5068 device_printf(dev, "<%s>", device); 5069 free(device, M_DEVBUF); 5070 } else { 5071 /* 5072 * Scan the class/subclass descriptions for a general 5073 * description. 5074 */ 5075 cp = "unknown"; 5076 scp = NULL; 5077 for (i = 0; pci_nomatch_tab[i].desc != NULL; i++) { 5078 if (pci_nomatch_tab[i].class == pci_get_class(child)) { 5079 if (pci_nomatch_tab[i].subclass == -1) { 5080 cp = pci_nomatch_tab[i].desc; 5081 report = pci_nomatch_tab[i].report; 5082 } else if (pci_nomatch_tab[i].subclass == 5083 pci_get_subclass(child)) { 5084 scp = pci_nomatch_tab[i].desc; 5085 report = pci_nomatch_tab[i].report; 5086 } 5087 } 5088 } 5089 if (report || bootverbose) { 5090 device_printf(dev, "<%s%s%s>", 5091 cp ? cp : "", 5092 ((cp != NULL) && (scp != NULL)) ? ", " : "", 5093 scp ? scp : ""); 5094 } 5095 } 5096 if (report || bootverbose) { 5097 printf(" at device %d.%d (no driver attached)\n", 5098 pci_get_slot(child), pci_get_function(child)); 5099 } 5100 pci_cfg_save(child, device_get_ivars(child), 1); 5101 } 5102 5103 void 5104 pci_child_detached(device_t dev, device_t child) 5105 { 5106 struct pci_devinfo *dinfo; 5107 struct resource_list *rl; 5108 5109 dinfo = device_get_ivars(child); 5110 rl = &dinfo->resources; 5111 5112 /* 5113 * Have to deallocate IRQs before releasing any MSI messages and 5114 * have to release MSI messages before deallocating any memory 5115 * BARs. 5116 */ 5117 if (resource_list_release_active(rl, dev, child, SYS_RES_IRQ) != 0) 5118 pci_printf(&dinfo->cfg, "Device leaked IRQ resources\n"); 5119 if (dinfo->cfg.msi.msi_alloc != 0 || dinfo->cfg.msix.msix_alloc != 0) { 5120 if (dinfo->cfg.msi.msi_alloc != 0) 5121 pci_printf(&dinfo->cfg, "Device leaked %d MSI " 5122 "vectors\n", dinfo->cfg.msi.msi_alloc); 5123 else 5124 pci_printf(&dinfo->cfg, "Device leaked %d MSI-X " 5125 "vectors\n", dinfo->cfg.msix.msix_alloc); 5126 (void)pci_release_msi(child); 5127 } 5128 if (resource_list_release_active(rl, dev, child, SYS_RES_MEMORY) != 0) 5129 pci_printf(&dinfo->cfg, "Device leaked memory resources\n"); 5130 if (resource_list_release_active(rl, dev, child, SYS_RES_IOPORT) != 0) 5131 pci_printf(&dinfo->cfg, "Device leaked I/O resources\n"); 5132 #ifdef PCI_RES_BUS 5133 if (resource_list_release_active(rl, dev, child, PCI_RES_BUS) != 0) 5134 pci_printf(&dinfo->cfg, "Device leaked PCI bus numbers\n"); 5135 #endif 5136 5137 pci_cfg_save(child, dinfo, 1); 5138 } 5139 5140 /* 5141 * Parse the PCI device database, if loaded, and return a pointer to a 5142 * description of the device. 5143 * 5144 * The database is flat text formatted as follows: 5145 * 5146 * Any line not in a valid format is ignored. 5147 * Lines are terminated with newline '\n' characters. 5148 * 5149 * A VENDOR line consists of the 4 digit (hex) vendor code, a TAB, then 5150 * the vendor name. 5151 * 5152 * A DEVICE line is entered immediately below the corresponding VENDOR ID. 5153 * - devices cannot be listed without a corresponding VENDOR line. 5154 * A DEVICE line consists of a TAB, the 4 digit (hex) device code, 5155 * another TAB, then the device name. 5156 */ 5157 5158 /* 5159 * Assuming (ptr) points to the beginning of a line in the database, 5160 * return the vendor or device and description of the next entry. 5161 * The value of (vendor) or (device) inappropriate for the entry type 5162 * is set to -1. Returns nonzero at the end of the database. 5163 * 5164 * Note that this is slightly unrobust in the face of corrupt data; 5165 * we attempt to safeguard against this by spamming the end of the 5166 * database with a newline when we initialise. 5167 */ 5168 static int 5169 pci_describe_parse_line(char **ptr, int *vendor, int *device, char **desc) 5170 { 5171 char *cp = *ptr; 5172 int left; 5173 5174 *device = -1; 5175 *vendor = -1; 5176 **desc = '\0'; 5177 for (;;) { 5178 left = pci_vendordata_size - (cp - pci_vendordata); 5179 if (left <= 0) { 5180 *ptr = cp; 5181 return(1); 5182 } 5183 5184 /* vendor entry? */ 5185 if (*cp != '\t' && 5186 sscanf(cp, "%x\t%80[^\n]", vendor, *desc) == 2) 5187 break; 5188 /* device entry? */ 5189 if (*cp == '\t' && 5190 sscanf(cp, "%x\t%80[^\n]", device, *desc) == 2) 5191 break; 5192 5193 /* skip to next line */ 5194 while (*cp != '\n' && left > 0) { 5195 cp++; 5196 left--; 5197 } 5198 if (*cp == '\n') { 5199 cp++; 5200 left--; 5201 } 5202 } 5203 /* skip to next line */ 5204 while (*cp != '\n' && left > 0) { 5205 cp++; 5206 left--; 5207 } 5208 if (*cp == '\n' && left > 0) 5209 cp++; 5210 *ptr = cp; 5211 return(0); 5212 } 5213 5214 static char * 5215 pci_describe_device(device_t dev) 5216 { 5217 int vendor, device; 5218 char *desc, *vp, *dp, *line; 5219 5220 desc = vp = dp = NULL; 5221 5222 /* 5223 * If we have no vendor data, we can't do anything. 5224 */ 5225 if (pci_vendordata == NULL) 5226 goto out; 5227 5228 /* 5229 * Scan the vendor data looking for this device 5230 */ 5231 line = pci_vendordata; 5232 if ((vp = malloc(80, M_DEVBUF, M_NOWAIT)) == NULL) 5233 goto out; 5234 for (;;) { 5235 if (pci_describe_parse_line(&line, &vendor, &device, &vp)) 5236 goto out; 5237 if (vendor == pci_get_vendor(dev)) 5238 break; 5239 } 5240 if ((dp = malloc(80, M_DEVBUF, M_NOWAIT)) == NULL) 5241 goto out; 5242 for (;;) { 5243 if (pci_describe_parse_line(&line, &vendor, &device, &dp)) { 5244 *dp = 0; 5245 break; 5246 } 5247 if (vendor != -1) { 5248 *dp = 0; 5249 break; 5250 } 5251 if (device == pci_get_device(dev)) 5252 break; 5253 } 5254 if (dp[0] == '\0') 5255 snprintf(dp, 80, "0x%x", pci_get_device(dev)); 5256 if ((desc = malloc(strlen(vp) + strlen(dp) + 3, M_DEVBUF, M_NOWAIT)) != 5257 NULL) 5258 sprintf(desc, "%s, %s", vp, dp); 5259 out: 5260 if (vp != NULL) 5261 free(vp, M_DEVBUF); 5262 if (dp != NULL) 5263 free(dp, M_DEVBUF); 5264 return(desc); 5265 } 5266 5267 int 5268 pci_read_ivar(device_t dev, device_t child, int which, uintptr_t *result) 5269 { 5270 struct pci_devinfo *dinfo; 5271 pcicfgregs *cfg; 5272 5273 dinfo = device_get_ivars(child); 5274 cfg = &dinfo->cfg; 5275 5276 switch (which) { 5277 case PCI_IVAR_ETHADDR: 5278 /* 5279 * The generic accessor doesn't deal with failure, so 5280 * we set the return value, then return an error. 5281 */ 5282 *((uint8_t **) result) = NULL; 5283 return (EINVAL); 5284 case PCI_IVAR_SUBVENDOR: 5285 *result = cfg->subvendor; 5286 break; 5287 case PCI_IVAR_SUBDEVICE: 5288 *result = cfg->subdevice; 5289 break; 5290 case PCI_IVAR_VENDOR: 5291 *result = cfg->vendor; 5292 break; 5293 case PCI_IVAR_DEVICE: 5294 *result = cfg->device; 5295 break; 5296 case PCI_IVAR_DEVID: 5297 *result = (cfg->device << 16) | cfg->vendor; 5298 break; 5299 case PCI_IVAR_CLASS: 5300 *result = cfg->baseclass; 5301 break; 5302 case PCI_IVAR_SUBCLASS: 5303 *result = cfg->subclass; 5304 break; 5305 case PCI_IVAR_PROGIF: 5306 *result = cfg->progif; 5307 break; 5308 case PCI_IVAR_REVID: 5309 *result = cfg->revid; 5310 break; 5311 case PCI_IVAR_INTPIN: 5312 *result = cfg->intpin; 5313 break; 5314 case PCI_IVAR_IRQ: 5315 *result = cfg->intline; 5316 break; 5317 case PCI_IVAR_DOMAIN: 5318 *result = cfg->domain; 5319 break; 5320 case PCI_IVAR_BUS: 5321 *result = cfg->bus; 5322 break; 5323 case PCI_IVAR_SLOT: 5324 *result = cfg->slot; 5325 break; 5326 case PCI_IVAR_FUNCTION: 5327 *result = cfg->func; 5328 break; 5329 case PCI_IVAR_CMDREG: 5330 *result = cfg->cmdreg; 5331 break; 5332 case PCI_IVAR_CACHELNSZ: 5333 *result = cfg->cachelnsz; 5334 break; 5335 case PCI_IVAR_MINGNT: 5336 if (cfg->hdrtype != PCIM_HDRTYPE_NORMAL) { 5337 *result = -1; 5338 return (EINVAL); 5339 } 5340 *result = cfg->mingnt; 5341 break; 5342 case PCI_IVAR_MAXLAT: 5343 if (cfg->hdrtype != PCIM_HDRTYPE_NORMAL) { 5344 *result = -1; 5345 return (EINVAL); 5346 } 5347 *result = cfg->maxlat; 5348 break; 5349 case PCI_IVAR_LATTIMER: 5350 *result = cfg->lattimer; 5351 break; 5352 default: 5353 return (ENOENT); 5354 } 5355 return (0); 5356 } 5357 5358 int 5359 pci_write_ivar(device_t dev, device_t child, int which, uintptr_t value) 5360 { 5361 struct pci_devinfo *dinfo; 5362 5363 dinfo = device_get_ivars(child); 5364 5365 switch (which) { 5366 case PCI_IVAR_INTPIN: 5367 dinfo->cfg.intpin = value; 5368 return (0); 5369 case PCI_IVAR_ETHADDR: 5370 case PCI_IVAR_SUBVENDOR: 5371 case PCI_IVAR_SUBDEVICE: 5372 case PCI_IVAR_VENDOR: 5373 case PCI_IVAR_DEVICE: 5374 case PCI_IVAR_DEVID: 5375 case PCI_IVAR_CLASS: 5376 case PCI_IVAR_SUBCLASS: 5377 case PCI_IVAR_PROGIF: 5378 case PCI_IVAR_REVID: 5379 case PCI_IVAR_IRQ: 5380 case PCI_IVAR_DOMAIN: 5381 case PCI_IVAR_BUS: 5382 case PCI_IVAR_SLOT: 5383 case PCI_IVAR_FUNCTION: 5384 return (EINVAL); /* disallow for now */ 5385 5386 default: 5387 return (ENOENT); 5388 } 5389 } 5390 5391 #include "opt_ddb.h" 5392 #ifdef DDB 5393 #include <ddb/ddb.h> 5394 #include <sys/cons.h> 5395 5396 /* 5397 * List resources based on pci map registers, used for within ddb 5398 */ 5399 5400 DB_SHOW_COMMAND_FLAGS(pciregs, db_pci_dump, DB_CMD_MEMSAFE) 5401 { 5402 struct pci_devinfo *dinfo; 5403 struct devlist *devlist_head; 5404 struct pci_conf *p; 5405 const char *name; 5406 int i, error, none_count; 5407 5408 none_count = 0; 5409 /* get the head of the device queue */ 5410 devlist_head = &pci_devq; 5411 5412 /* 5413 * Go through the list of devices and print out devices 5414 */ 5415 for (error = 0, i = 0, 5416 dinfo = STAILQ_FIRST(devlist_head); 5417 (dinfo != NULL) && (error == 0) && (i < pci_numdevs) && !db_pager_quit; 5418 dinfo = STAILQ_NEXT(dinfo, pci_links), i++) { 5419 /* Populate pd_name and pd_unit */ 5420 name = NULL; 5421 if (dinfo->cfg.dev) 5422 name = device_get_name(dinfo->cfg.dev); 5423 5424 p = &dinfo->conf; 5425 db_printf("%s%d@pci%d:%d:%d:%d:\tclass=0x%06x card=0x%08x " 5426 "chip=0x%08x rev=0x%02x hdr=0x%02x\n", 5427 (name && *name) ? name : "none", 5428 (name && *name) ? (int)device_get_unit(dinfo->cfg.dev) : 5429 none_count++, 5430 p->pc_sel.pc_domain, p->pc_sel.pc_bus, p->pc_sel.pc_dev, 5431 p->pc_sel.pc_func, (p->pc_class << 16) | 5432 (p->pc_subclass << 8) | p->pc_progif, 5433 (p->pc_subdevice << 16) | p->pc_subvendor, 5434 (p->pc_device << 16) | p->pc_vendor, 5435 p->pc_revid, p->pc_hdr); 5436 } 5437 } 5438 #endif /* DDB */ 5439 5440 struct resource * 5441 pci_reserve_map(device_t dev, device_t child, int type, int *rid, 5442 rman_res_t start, rman_res_t end, rman_res_t count, u_int num, 5443 u_int flags) 5444 { 5445 struct pci_devinfo *dinfo = device_get_ivars(child); 5446 struct resource_list *rl = &dinfo->resources; 5447 struct resource *res; 5448 struct pci_map *pm; 5449 uint16_t cmd; 5450 pci_addr_t map, testval; 5451 int mapsize; 5452 5453 res = NULL; 5454 5455 /* If rid is managed by EA, ignore it */ 5456 if (pci_ea_is_enabled(child, *rid)) 5457 goto out; 5458 5459 pm = pci_find_bar(child, *rid); 5460 if (pm != NULL) { 5461 /* This is a BAR that we failed to allocate earlier. */ 5462 mapsize = pm->pm_size; 5463 map = pm->pm_value; 5464 } else { 5465 /* 5466 * Weed out the bogons, and figure out how large the 5467 * BAR/map is. BARs that read back 0 here are bogus 5468 * and unimplemented. Note: atapci in legacy mode are 5469 * special and handled elsewhere in the code. If you 5470 * have a atapci device in legacy mode and it fails 5471 * here, that other code is broken. 5472 */ 5473 pci_read_bar(child, *rid, &map, &testval, NULL); 5474 5475 /* 5476 * Determine the size of the BAR and ignore BARs with a size 5477 * of 0. Device ROM BARs use a different mask value. 5478 */ 5479 if (PCIR_IS_BIOS(&dinfo->cfg, *rid)) 5480 mapsize = pci_romsize(testval); 5481 else 5482 mapsize = pci_mapsize(testval); 5483 if (mapsize == 0) 5484 goto out; 5485 pm = pci_add_bar(child, *rid, map, mapsize); 5486 } 5487 5488 if (PCI_BAR_MEM(map) || PCIR_IS_BIOS(&dinfo->cfg, *rid)) { 5489 if (type != SYS_RES_MEMORY) { 5490 if (bootverbose) 5491 device_printf(dev, 5492 "child %s requested type %d for rid %#x," 5493 " but the BAR says it is an memio\n", 5494 device_get_nameunit(child), type, *rid); 5495 goto out; 5496 } 5497 } else { 5498 if (type != SYS_RES_IOPORT) { 5499 if (bootverbose) 5500 device_printf(dev, 5501 "child %s requested type %d for rid %#x," 5502 " but the BAR says it is an ioport\n", 5503 device_get_nameunit(child), type, *rid); 5504 goto out; 5505 } 5506 } 5507 5508 /* 5509 * For real BARs, we need to override the size that 5510 * the driver requests, because that's what the BAR 5511 * actually uses and we would otherwise have a 5512 * situation where we might allocate the excess to 5513 * another driver, which won't work. 5514 */ 5515 count = ((pci_addr_t)1 << mapsize) * num; 5516 if (RF_ALIGNMENT(flags) < mapsize) 5517 flags = (flags & ~RF_ALIGNMENT_MASK) | RF_ALIGNMENT_LOG2(mapsize); 5518 if (PCI_BAR_MEM(map) && (map & PCIM_BAR_MEM_PREFETCH)) 5519 flags |= RF_PREFETCHABLE; 5520 5521 /* 5522 * Allocate enough resource, and then write back the 5523 * appropriate BAR for that resource. 5524 */ 5525 resource_list_add(rl, type, *rid, start, end, count); 5526 res = resource_list_reserve(rl, dev, child, type, rid, start, end, 5527 count, flags & ~RF_ACTIVE); 5528 if (res == NULL) { 5529 resource_list_delete(rl, type, *rid); 5530 device_printf(child, 5531 "%#jx bytes of rid %#x res %d failed (%#jx, %#jx).\n", 5532 count, *rid, type, start, end); 5533 goto out; 5534 } 5535 if (bootverbose) 5536 device_printf(child, 5537 "Lazy allocation of %#jx bytes rid %#x type %d at %#jx\n", 5538 count, *rid, type, rman_get_start(res)); 5539 5540 /* Disable decoding via the CMD register before updating the BAR */ 5541 cmd = pci_read_config(child, PCIR_COMMAND, 2); 5542 pci_write_config(child, PCIR_COMMAND, 5543 cmd & ~(PCI_BAR_MEM(map) ? PCIM_CMD_MEMEN : PCIM_CMD_PORTEN), 2); 5544 5545 map = rman_get_start(res); 5546 pci_write_bar(child, pm, map); 5547 5548 /* Restore the original value of the CMD register */ 5549 pci_write_config(child, PCIR_COMMAND, cmd, 2); 5550 out: 5551 return (res); 5552 } 5553 5554 struct resource * 5555 pci_alloc_multi_resource(device_t dev, device_t child, int type, int *rid, 5556 rman_res_t start, rman_res_t end, rman_res_t count, u_long num, 5557 u_int flags) 5558 { 5559 struct pci_devinfo *dinfo; 5560 struct resource_list *rl; 5561 struct resource_list_entry *rle; 5562 struct resource *res; 5563 pcicfgregs *cfg; 5564 5565 /* 5566 * Perform lazy resource allocation 5567 */ 5568 dinfo = device_get_ivars(child); 5569 rl = &dinfo->resources; 5570 cfg = &dinfo->cfg; 5571 switch (type) { 5572 #if defined(NEW_PCIB) && defined(PCI_RES_BUS) 5573 case PCI_RES_BUS: 5574 return (pci_alloc_secbus(dev, child, rid, start, end, count, 5575 flags)); 5576 #endif 5577 case SYS_RES_IRQ: 5578 /* 5579 * Can't alloc legacy interrupt once MSI messages have 5580 * been allocated. 5581 */ 5582 if (*rid == 0 && (cfg->msi.msi_alloc > 0 || 5583 cfg->msix.msix_alloc > 0)) 5584 return (NULL); 5585 5586 /* 5587 * If the child device doesn't have an interrupt 5588 * routed and is deserving of an interrupt, try to 5589 * assign it one. 5590 */ 5591 if (*rid == 0 && !PCI_INTERRUPT_VALID(cfg->intline) && 5592 (cfg->intpin != 0)) 5593 pci_assign_interrupt(dev, child, 0); 5594 break; 5595 case SYS_RES_IOPORT: 5596 case SYS_RES_MEMORY: 5597 #ifdef NEW_PCIB 5598 /* 5599 * PCI-PCI bridge I/O window resources are not BARs. 5600 * For those allocations just pass the request up the 5601 * tree. 5602 */ 5603 if (cfg->hdrtype == PCIM_HDRTYPE_BRIDGE) { 5604 switch (*rid) { 5605 case PCIR_IOBASEL_1: 5606 case PCIR_MEMBASE_1: 5607 case PCIR_PMBASEL_1: 5608 /* 5609 * XXX: Should we bother creating a resource 5610 * list entry? 5611 */ 5612 return (bus_generic_alloc_resource(dev, child, 5613 type, rid, start, end, count, flags)); 5614 } 5615 } 5616 #endif 5617 /* Reserve resources for this BAR if needed. */ 5618 rle = resource_list_find(rl, type, *rid); 5619 if (rle == NULL) { 5620 res = pci_reserve_map(dev, child, type, rid, start, end, 5621 count, num, flags); 5622 if (res == NULL) 5623 return (NULL); 5624 } 5625 } 5626 return (resource_list_alloc(rl, dev, child, type, rid, 5627 start, end, count, flags)); 5628 } 5629 5630 struct resource * 5631 pci_alloc_resource(device_t dev, device_t child, int type, int *rid, 5632 rman_res_t start, rman_res_t end, rman_res_t count, u_int flags) 5633 { 5634 #ifdef PCI_IOV 5635 struct pci_devinfo *dinfo; 5636 #endif 5637 5638 if (device_get_parent(child) != dev) 5639 return (BUS_ALLOC_RESOURCE(device_get_parent(dev), child, 5640 type, rid, start, end, count, flags)); 5641 5642 #ifdef PCI_IOV 5643 dinfo = device_get_ivars(child); 5644 if (dinfo->cfg.flags & PCICFG_VF) { 5645 switch (type) { 5646 /* VFs can't have I/O BARs. */ 5647 case SYS_RES_IOPORT: 5648 return (NULL); 5649 case SYS_RES_MEMORY: 5650 return (pci_vf_alloc_mem_resource(dev, child, rid, 5651 start, end, count, flags)); 5652 } 5653 5654 /* Fall through for other types of resource allocations. */ 5655 } 5656 #endif 5657 5658 return (pci_alloc_multi_resource(dev, child, type, rid, start, end, 5659 count, 1, flags)); 5660 } 5661 5662 int 5663 pci_release_resource(device_t dev, device_t child, int type, int rid, 5664 struct resource *r) 5665 { 5666 struct pci_devinfo *dinfo; 5667 struct resource_list *rl; 5668 pcicfgregs *cfg __unused; 5669 5670 if (device_get_parent(child) != dev) 5671 return (BUS_RELEASE_RESOURCE(device_get_parent(dev), child, 5672 type, rid, r)); 5673 5674 dinfo = device_get_ivars(child); 5675 cfg = &dinfo->cfg; 5676 5677 #ifdef PCI_IOV 5678 if (cfg->flags & PCICFG_VF) { 5679 switch (type) { 5680 /* VFs can't have I/O BARs. */ 5681 case SYS_RES_IOPORT: 5682 return (EDOOFUS); 5683 case SYS_RES_MEMORY: 5684 return (pci_vf_release_mem_resource(dev, child, rid, 5685 r)); 5686 } 5687 5688 /* Fall through for other types of resource allocations. */ 5689 } 5690 #endif 5691 5692 #ifdef NEW_PCIB 5693 /* 5694 * PCI-PCI bridge I/O window resources are not BARs. For 5695 * those allocations just pass the request up the tree. 5696 */ 5697 if (cfg->hdrtype == PCIM_HDRTYPE_BRIDGE && 5698 (type == SYS_RES_IOPORT || type == SYS_RES_MEMORY)) { 5699 switch (rid) { 5700 case PCIR_IOBASEL_1: 5701 case PCIR_MEMBASE_1: 5702 case PCIR_PMBASEL_1: 5703 return (bus_generic_release_resource(dev, child, type, 5704 rid, r)); 5705 } 5706 } 5707 #endif 5708 5709 rl = &dinfo->resources; 5710 return (resource_list_release(rl, dev, child, type, rid, r)); 5711 } 5712 5713 int 5714 pci_activate_resource(device_t dev, device_t child, int type, int rid, 5715 struct resource *r) 5716 { 5717 struct pci_devinfo *dinfo; 5718 int error; 5719 5720 error = bus_generic_activate_resource(dev, child, type, rid, r); 5721 if (error) 5722 return (error); 5723 5724 /* Enable decoding in the command register when activating BARs. */ 5725 if (device_get_parent(child) == dev) { 5726 /* Device ROMs need their decoding explicitly enabled. */ 5727 dinfo = device_get_ivars(child); 5728 if (type == SYS_RES_MEMORY && PCIR_IS_BIOS(&dinfo->cfg, rid)) 5729 pci_write_bar(child, pci_find_bar(child, rid), 5730 rman_get_start(r) | PCIM_BIOS_ENABLE); 5731 switch (type) { 5732 case SYS_RES_IOPORT: 5733 case SYS_RES_MEMORY: 5734 error = PCI_ENABLE_IO(dev, child, type); 5735 break; 5736 } 5737 } 5738 return (error); 5739 } 5740 5741 int 5742 pci_deactivate_resource(device_t dev, device_t child, int type, 5743 int rid, struct resource *r) 5744 { 5745 struct pci_devinfo *dinfo; 5746 int error; 5747 5748 error = bus_generic_deactivate_resource(dev, child, type, rid, r); 5749 if (error) 5750 return (error); 5751 5752 /* Disable decoding for device ROMs. */ 5753 if (device_get_parent(child) == dev) { 5754 dinfo = device_get_ivars(child); 5755 if (type == SYS_RES_MEMORY && PCIR_IS_BIOS(&dinfo->cfg, rid)) 5756 pci_write_bar(child, pci_find_bar(child, rid), 5757 rman_get_start(r)); 5758 } 5759 return (0); 5760 } 5761 5762 void 5763 pci_child_deleted(device_t dev, device_t child) 5764 { 5765 struct resource_list_entry *rle; 5766 struct resource_list *rl; 5767 struct pci_devinfo *dinfo; 5768 5769 dinfo = device_get_ivars(child); 5770 rl = &dinfo->resources; 5771 5772 EVENTHANDLER_INVOKE(pci_delete_device, child); 5773 5774 /* Turn off access to resources we're about to free */ 5775 if (bus_child_present(child) != 0) { 5776 pci_write_config(child, PCIR_COMMAND, pci_read_config(child, 5777 PCIR_COMMAND, 2) & ~(PCIM_CMD_MEMEN | PCIM_CMD_PORTEN), 2); 5778 5779 pci_disable_busmaster(child); 5780 } 5781 5782 /* Free all allocated resources */ 5783 STAILQ_FOREACH(rle, rl, link) { 5784 if (rle->res) { 5785 if (rman_get_flags(rle->res) & RF_ACTIVE || 5786 resource_list_busy(rl, rle->type, rle->rid)) { 5787 pci_printf(&dinfo->cfg, 5788 "Resource still owned, oops. " 5789 "(type=%d, rid=%d, addr=%lx)\n", 5790 rle->type, rle->rid, 5791 rman_get_start(rle->res)); 5792 bus_release_resource(child, rle->type, rle->rid, 5793 rle->res); 5794 } 5795 resource_list_unreserve(rl, dev, child, rle->type, 5796 rle->rid); 5797 } 5798 } 5799 resource_list_free(rl); 5800 5801 pci_freecfg(dinfo); 5802 } 5803 5804 void 5805 pci_delete_resource(device_t dev, device_t child, int type, int rid) 5806 { 5807 struct pci_devinfo *dinfo; 5808 struct resource_list *rl; 5809 struct resource_list_entry *rle; 5810 5811 if (device_get_parent(child) != dev) 5812 return; 5813 5814 dinfo = device_get_ivars(child); 5815 rl = &dinfo->resources; 5816 rle = resource_list_find(rl, type, rid); 5817 if (rle == NULL) 5818 return; 5819 5820 if (rle->res) { 5821 if (rman_get_flags(rle->res) & RF_ACTIVE || 5822 resource_list_busy(rl, type, rid)) { 5823 device_printf(dev, "delete_resource: " 5824 "Resource still owned by child, oops. " 5825 "(type=%d, rid=%d, addr=%jx)\n", 5826 type, rid, rman_get_start(rle->res)); 5827 return; 5828 } 5829 resource_list_unreserve(rl, dev, child, type, rid); 5830 } 5831 resource_list_delete(rl, type, rid); 5832 } 5833 5834 struct resource_list * 5835 pci_get_resource_list (device_t dev, device_t child) 5836 { 5837 struct pci_devinfo *dinfo = device_get_ivars(child); 5838 5839 return (&dinfo->resources); 5840 } 5841 5842 #ifdef IOMMU 5843 bus_dma_tag_t 5844 pci_get_dma_tag(device_t bus, device_t dev) 5845 { 5846 bus_dma_tag_t tag; 5847 struct pci_softc *sc; 5848 5849 if (device_get_parent(dev) == bus) { 5850 /* try iommu and return if it works */ 5851 tag = iommu_get_dma_tag(bus, dev); 5852 } else 5853 tag = NULL; 5854 if (tag == NULL) { 5855 sc = device_get_softc(bus); 5856 tag = sc->sc_dma_tag; 5857 } 5858 return (tag); 5859 } 5860 #else 5861 bus_dma_tag_t 5862 pci_get_dma_tag(device_t bus, device_t dev) 5863 { 5864 struct pci_softc *sc = device_get_softc(bus); 5865 5866 return (sc->sc_dma_tag); 5867 } 5868 #endif 5869 5870 uint32_t 5871 pci_read_config_method(device_t dev, device_t child, int reg, int width) 5872 { 5873 struct pci_devinfo *dinfo = device_get_ivars(child); 5874 pcicfgregs *cfg = &dinfo->cfg; 5875 5876 #ifdef PCI_IOV 5877 /* 5878 * SR-IOV VFs don't implement the VID or DID registers, so we have to 5879 * emulate them here. 5880 */ 5881 if (cfg->flags & PCICFG_VF) { 5882 if (reg == PCIR_VENDOR) { 5883 switch (width) { 5884 case 4: 5885 return (cfg->device << 16 | cfg->vendor); 5886 case 2: 5887 return (cfg->vendor); 5888 case 1: 5889 return (cfg->vendor & 0xff); 5890 default: 5891 return (0xffffffff); 5892 } 5893 } else if (reg == PCIR_DEVICE) { 5894 switch (width) { 5895 /* Note that an unaligned 4-byte read is an error. */ 5896 case 2: 5897 return (cfg->device); 5898 case 1: 5899 return (cfg->device & 0xff); 5900 default: 5901 return (0xffffffff); 5902 } 5903 } 5904 } 5905 #endif 5906 5907 return (PCIB_READ_CONFIG(device_get_parent(dev), 5908 cfg->bus, cfg->slot, cfg->func, reg, width)); 5909 } 5910 5911 void 5912 pci_write_config_method(device_t dev, device_t child, int reg, 5913 uint32_t val, int width) 5914 { 5915 struct pci_devinfo *dinfo = device_get_ivars(child); 5916 pcicfgregs *cfg = &dinfo->cfg; 5917 5918 PCIB_WRITE_CONFIG(device_get_parent(dev), 5919 cfg->bus, cfg->slot, cfg->func, reg, val, width); 5920 } 5921 5922 int 5923 pci_child_location_method(device_t dev, device_t child, struct sbuf *sb) 5924 { 5925 5926 sbuf_printf(sb, "slot=%d function=%d dbsf=pci%d:%d:%d:%d", 5927 pci_get_slot(child), pci_get_function(child), pci_get_domain(child), 5928 pci_get_bus(child), pci_get_slot(child), pci_get_function(child)); 5929 return (0); 5930 } 5931 5932 int 5933 pci_child_pnpinfo_method(device_t dev, device_t child, struct sbuf *sb) 5934 { 5935 struct pci_devinfo *dinfo; 5936 pcicfgregs *cfg; 5937 5938 dinfo = device_get_ivars(child); 5939 cfg = &dinfo->cfg; 5940 sbuf_printf(sb, "vendor=0x%04x device=0x%04x subvendor=0x%04x " 5941 "subdevice=0x%04x class=0x%02x%02x%02x", cfg->vendor, cfg->device, 5942 cfg->subvendor, cfg->subdevice, cfg->baseclass, cfg->subclass, 5943 cfg->progif); 5944 return (0); 5945 } 5946 5947 int 5948 pci_get_device_path_method(device_t bus, device_t child, const char *locator, 5949 struct sbuf *sb) 5950 { 5951 device_t parent = device_get_parent(bus); 5952 int rv; 5953 5954 if (strcmp(locator, BUS_LOCATOR_UEFI) == 0) { 5955 rv = bus_generic_get_device_path(parent, bus, locator, sb); 5956 if (rv == 0) { 5957 sbuf_printf(sb, "/Pci(0x%x,0x%x)", pci_get_slot(child), 5958 pci_get_function(child)); 5959 } 5960 return (0); 5961 } 5962 return (bus_generic_get_device_path(bus, child, locator, sb)); 5963 } 5964 5965 int 5966 pci_assign_interrupt_method(device_t dev, device_t child) 5967 { 5968 struct pci_devinfo *dinfo = device_get_ivars(child); 5969 pcicfgregs *cfg = &dinfo->cfg; 5970 5971 return (PCIB_ROUTE_INTERRUPT(device_get_parent(dev), child, 5972 cfg->intpin)); 5973 } 5974 5975 static void 5976 pci_lookup(void *arg, const char *name, device_t *dev) 5977 { 5978 long val; 5979 char *end; 5980 int domain, bus, slot, func; 5981 5982 if (*dev != NULL) 5983 return; 5984 5985 /* 5986 * Accept pciconf-style selectors of either pciD:B:S:F or 5987 * pciB:S:F. In the latter case, the domain is assumed to 5988 * be zero. 5989 */ 5990 if (strncmp(name, "pci", 3) != 0) 5991 return; 5992 val = strtol(name + 3, &end, 10); 5993 if (val < 0 || val > INT_MAX || *end != ':') 5994 return; 5995 domain = val; 5996 val = strtol(end + 1, &end, 10); 5997 if (val < 0 || val > INT_MAX || *end != ':') 5998 return; 5999 bus = val; 6000 val = strtol(end + 1, &end, 10); 6001 if (val < 0 || val > INT_MAX) 6002 return; 6003 slot = val; 6004 if (*end == ':') { 6005 val = strtol(end + 1, &end, 10); 6006 if (val < 0 || val > INT_MAX || *end != '\0') 6007 return; 6008 func = val; 6009 } else if (*end == '\0') { 6010 func = slot; 6011 slot = bus; 6012 bus = domain; 6013 domain = 0; 6014 } else 6015 return; 6016 6017 if (domain > PCI_DOMAINMAX || bus > PCI_BUSMAX || slot > PCI_SLOTMAX || 6018 func > PCIE_ARI_FUNCMAX || (slot != 0 && func > PCI_FUNCMAX)) 6019 return; 6020 6021 *dev = pci_find_dbsf(domain, bus, slot, func); 6022 } 6023 6024 static int 6025 pci_modevent(module_t mod, int what, void *arg) 6026 { 6027 static struct cdev *pci_cdev; 6028 static eventhandler_tag tag; 6029 6030 switch (what) { 6031 case MOD_LOAD: 6032 STAILQ_INIT(&pci_devq); 6033 pci_generation = 0; 6034 pci_cdev = make_dev(&pcicdev, 0, UID_ROOT, GID_WHEEL, 0644, 6035 "pci"); 6036 pci_load_vendor_data(); 6037 tag = EVENTHANDLER_REGISTER(dev_lookup, pci_lookup, NULL, 6038 1000); 6039 break; 6040 6041 case MOD_UNLOAD: 6042 if (tag != NULL) 6043 EVENTHANDLER_DEREGISTER(dev_lookup, tag); 6044 destroy_dev(pci_cdev); 6045 break; 6046 } 6047 6048 return (0); 6049 } 6050 6051 static void 6052 pci_cfg_restore_pcie(device_t dev, struct pci_devinfo *dinfo) 6053 { 6054 #define WREG(n, v) pci_write_config(dev, pos + (n), (v), 2) 6055 struct pcicfg_pcie *cfg; 6056 int version, pos; 6057 6058 cfg = &dinfo->cfg.pcie; 6059 pos = cfg->pcie_location; 6060 6061 version = cfg->pcie_flags & PCIEM_FLAGS_VERSION; 6062 6063 WREG(PCIER_DEVICE_CTL, cfg->pcie_device_ctl); 6064 6065 if (version > 1 || cfg->pcie_type == PCIEM_TYPE_ROOT_PORT || 6066 cfg->pcie_type == PCIEM_TYPE_ENDPOINT || 6067 cfg->pcie_type == PCIEM_TYPE_LEGACY_ENDPOINT) 6068 WREG(PCIER_LINK_CTL, cfg->pcie_link_ctl); 6069 6070 if (version > 1 || (cfg->pcie_type == PCIEM_TYPE_ROOT_PORT || 6071 (cfg->pcie_type == PCIEM_TYPE_DOWNSTREAM_PORT && 6072 (cfg->pcie_flags & PCIEM_FLAGS_SLOT)))) 6073 WREG(PCIER_SLOT_CTL, cfg->pcie_slot_ctl); 6074 6075 if (version > 1 || cfg->pcie_type == PCIEM_TYPE_ROOT_PORT || 6076 cfg->pcie_type == PCIEM_TYPE_ROOT_EC) 6077 WREG(PCIER_ROOT_CTL, cfg->pcie_root_ctl); 6078 6079 if (version > 1) { 6080 WREG(PCIER_DEVICE_CTL2, cfg->pcie_device_ctl2); 6081 WREG(PCIER_LINK_CTL2, cfg->pcie_link_ctl2); 6082 WREG(PCIER_SLOT_CTL2, cfg->pcie_slot_ctl2); 6083 } 6084 #undef WREG 6085 } 6086 6087 static void 6088 pci_cfg_restore_pcix(device_t dev, struct pci_devinfo *dinfo) 6089 { 6090 pci_write_config(dev, dinfo->cfg.pcix.pcix_location + PCIXR_COMMAND, 6091 dinfo->cfg.pcix.pcix_command, 2); 6092 } 6093 6094 void 6095 pci_cfg_restore(device_t dev, struct pci_devinfo *dinfo) 6096 { 6097 6098 /* 6099 * Restore the device to full power mode. We must do this 6100 * before we restore the registers because moving from D3 to 6101 * D0 will cause the chip's BARs and some other registers to 6102 * be reset to some unknown power on reset values. Cut down 6103 * the noise on boot by doing nothing if we are already in 6104 * state D0. 6105 */ 6106 if (pci_get_powerstate(dev) != PCI_POWERSTATE_D0) 6107 pci_set_powerstate(dev, PCI_POWERSTATE_D0); 6108 pci_write_config(dev, PCIR_INTLINE, dinfo->cfg.intline, 1); 6109 pci_write_config(dev, PCIR_INTPIN, dinfo->cfg.intpin, 1); 6110 pci_write_config(dev, PCIR_CACHELNSZ, dinfo->cfg.cachelnsz, 1); 6111 pci_write_config(dev, PCIR_LATTIMER, dinfo->cfg.lattimer, 1); 6112 pci_write_config(dev, PCIR_PROGIF, dinfo->cfg.progif, 1); 6113 pci_write_config(dev, PCIR_REVID, dinfo->cfg.revid, 1); 6114 switch (dinfo->cfg.hdrtype & PCIM_HDRTYPE) { 6115 case PCIM_HDRTYPE_NORMAL: 6116 pci_write_config(dev, PCIR_MINGNT, dinfo->cfg.mingnt, 1); 6117 pci_write_config(dev, PCIR_MAXLAT, dinfo->cfg.maxlat, 1); 6118 break; 6119 case PCIM_HDRTYPE_BRIDGE: 6120 pci_write_config(dev, PCIR_SECLAT_1, 6121 dinfo->cfg.bridge.br_seclat, 1); 6122 pci_write_config(dev, PCIR_SUBBUS_1, 6123 dinfo->cfg.bridge.br_subbus, 1); 6124 pci_write_config(dev, PCIR_SECBUS_1, 6125 dinfo->cfg.bridge.br_secbus, 1); 6126 pci_write_config(dev, PCIR_PRIBUS_1, 6127 dinfo->cfg.bridge.br_pribus, 1); 6128 pci_write_config(dev, PCIR_BRIDGECTL_1, 6129 dinfo->cfg.bridge.br_control, 2); 6130 break; 6131 case PCIM_HDRTYPE_CARDBUS: 6132 pci_write_config(dev, PCIR_SECLAT_2, 6133 dinfo->cfg.bridge.br_seclat, 1); 6134 pci_write_config(dev, PCIR_SUBBUS_2, 6135 dinfo->cfg.bridge.br_subbus, 1); 6136 pci_write_config(dev, PCIR_SECBUS_2, 6137 dinfo->cfg.bridge.br_secbus, 1); 6138 pci_write_config(dev, PCIR_PRIBUS_2, 6139 dinfo->cfg.bridge.br_pribus, 1); 6140 pci_write_config(dev, PCIR_BRIDGECTL_2, 6141 dinfo->cfg.bridge.br_control, 2); 6142 break; 6143 } 6144 pci_restore_bars(dev); 6145 6146 if ((dinfo->cfg.hdrtype & PCIM_HDRTYPE) != PCIM_HDRTYPE_BRIDGE) 6147 pci_write_config(dev, PCIR_COMMAND, dinfo->cfg.cmdreg, 2); 6148 6149 /* 6150 * Restore extended capabilities for PCI-Express and PCI-X 6151 */ 6152 if (dinfo->cfg.pcie.pcie_location != 0) 6153 pci_cfg_restore_pcie(dev, dinfo); 6154 if (dinfo->cfg.pcix.pcix_location != 0) 6155 pci_cfg_restore_pcix(dev, dinfo); 6156 6157 /* Restore MSI and MSI-X configurations if they are present. */ 6158 if (dinfo->cfg.msi.msi_location != 0) 6159 pci_resume_msi(dev); 6160 if (dinfo->cfg.msix.msix_location != 0) 6161 pci_resume_msix(dev); 6162 6163 #ifdef PCI_IOV 6164 if (dinfo->cfg.iov != NULL) 6165 pci_iov_cfg_restore(dev, dinfo); 6166 #endif 6167 } 6168 6169 static void 6170 pci_cfg_save_pcie(device_t dev, struct pci_devinfo *dinfo) 6171 { 6172 #define RREG(n) pci_read_config(dev, pos + (n), 2) 6173 struct pcicfg_pcie *cfg; 6174 int version, pos; 6175 6176 cfg = &dinfo->cfg.pcie; 6177 pos = cfg->pcie_location; 6178 6179 cfg->pcie_flags = RREG(PCIER_FLAGS); 6180 6181 version = cfg->pcie_flags & PCIEM_FLAGS_VERSION; 6182 6183 cfg->pcie_device_ctl = RREG(PCIER_DEVICE_CTL); 6184 6185 if (version > 1 || cfg->pcie_type == PCIEM_TYPE_ROOT_PORT || 6186 cfg->pcie_type == PCIEM_TYPE_ENDPOINT || 6187 cfg->pcie_type == PCIEM_TYPE_LEGACY_ENDPOINT) 6188 cfg->pcie_link_ctl = RREG(PCIER_LINK_CTL); 6189 6190 if (version > 1 || (cfg->pcie_type == PCIEM_TYPE_ROOT_PORT || 6191 (cfg->pcie_type == PCIEM_TYPE_DOWNSTREAM_PORT && 6192 (cfg->pcie_flags & PCIEM_FLAGS_SLOT)))) 6193 cfg->pcie_slot_ctl = RREG(PCIER_SLOT_CTL); 6194 6195 if (version > 1 || cfg->pcie_type == PCIEM_TYPE_ROOT_PORT || 6196 cfg->pcie_type == PCIEM_TYPE_ROOT_EC) 6197 cfg->pcie_root_ctl = RREG(PCIER_ROOT_CTL); 6198 6199 if (version > 1) { 6200 cfg->pcie_device_ctl2 = RREG(PCIER_DEVICE_CTL2); 6201 cfg->pcie_link_ctl2 = RREG(PCIER_LINK_CTL2); 6202 cfg->pcie_slot_ctl2 = RREG(PCIER_SLOT_CTL2); 6203 } 6204 #undef RREG 6205 } 6206 6207 static void 6208 pci_cfg_save_pcix(device_t dev, struct pci_devinfo *dinfo) 6209 { 6210 dinfo->cfg.pcix.pcix_command = pci_read_config(dev, 6211 dinfo->cfg.pcix.pcix_location + PCIXR_COMMAND, 2); 6212 } 6213 6214 void 6215 pci_cfg_save(device_t dev, struct pci_devinfo *dinfo, int setstate) 6216 { 6217 uint32_t cls; 6218 int ps; 6219 6220 /* 6221 * Some drivers apparently write to these registers w/o updating our 6222 * cached copy. No harm happens if we update the copy, so do so here 6223 * so we can restore them. The COMMAND register is modified by the 6224 * bus w/o updating the cache. This should represent the normally 6225 * writable portion of the 'defined' part of type 0/1/2 headers. 6226 */ 6227 dinfo->cfg.vendor = pci_read_config(dev, PCIR_VENDOR, 2); 6228 dinfo->cfg.device = pci_read_config(dev, PCIR_DEVICE, 2); 6229 dinfo->cfg.cmdreg = pci_read_config(dev, PCIR_COMMAND, 2); 6230 dinfo->cfg.intline = pci_read_config(dev, PCIR_INTLINE, 1); 6231 dinfo->cfg.intpin = pci_read_config(dev, PCIR_INTPIN, 1); 6232 dinfo->cfg.cachelnsz = pci_read_config(dev, PCIR_CACHELNSZ, 1); 6233 dinfo->cfg.lattimer = pci_read_config(dev, PCIR_LATTIMER, 1); 6234 dinfo->cfg.baseclass = pci_read_config(dev, PCIR_CLASS, 1); 6235 dinfo->cfg.subclass = pci_read_config(dev, PCIR_SUBCLASS, 1); 6236 dinfo->cfg.progif = pci_read_config(dev, PCIR_PROGIF, 1); 6237 dinfo->cfg.revid = pci_read_config(dev, PCIR_REVID, 1); 6238 switch (dinfo->cfg.hdrtype & PCIM_HDRTYPE) { 6239 case PCIM_HDRTYPE_NORMAL: 6240 dinfo->cfg.subvendor = pci_read_config(dev, PCIR_SUBVEND_0, 2); 6241 dinfo->cfg.subdevice = pci_read_config(dev, PCIR_SUBDEV_0, 2); 6242 dinfo->cfg.mingnt = pci_read_config(dev, PCIR_MINGNT, 1); 6243 dinfo->cfg.maxlat = pci_read_config(dev, PCIR_MAXLAT, 1); 6244 break; 6245 case PCIM_HDRTYPE_BRIDGE: 6246 dinfo->cfg.bridge.br_seclat = pci_read_config(dev, 6247 PCIR_SECLAT_1, 1); 6248 dinfo->cfg.bridge.br_subbus = pci_read_config(dev, 6249 PCIR_SUBBUS_1, 1); 6250 dinfo->cfg.bridge.br_secbus = pci_read_config(dev, 6251 PCIR_SECBUS_1, 1); 6252 dinfo->cfg.bridge.br_pribus = pci_read_config(dev, 6253 PCIR_PRIBUS_1, 1); 6254 dinfo->cfg.bridge.br_control = pci_read_config(dev, 6255 PCIR_BRIDGECTL_1, 2); 6256 break; 6257 case PCIM_HDRTYPE_CARDBUS: 6258 dinfo->cfg.bridge.br_seclat = pci_read_config(dev, 6259 PCIR_SECLAT_2, 1); 6260 dinfo->cfg.bridge.br_subbus = pci_read_config(dev, 6261 PCIR_SUBBUS_2, 1); 6262 dinfo->cfg.bridge.br_secbus = pci_read_config(dev, 6263 PCIR_SECBUS_2, 1); 6264 dinfo->cfg.bridge.br_pribus = pci_read_config(dev, 6265 PCIR_PRIBUS_2, 1); 6266 dinfo->cfg.bridge.br_control = pci_read_config(dev, 6267 PCIR_BRIDGECTL_2, 2); 6268 dinfo->cfg.subvendor = pci_read_config(dev, PCIR_SUBVEND_2, 2); 6269 dinfo->cfg.subdevice = pci_read_config(dev, PCIR_SUBDEV_2, 2); 6270 break; 6271 } 6272 6273 if (dinfo->cfg.pcie.pcie_location != 0) 6274 pci_cfg_save_pcie(dev, dinfo); 6275 6276 if (dinfo->cfg.pcix.pcix_location != 0) 6277 pci_cfg_save_pcix(dev, dinfo); 6278 6279 #ifdef PCI_IOV 6280 if (dinfo->cfg.iov != NULL) 6281 pci_iov_cfg_save(dev, dinfo); 6282 #endif 6283 6284 /* 6285 * don't set the state for display devices, base peripherals and 6286 * memory devices since bad things happen when they are powered down. 6287 * We should (a) have drivers that can easily detach and (b) use 6288 * generic drivers for these devices so that some device actually 6289 * attaches. We need to make sure that when we implement (a) we don't 6290 * power the device down on a reattach. 6291 */ 6292 cls = pci_get_class(dev); 6293 if (!setstate) 6294 return; 6295 switch (pci_do_power_nodriver) 6296 { 6297 case 0: /* NO powerdown at all */ 6298 return; 6299 case 1: /* Conservative about what to power down */ 6300 if (cls == PCIC_STORAGE) 6301 return; 6302 /*FALLTHROUGH*/ 6303 case 2: /* Aggressive about what to power down */ 6304 if (cls == PCIC_DISPLAY || cls == PCIC_MEMORY || 6305 cls == PCIC_BASEPERIPH) 6306 return; 6307 /*FALLTHROUGH*/ 6308 case 3: /* Power down everything */ 6309 break; 6310 } 6311 /* 6312 * PCI spec says we can only go into D3 state from D0 state. 6313 * Transition from D[12] into D0 before going to D3 state. 6314 */ 6315 ps = pci_get_powerstate(dev); 6316 if (ps != PCI_POWERSTATE_D0 && ps != PCI_POWERSTATE_D3) 6317 pci_set_powerstate(dev, PCI_POWERSTATE_D0); 6318 if (pci_get_powerstate(dev) != PCI_POWERSTATE_D3) 6319 pci_set_powerstate(dev, PCI_POWERSTATE_D3); 6320 } 6321 6322 /* Wrapper APIs suitable for device driver use. */ 6323 void 6324 pci_save_state(device_t dev) 6325 { 6326 struct pci_devinfo *dinfo; 6327 6328 dinfo = device_get_ivars(dev); 6329 pci_cfg_save(dev, dinfo, 0); 6330 } 6331 6332 void 6333 pci_restore_state(device_t dev) 6334 { 6335 struct pci_devinfo *dinfo; 6336 6337 dinfo = device_get_ivars(dev); 6338 pci_cfg_restore(dev, dinfo); 6339 } 6340 6341 static int 6342 pci_get_id_method(device_t dev, device_t child, enum pci_id_type type, 6343 uintptr_t *id) 6344 { 6345 6346 return (PCIB_GET_ID(device_get_parent(dev), child, type, id)); 6347 } 6348 6349 /* Find the upstream port of a given PCI device in a root complex. */ 6350 device_t 6351 pci_find_pcie_root_port(device_t dev) 6352 { 6353 struct pci_devinfo *dinfo; 6354 devclass_t pci_class; 6355 device_t pcib, bus; 6356 6357 pci_class = devclass_find("pci"); 6358 KASSERT(device_get_devclass(device_get_parent(dev)) == pci_class, 6359 ("%s: non-pci device %s", __func__, device_get_nameunit(dev))); 6360 6361 /* 6362 * Walk the bridge hierarchy until we find a PCI-e root 6363 * port or a non-PCI device. 6364 */ 6365 for (;;) { 6366 bus = device_get_parent(dev); 6367 KASSERT(bus != NULL, ("%s: null parent of %s", __func__, 6368 device_get_nameunit(dev))); 6369 6370 pcib = device_get_parent(bus); 6371 KASSERT(pcib != NULL, ("%s: null bridge of %s", __func__, 6372 device_get_nameunit(bus))); 6373 6374 /* 6375 * pcib's parent must be a PCI bus for this to be a 6376 * PCI-PCI bridge. 6377 */ 6378 if (device_get_devclass(device_get_parent(pcib)) != pci_class) 6379 return (NULL); 6380 6381 dinfo = device_get_ivars(pcib); 6382 if (dinfo->cfg.pcie.pcie_location != 0 && 6383 dinfo->cfg.pcie.pcie_type == PCIEM_TYPE_ROOT_PORT) 6384 return (pcib); 6385 6386 dev = pcib; 6387 } 6388 } 6389 6390 /* 6391 * Wait for pending transactions to complete on a PCI-express function. 6392 * 6393 * The maximum delay is specified in milliseconds in max_delay. Note 6394 * that this function may sleep. 6395 * 6396 * Returns true if the function is idle and false if the timeout is 6397 * exceeded. If dev is not a PCI-express function, this returns true. 6398 */ 6399 bool 6400 pcie_wait_for_pending_transactions(device_t dev, u_int max_delay) 6401 { 6402 struct pci_devinfo *dinfo = device_get_ivars(dev); 6403 uint16_t sta; 6404 int cap; 6405 6406 cap = dinfo->cfg.pcie.pcie_location; 6407 if (cap == 0) 6408 return (true); 6409 6410 sta = pci_read_config(dev, cap + PCIER_DEVICE_STA, 2); 6411 while (sta & PCIEM_STA_TRANSACTION_PND) { 6412 if (max_delay == 0) 6413 return (false); 6414 6415 /* Poll once every 100 milliseconds up to the timeout. */ 6416 if (max_delay > 100) { 6417 pause_sbt("pcietp", 100 * SBT_1MS, 0, C_HARDCLOCK); 6418 max_delay -= 100; 6419 } else { 6420 pause_sbt("pcietp", max_delay * SBT_1MS, 0, 6421 C_HARDCLOCK); 6422 max_delay = 0; 6423 } 6424 sta = pci_read_config(dev, cap + PCIER_DEVICE_STA, 2); 6425 } 6426 6427 return (true); 6428 } 6429 6430 /* 6431 * Determine the maximum Completion Timeout in microseconds. 6432 * 6433 * For non-PCI-express functions this returns 0. 6434 */ 6435 int 6436 pcie_get_max_completion_timeout(device_t dev) 6437 { 6438 struct pci_devinfo *dinfo = device_get_ivars(dev); 6439 int cap; 6440 6441 cap = dinfo->cfg.pcie.pcie_location; 6442 if (cap == 0) 6443 return (0); 6444 6445 /* 6446 * Functions using the 1.x spec use the default timeout range of 6447 * 50 microseconds to 50 milliseconds. Functions that do not 6448 * support programmable timeouts also use this range. 6449 */ 6450 if ((dinfo->cfg.pcie.pcie_flags & PCIEM_FLAGS_VERSION) < 2 || 6451 (pci_read_config(dev, cap + PCIER_DEVICE_CAP2, 4) & 6452 PCIEM_CAP2_COMP_TIMO_RANGES) == 0) 6453 return (50 * 1000); 6454 6455 switch (pci_read_config(dev, cap + PCIER_DEVICE_CTL2, 2) & 6456 PCIEM_CTL2_COMP_TIMO_VAL) { 6457 case PCIEM_CTL2_COMP_TIMO_100US: 6458 return (100); 6459 case PCIEM_CTL2_COMP_TIMO_10MS: 6460 return (10 * 1000); 6461 case PCIEM_CTL2_COMP_TIMO_55MS: 6462 return (55 * 1000); 6463 case PCIEM_CTL2_COMP_TIMO_210MS: 6464 return (210 * 1000); 6465 case PCIEM_CTL2_COMP_TIMO_900MS: 6466 return (900 * 1000); 6467 case PCIEM_CTL2_COMP_TIMO_3500MS: 6468 return (3500 * 1000); 6469 case PCIEM_CTL2_COMP_TIMO_13S: 6470 return (13 * 1000 * 1000); 6471 case PCIEM_CTL2_COMP_TIMO_64S: 6472 return (64 * 1000 * 1000); 6473 default: 6474 return (50 * 1000); 6475 } 6476 } 6477 6478 void 6479 pcie_apei_error(device_t dev, int sev, uint8_t *aerp) 6480 { 6481 struct pci_devinfo *dinfo = device_get_ivars(dev); 6482 const char *s; 6483 int aer; 6484 uint32_t r, r1; 6485 uint16_t rs; 6486 6487 if (sev == PCIEM_STA_CORRECTABLE_ERROR) 6488 s = "Correctable"; 6489 else if (sev == PCIEM_STA_NON_FATAL_ERROR) 6490 s = "Uncorrectable (Non-Fatal)"; 6491 else 6492 s = "Uncorrectable (Fatal)"; 6493 device_printf(dev, "%s PCIe error reported by APEI\n", s); 6494 if (aerp) { 6495 if (sev == PCIEM_STA_CORRECTABLE_ERROR) { 6496 r = le32dec(aerp + PCIR_AER_COR_STATUS); 6497 r1 = le32dec(aerp + PCIR_AER_COR_MASK); 6498 } else { 6499 r = le32dec(aerp + PCIR_AER_UC_STATUS); 6500 r1 = le32dec(aerp + PCIR_AER_UC_MASK); 6501 } 6502 device_printf(dev, "status 0x%08x mask 0x%08x", r, r1); 6503 if (sev != PCIEM_STA_CORRECTABLE_ERROR) { 6504 r = le32dec(aerp + PCIR_AER_UC_SEVERITY); 6505 rs = le16dec(aerp + PCIR_AER_CAP_CONTROL); 6506 printf(" severity 0x%08x first %d\n", 6507 r, rs & 0x1f); 6508 } else 6509 printf("\n"); 6510 } 6511 6512 /* As kind of recovery just report and clear the error statuses. */ 6513 if (pci_find_extcap(dev, PCIZ_AER, &aer) == 0) { 6514 r = pci_read_config(dev, aer + PCIR_AER_UC_STATUS, 4); 6515 if (r != 0) { 6516 pci_write_config(dev, aer + PCIR_AER_UC_STATUS, r, 4); 6517 device_printf(dev, "Clearing UC AER errors 0x%08x\n", r); 6518 } 6519 6520 r = pci_read_config(dev, aer + PCIR_AER_COR_STATUS, 4); 6521 if (r != 0) { 6522 pci_write_config(dev, aer + PCIR_AER_COR_STATUS, r, 4); 6523 device_printf(dev, "Clearing COR AER errors 0x%08x\n", r); 6524 } 6525 } 6526 if (dinfo->cfg.pcie.pcie_location != 0) { 6527 rs = pci_read_config(dev, dinfo->cfg.pcie.pcie_location + 6528 PCIER_DEVICE_STA, 2); 6529 if ((rs & (PCIEM_STA_CORRECTABLE_ERROR | 6530 PCIEM_STA_NON_FATAL_ERROR | PCIEM_STA_FATAL_ERROR | 6531 PCIEM_STA_UNSUPPORTED_REQ)) != 0) { 6532 pci_write_config(dev, dinfo->cfg.pcie.pcie_location + 6533 PCIER_DEVICE_STA, rs, 2); 6534 device_printf(dev, "Clearing PCIe errors 0x%04x\n", rs); 6535 } 6536 } 6537 } 6538 6539 /* 6540 * Perform a Function Level Reset (FLR) on a device. 6541 * 6542 * This function first waits for any pending transactions to complete 6543 * within the timeout specified by max_delay. If transactions are 6544 * still pending, the function will return false without attempting a 6545 * reset. 6546 * 6547 * If dev is not a PCI-express function or does not support FLR, this 6548 * function returns false. 6549 * 6550 * Note that no registers are saved or restored. The caller is 6551 * responsible for saving and restoring any registers including 6552 * PCI-standard registers via pci_save_state() and 6553 * pci_restore_state(). 6554 */ 6555 bool 6556 pcie_flr(device_t dev, u_int max_delay, bool force) 6557 { 6558 struct pci_devinfo *dinfo = device_get_ivars(dev); 6559 uint16_t cmd, ctl; 6560 int compl_delay; 6561 int cap; 6562 6563 cap = dinfo->cfg.pcie.pcie_location; 6564 if (cap == 0) 6565 return (false); 6566 6567 if (!(pci_read_config(dev, cap + PCIER_DEVICE_CAP, 4) & PCIEM_CAP_FLR)) 6568 return (false); 6569 6570 /* 6571 * Disable busmastering to prevent generation of new 6572 * transactions while waiting for the device to go idle. If 6573 * the idle timeout fails, the command register is restored 6574 * which will re-enable busmastering. 6575 */ 6576 cmd = pci_read_config(dev, PCIR_COMMAND, 2); 6577 pci_write_config(dev, PCIR_COMMAND, cmd & ~(PCIM_CMD_BUSMASTEREN), 2); 6578 if (!pcie_wait_for_pending_transactions(dev, max_delay)) { 6579 if (!force) { 6580 pci_write_config(dev, PCIR_COMMAND, cmd, 2); 6581 return (false); 6582 } 6583 pci_printf(&dinfo->cfg, 6584 "Resetting with transactions pending after %d ms\n", 6585 max_delay); 6586 6587 /* 6588 * Extend the post-FLR delay to cover the maximum 6589 * Completion Timeout delay of anything in flight 6590 * during the FLR delay. Enforce a minimum delay of 6591 * at least 10ms. 6592 */ 6593 compl_delay = pcie_get_max_completion_timeout(dev) / 1000; 6594 if (compl_delay < 10) 6595 compl_delay = 10; 6596 } else 6597 compl_delay = 0; 6598 6599 /* Initiate the reset. */ 6600 ctl = pci_read_config(dev, cap + PCIER_DEVICE_CTL, 2); 6601 pci_write_config(dev, cap + PCIER_DEVICE_CTL, ctl | 6602 PCIEM_CTL_INITIATE_FLR, 2); 6603 6604 /* Wait for 100ms. */ 6605 pause_sbt("pcieflr", (100 + compl_delay) * SBT_1MS, 0, C_HARDCLOCK); 6606 6607 if (pci_read_config(dev, cap + PCIER_DEVICE_STA, 2) & 6608 PCIEM_STA_TRANSACTION_PND) 6609 pci_printf(&dinfo->cfg, "Transactions pending after FLR!\n"); 6610 return (true); 6611 } 6612 6613 /* 6614 * Attempt a power-management reset by cycling the device in/out of D3 6615 * state. PCI spec says we can only go into D3 state from D0 state. 6616 * Transition from D[12] into D0 before going to D3 state. 6617 */ 6618 int 6619 pci_power_reset(device_t dev) 6620 { 6621 int ps; 6622 6623 ps = pci_get_powerstate(dev); 6624 if (ps != PCI_POWERSTATE_D0 && ps != PCI_POWERSTATE_D3) 6625 pci_set_powerstate(dev, PCI_POWERSTATE_D0); 6626 pci_set_powerstate(dev, PCI_POWERSTATE_D3); 6627 pci_set_powerstate(dev, ps); 6628 return (0); 6629 } 6630 6631 /* 6632 * Try link drop and retrain of the downstream port of upstream 6633 * switch, for PCIe. According to the PCIe 3.0 spec 6.6.1, this must 6634 * cause Conventional Hot reset of the device in the slot. 6635 * Alternative, for PCIe, could be the secondary bus reset initiatied 6636 * on the upstream switch PCIR_BRIDGECTL_1, bit 6. 6637 */ 6638 int 6639 pcie_link_reset(device_t port, int pcie_location) 6640 { 6641 uint16_t v; 6642 6643 v = pci_read_config(port, pcie_location + PCIER_LINK_CTL, 2); 6644 v |= PCIEM_LINK_CTL_LINK_DIS; 6645 pci_write_config(port, pcie_location + PCIER_LINK_CTL, v, 2); 6646 pause_sbt("pcier1", mstosbt(20), 0, 0); 6647 v &= ~PCIEM_LINK_CTL_LINK_DIS; 6648 v |= PCIEM_LINK_CTL_RETRAIN_LINK; 6649 pci_write_config(port, pcie_location + PCIER_LINK_CTL, v, 2); 6650 pause_sbt("pcier2", mstosbt(100), 0, 0); /* 100 ms */ 6651 v = pci_read_config(port, pcie_location + PCIER_LINK_STA, 2); 6652 return ((v & PCIEM_LINK_STA_TRAINING) != 0 ? ETIMEDOUT : 0); 6653 } 6654 6655 static int 6656 pci_reset_post(device_t dev, device_t child) 6657 { 6658 6659 if (dev == device_get_parent(child)) 6660 pci_restore_state(child); 6661 return (0); 6662 } 6663 6664 static int 6665 pci_reset_prepare(device_t dev, device_t child) 6666 { 6667 6668 if (dev == device_get_parent(child)) 6669 pci_save_state(child); 6670 return (0); 6671 } 6672 6673 static int 6674 pci_reset_child(device_t dev, device_t child, int flags) 6675 { 6676 int error; 6677 6678 if (dev == NULL || device_get_parent(child) != dev) 6679 return (0); 6680 if ((flags & DEVF_RESET_DETACH) != 0) { 6681 error = device_get_state(child) == DS_ATTACHED ? 6682 device_detach(child) : 0; 6683 } else { 6684 error = BUS_SUSPEND_CHILD(dev, child); 6685 } 6686 if (error == 0) { 6687 if (!pcie_flr(child, 1000, false)) { 6688 error = BUS_RESET_PREPARE(dev, child); 6689 if (error == 0) 6690 pci_power_reset(child); 6691 BUS_RESET_POST(dev, child); 6692 } 6693 if ((flags & DEVF_RESET_DETACH) != 0) 6694 device_probe_and_attach(child); 6695 else 6696 BUS_RESUME_CHILD(dev, child); 6697 } 6698 return (error); 6699 } 6700 6701 const struct pci_device_table * 6702 pci_match_device(device_t child, const struct pci_device_table *id, size_t nelt) 6703 { 6704 bool match; 6705 uint16_t vendor, device, subvendor, subdevice, class, subclass, revid; 6706 6707 vendor = pci_get_vendor(child); 6708 device = pci_get_device(child); 6709 subvendor = pci_get_subvendor(child); 6710 subdevice = pci_get_subdevice(child); 6711 class = pci_get_class(child); 6712 subclass = pci_get_subclass(child); 6713 revid = pci_get_revid(child); 6714 while (nelt-- > 0) { 6715 match = true; 6716 if (id->match_flag_vendor) 6717 match &= vendor == id->vendor; 6718 if (id->match_flag_device) 6719 match &= device == id->device; 6720 if (id->match_flag_subvendor) 6721 match &= subvendor == id->subvendor; 6722 if (id->match_flag_subdevice) 6723 match &= subdevice == id->subdevice; 6724 if (id->match_flag_class) 6725 match &= class == id->class_id; 6726 if (id->match_flag_subclass) 6727 match &= subclass == id->subclass; 6728 if (id->match_flag_revid) 6729 match &= revid == id->revid; 6730 if (match) 6731 return (id); 6732 id++; 6733 } 6734 return (NULL); 6735 } 6736 6737 static void 6738 pci_print_faulted_dev_name(const struct pci_devinfo *dinfo) 6739 { 6740 const char *dev_name; 6741 device_t dev; 6742 6743 dev = dinfo->cfg.dev; 6744 printf("pci%d:%d:%d:%d", dinfo->cfg.domain, dinfo->cfg.bus, 6745 dinfo->cfg.slot, dinfo->cfg.func); 6746 dev_name = device_get_name(dev); 6747 if (dev_name != NULL) 6748 printf(" (%s%d)", dev_name, device_get_unit(dev)); 6749 } 6750 6751 void 6752 pci_print_faulted_dev(void) 6753 { 6754 struct pci_devinfo *dinfo; 6755 device_t dev; 6756 int aer, i; 6757 uint32_t r1, r2; 6758 uint16_t status; 6759 6760 STAILQ_FOREACH(dinfo, &pci_devq, pci_links) { 6761 dev = dinfo->cfg.dev; 6762 status = pci_read_config(dev, PCIR_STATUS, 2); 6763 status &= PCIM_STATUS_MDPERR | PCIM_STATUS_STABORT | 6764 PCIM_STATUS_RTABORT | PCIM_STATUS_RMABORT | 6765 PCIM_STATUS_SERR | PCIM_STATUS_PERR; 6766 if (status != 0) { 6767 pci_print_faulted_dev_name(dinfo); 6768 printf(" error 0x%04x\n", status); 6769 } 6770 if (dinfo->cfg.pcie.pcie_location != 0) { 6771 status = pci_read_config(dev, 6772 dinfo->cfg.pcie.pcie_location + 6773 PCIER_DEVICE_STA, 2); 6774 if ((status & (PCIEM_STA_CORRECTABLE_ERROR | 6775 PCIEM_STA_NON_FATAL_ERROR | PCIEM_STA_FATAL_ERROR | 6776 PCIEM_STA_UNSUPPORTED_REQ)) != 0) { 6777 pci_print_faulted_dev_name(dinfo); 6778 printf(" PCIe DEVCTL 0x%04x DEVSTA 0x%04x\n", 6779 pci_read_config(dev, 6780 dinfo->cfg.pcie.pcie_location + 6781 PCIER_DEVICE_CTL, 2), 6782 status); 6783 } 6784 } 6785 if (pci_find_extcap(dev, PCIZ_AER, &aer) == 0) { 6786 r1 = pci_read_config(dev, aer + PCIR_AER_UC_STATUS, 4); 6787 r2 = pci_read_config(dev, aer + PCIR_AER_COR_STATUS, 4); 6788 if (r1 != 0 || r2 != 0) { 6789 pci_print_faulted_dev_name(dinfo); 6790 printf(" AER UC 0x%08x Mask 0x%08x Svr 0x%08x\n" 6791 " COR 0x%08x Mask 0x%08x Ctl 0x%08x\n", 6792 r1, pci_read_config(dev, aer + 6793 PCIR_AER_UC_MASK, 4), 6794 pci_read_config(dev, aer + 6795 PCIR_AER_UC_SEVERITY, 4), 6796 r2, pci_read_config(dev, aer + 6797 PCIR_AER_COR_MASK, 4), 6798 pci_read_config(dev, aer + 6799 PCIR_AER_CAP_CONTROL, 4)); 6800 for (i = 0; i < 4; i++) { 6801 r1 = pci_read_config(dev, aer + 6802 PCIR_AER_HEADER_LOG + i * 4, 4); 6803 printf(" HL%d: 0x%08x\n", i, r1); 6804 } 6805 } 6806 } 6807 } 6808 } 6809 6810 #ifdef DDB 6811 DB_SHOW_COMMAND_FLAGS(pcierr, pci_print_faulted_dev_db, DB_CMD_MEMSAFE) 6812 { 6813 6814 pci_print_faulted_dev(); 6815 } 6816 6817 static void 6818 db_clear_pcie_errors(const struct pci_devinfo *dinfo) 6819 { 6820 device_t dev; 6821 int aer; 6822 uint32_t r; 6823 6824 dev = dinfo->cfg.dev; 6825 r = pci_read_config(dev, dinfo->cfg.pcie.pcie_location + 6826 PCIER_DEVICE_STA, 2); 6827 pci_write_config(dev, dinfo->cfg.pcie.pcie_location + 6828 PCIER_DEVICE_STA, r, 2); 6829 6830 if (pci_find_extcap(dev, PCIZ_AER, &aer) != 0) 6831 return; 6832 r = pci_read_config(dev, aer + PCIR_AER_UC_STATUS, 4); 6833 if (r != 0) 6834 pci_write_config(dev, aer + PCIR_AER_UC_STATUS, r, 4); 6835 r = pci_read_config(dev, aer + PCIR_AER_COR_STATUS, 4); 6836 if (r != 0) 6837 pci_write_config(dev, aer + PCIR_AER_COR_STATUS, r, 4); 6838 } 6839 6840 DB_COMMAND_FLAGS(pci_clearerr, db_pci_clearerr, DB_CMD_MEMSAFE) 6841 { 6842 struct pci_devinfo *dinfo; 6843 device_t dev; 6844 uint16_t status, status1; 6845 6846 STAILQ_FOREACH(dinfo, &pci_devq, pci_links) { 6847 dev = dinfo->cfg.dev; 6848 status1 = status = pci_read_config(dev, PCIR_STATUS, 2); 6849 status1 &= PCIM_STATUS_MDPERR | PCIM_STATUS_STABORT | 6850 PCIM_STATUS_RTABORT | PCIM_STATUS_RMABORT | 6851 PCIM_STATUS_SERR | PCIM_STATUS_PERR; 6852 if (status1 != 0) { 6853 status &= ~status1; 6854 pci_write_config(dev, PCIR_STATUS, status, 2); 6855 } 6856 if (dinfo->cfg.pcie.pcie_location != 0) 6857 db_clear_pcie_errors(dinfo); 6858 } 6859 } 6860 #endif 6861