Searched refs:KPF (Results 126 – 144 of 144) sorted by relevance
123456
| /dports/biology/emboss/EMBOSS-6.6.0/test/data/structure/ |
| H A D | Epdbtosp.dat | 71246 EN 1KPF
|
| /dports/deskutils/calibre/calibre-src-5.34.0/translations/calibre/ |
| H A D | sk.po | 6749 "Extract the source DOCX file from Amazon Kindle Create KPF files. Note this "
|
| H A D | da.po | 6742 "Extract the source DOCX file from Amazon Kindle Create KPF files. Note this "
|
| H A D | et.po | 6741 "Extract the source DOCX file from Amazon Kindle Create KPF files. Note this "
|
| H A D | eu.po | 6750 "Extract the source DOCX file from Amazon Kindle Create KPF files. Note this "
|
| H A D | ro.po | 6742 "Extract the source DOCX file from Amazon Kindle Create KPF files. Note this "
|
| H A D | is.po | 6741 "Extract the source DOCX file from Amazon Kindle Create KPF files. Note this "
|
| H A D | en_GB.po | 6742 "Extract the source DOCX file from Amazon Kindle Create KPF files. Note this "
|
| H A D | hu.po | 6768 "Extract the source DOCX file from Amazon Kindle Create KPF files. Note this "
|
| H A D | ms.po | 6736 "Extract the source DOCX file from Amazon Kindle Create KPF files. Note this "
|
| H A D | tr.po | 6761 "Extract the source DOCX file from Amazon Kindle Create KPF files. Note this "
|
| H A D | de.po | 6816 "Extract the source DOCX file from Amazon Kindle Create KPF files. Note this "
|
| H A D | ca.po | 6763 "Extract the source DOCX file from Amazon Kindle Create KPF files. Note this "
|
| /dports/audio/rhvoice/RHVoice-1.2.4/src/third-party/cldr/tools/java/org/unicode/cldr/util/data/external/ |
| H A D | 2013-1_UNLOCODE_CodeListPart3.csv | 557 ,"PG","KPF","Kondubol","Kondubol",,"---4----","RL","0907",,"1012S 14942E",
|
| H A D | 2013-1_UNLOCODE_CodeListPart1.csv | 21095 ,"DE","KPF","Kipfenberg","Kipfenberg","BY","1-3-----","RL","0701",,"4857N 01123E",
|
| /dports/science/py-oddt/oddt-0.7/oddt/toolkits/extras/ |
| H A D | pdb_residue_templates.smi | 17043 NC(CCCCN=C(CF)C(=O)O)C(=O)O KPF
|
| /dports/security/hashcat-legacy/hashcat-legacy-2.00/salts/ |
| H A D | brute-vbulletin.salt | 392674 KPF
|
| /dports/astro/weather/weather-2.4.2/ |
| H A D | airports.csv | 12363 …l Airport",-8.5336,142.5049,132,"OC","PG","PG-WPD","Kondobol","no","AYDL","KPF","KDB",,,"Kondubol,…
|
| /dports/devel/cld2/cld-20150505/internal/ |
| H A D | test_shuffle_1000_48_666.utf8 | 62397 …ata BAM tidak mempunyai ~ pertandingan ratu cantik selagi ada pihak yang ~ KPF namun dalam masa ya…
|
123456